Answered: Lamar measures out 1.697 g of NaCl to…

Lamar measures out 1.697 g of NaCl to add to his pot of boiling water for his pasta. How many moles of NaCl did Lamar add to his boiling water? The molar mass of NaCl is 58.44 g/mol.

Chemistry In Focus

7th Edition

ISBN:9781337399692

Author:Tro, Nivaldo J.

Publisher:Tro, Nivaldo J.

Chapter4: Molecules, Compounds, And Chemical Reactions

Section: Chapter Questions

Problem 4SC

See similar textbooks

Related questions

Q: Which statement is true of the atom with an electron configuration of 1s2 2s2 2p6 3s1? This is the…

A: The electron configuration 1s2 2s2 2p6 3s1 corresponds to the element sodium (Na), which has 11…

Q: H₂SO, Œ

Q: How many moles are there in 4.31 × 10¹2 molecules of sucrose C12H22011? (1 mole = 6.022 x 1023…

Q: Give the IUPAC name for the following compound. Click here to preview the image لیلا…

A: Since you have asked multiple type questions, we will solve only first questions for you. If you…

Q: A chemistry graduate student is studying the rate of this reaction: NH,OH(aq) →NH, (aq)+H,O(aq) He…

Q: OH

A: IUPAC stands for the International Union of Pure and Applied Chemistry, which is an international…

Q: Express the molality to two significant figures. molality = 0.66 m NaCl Submit Previous Answers All…

Q: The rate of the following reaction in aqueous solution is monitored by measuring the number of moles…

A: The sum of the exponent term in the rate law for a chemical reaction is known as the order of the…

Q: 17 eBook Print References Be sure to answer all parts. Predict the product of the following reaction…

A: Primary alcohol react with HBr to give alkyl bromide

Q: Answer the following questions: 1. What is the optimum pH for catalase? 2. Why does the reaction…

A: The enzymes are generally very pH sensitive. Their activity is dependent on pH.

Q: 12. A radioactive substance has a half-life of 24 years. If you begin with a 1000 g sample, how much…

A: Since you have posted multiple questions, we will provide the solution only to the first question as…

Q: Consider the di-substituted cyclohexane structure: to Now, place the isopropyl group and bromine in…

A: For getting most Stable, low energy conformation we place the substituents in equatorial positions…

Q: Reaction 2 Initial temp (HCl) 26.7 celsius Initial temp (NaOH) Average initial temp Final…

A: Heat of reaction 2:

Q: A solution is made by dissolving 25.7 g of cobalt(II) iodide, CoI2, in enough water to make exactly…

A: Consider the given information as follows; Mass of cobalt (II) iodide, CoI2 = 25.7 g Volume of…

Q: 2) In the lecture we have proved that for an ideal gas Cp,m = Cv,m + R. In the general case (i. e.,…

A: Given that, the relation between two molar heat capacities is Cp,m = CV, m + α2VmTκ, where Vm = Vn.…

Q: (b) Construct a valence MO diagram for the pi bonding in the trigonal planar molecule BF3; to…

A: Answer :---

Q: Using only the periodic table arrange the following elements in order of increasing atomic radius:…

A: Atomic radius - It is the distance between nuclei of an atom to the valence electron of an atom. It…

Q: Lewis structure of NF2^1-

A: We have to draw the Lewis structure of NF2-

Q: (1) Mechanism. Provide the mechanism for the following reaction. 'H HS SH H₂SO (cat.)

A: This reaction is the acid catalyzed formation of the 1,3-dithianes. For this aldehyde and…

Q: Assuming that 8.575 kg of NaCl (Hint: NaCl is a strong electrolyte) is distributed across a roadway,…

A: Freezing point determination using colligative properties.

Q: Determine how many liters of nitrogen will be required to produce 222.7 liters of ammonia. The…

A: Given, volume of ammonia(NH3) produced = 222.7 L we know that if the temperature and pressure is…

Q: Assume you are stuck in lab with only 17.6 g of aluminum chloride and 32.0 g of Potassium Chromate.…

Q: Papaverine hydrochloride (abbreviated papH+Cl"; molar mass 378.85 g/mol) is a drug that belongs to a…

A: Given: The molar mass of papH+Cl- is 378.85 g/mol. The concentration of papH+Cl- is 40.0 mg/mL. The…

Q: Label the following compounds as ionic or molecular and name them appropriately. 1) Na2SO4 2)…

A: Check the names of polyatomic ions in the given molecule and give the name appropriately.

Q: 10 attempts left CH3CH₂CH₂CH₂OH Click in the answer box to activate the palette. Write the organic…

A: In this question, we will draw the structure of the organic product from the Reaction between…

Q: O Macmillan Learning Calculate the energy change of the reaction shown. Use the list of bond…

A: bond enthalpies of H–H= 435 kJ mol–1 Br–Br= 192 kJ mol–1 H–Br = 364 kJ mol–1

Q: The combustion of propane may be described by the chemical equation C3H, (g) +50₂ (g 3 CO₂(g) +…

Q: Outline a feasible laboratory synthesis of 2-ethylcyclohexanone (shown below) starting with…

A: The given conversion can be explained as:

Q: Hydroxyapatite, Ca10(PO4)6(OH)2 , has a solubility constant of Ksp = 2.34×10−59, and dissociates…

A: Given: Solubility constant of hydroxyapatite is 2.34×10-59. [OH−] is fixed at 9.60×10-4 M.

Q: The reaction A+B⟶C+D rate=?[A][B]2 has an initial rate of 0.0860 M/s What will the…

A: In this question, we are given a chemical reaction with a rate law expressed in terms of the…

Q: Which, if any of the following, constitute a closed system? (a) A sealed container in which a…

A: A closed system is one in which no matter can enter or leave, but energy can be exchanged with the…

Q: Q3. Identify three sources of radiation that have a significant effect on your own total exposure.…

A: This answer identifies three common sources of radiation that can have a significant effect on an…

Q: Hi there my key says these molecules are enantiomers but I don't understand how, do you think this…

A: Given that, two compounds are We have to give the relationship between the above two molecules.…

Q: At a certain temperature the vapor pressure of pure thiophene (C₂H4S) is measured to be 0.61 atm.…

Q: Lewis structure of SiI4

Q: Arrange the atoms and/or ions in the following groups in order of decreasing size. (Express your…

A: The concept used in the above question is the relationship between atomic or ionic radius and the…

Q: a Calculate the total molarity of the following solution: 0.071 M MgBr₂. (Enter your answer to two…

Q: How many moles of Ca3(PO4)2 will be produced if 0.803 g of H3PO4 are reacted completely?

Q: For the following molecules, draw all possible stereoisomers using line-angle formulas with…

A: Enantiomers are isomers that are non-superimposable mirror images of eachother and have exact…

Q: 6. Which is heaviest? (a) 1 mole N₂ (b) 28 g N₂ (c) 1 mole S (d) 6.02 x 103 atoms of H (e) 1.5 moles…

A: Since you have posted multiple questions, we can solve only first question for you according to the…

Q: 21) What mass of MgF2 is contained in 75.85 g of a 22.4% by mass solution of MgF2 in water? A) 5.89…

A: Mass of MgF2= ? Mass of solution of MgF2 in water = 75.85g Mass percent= 22.4%

Q: 3. Describe the TWO methods you'll use to confirm that you successfully dehydrated cyclohexanol to…

A: Catalyst used in this reaction is H3PO4 and heat is required for conversaio of cyclohexanol to…

Q: How many moles of HCI are there in 75.0 mL of 0.285 M HCI?

A: The formula which we will use to calculate the moles of HCl is => molarity of HCl = moles of HCl…

Q: A K2SO4 solution is prepared by weighing out a certain amount of the pure solid reagent, dissolving…

A: Given that the concentration of K+ in the final solution is 0.100 %(w/v). The final solution is made…

Q: A certain substance X has a normal boiling point of 105.9 °C and a molal boiling point elevation…

Q: draw out the reactions for synthesis of 2,6 dinitroaniline. show the necessary reagents used in the…

Q: 3. Which carbon-metal bond has the largest ionic character? (Given: electronegativities: C 2.5, Al…

A: Since, If difference of two atom electronegativity value which can form bond is largest then it's…

Q: (a) Draw an orthorhombic unit cell, and within that cell a (210) plane. (b) Draw a monoclinic unit…

A: unit Cell: Unit Cell is the smallest part (portion) of a crystal lattice. It is the simplest…

Q: Lewis structure of SO4^2-

A: Introduction In chemistry, a Lewis structure is a graphical representation of the electron…

Concept explainers

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.

Question

Lamar measures out 1.697 g of NaCl to add to his pot of boiling water for his pasta. How many moles of NaCl did Lamar add to his boiling water?

The molar mass of NaCl is 58.44 g/mol.

Expert Solution

Step 1

Given is

mass of NaCl added = 1.697 g

molar mass of NaCl = 58.44 g/mol

We need to calculate the number of moles in added NaCl.

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Consider the following diagram, where atom X is represented by a square and atom Y is represented by a circle. (a) Write the equation for the reaction represented by the diagram. (b) If each circle stands for a mole of Y and each square a mole of X, how many moles of X did one start with? How many moles of Y? (c) Using the same representation described in part (b), how many moles of product are formed? How many moles of X and Y are left unreacted?
Freon- 12 (CCI2F2) is used as a refrigerant in air conditioners and as a propellant in aerosol cans. Calculate the number of molecules of Freon-12 in 5.56 mg of Freon-12. What is the mass of chlorine in 5.56 mg of Freon-12?
Phosphoric acid, one of the acids used in some cola drinks, is produced by the reaction of phosphorus(V) oxide, an acidic oxide, with water. Phosphorus(V) oxide is prepared by the combustion of phosphorus. (a) Write the empirical formula of phosphorus(V) oxide. (b) What is the molecular formula of phosphorus(V) oxide if the molar mass is about 280. (c) Write balanced equations for the production of phosphorus(V) oxide and phosphoric acid. (d) Determine the mass of phosphorus required to make 1.00104 kg of phosphoric acid, assuming a yield of 98.35%.
Which of the following has the largest number of molecules? a 1 g of benzene, C6H6 b l g of formaldehyde, CH2O c l g of TNT, C7H3N3O6 d l g of naphthalene, C10H8 e l g of glucose, C6H12O6
Calculate the molarity of solutions prepared by dilution or calculate the quantities needed to carry out a dilution to prepare a solution of a specified concentration.
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Moles within Moles and Molar Mass Part 1: a How many hydrogen and oxygen atoms are present in 1 molecule of H2O? b How many moles of hydrogen and oxygen atoms are present in 1 mol H2O? c What are the masses of hydrogen and oxygen in 1.0 mol H2O? d What is the mass of 1.0 mol H2O? Part 2: Two hypothetical ionic compounds are discovered with the chemical formulas XCl2 and YCl2, where X and Y represent symbols of the imaginary elements. Chemical analysis of the two compounds reveals that 0.25 mol XCl2 has a mass of 100.0 g and 0.50 mol YCl2 has a mass of 125.0 g. a What are the molar masses of XCl2 and YCl2? b If you had 1.0-mol samples of XCl2 and YCl2, how would the number of chloride ions compare? c If you had 1.0-mol samples of XCl2 and YCl2, how would the masses of elements X and Y compare? d What is the mass of chloride ions present in 1.0 mol XCl2 and 1.0 mol YCl2? e What are the molar masses of elements X and Y? f How many moles of X ions and chloride ions would be present in a 200.0-g sample of XCl2? g How many grams of Y ions would be present in a 250.0-g sample of YCl2? h What would be the molar mass of the compound YBr3? Part 3: A minute sample of AlCl3 is analyzed for chlorine. The analysis reveals that there are 12 chloride ions present in the sample. How many aluminum ions must be present in the sample? a What is the total mass of AlCl3 in this sample? b How many moles of AlCl2 are in this sample?
Write the balanced chemical equation for the complete combustion of heptene, C7H14. In combustion, hcpLcnc reacts with oxygen to produce carbon dioxide and water. What is the mole ratio that would enable you to calculate the number of moles of oxygen needed to react exactly with a given number of moles of heptene? What mole ratios would you use to calculate how many moles of each product form from a given number of moles of heptene?
Billions of pounds of urea, CO(NH2)2, are produced annually for use as a fertilizer. The principal reaction employed is: 2NH3+CO2CO(NH2)2+H2O By assuming unlimited amounts of CO2, how many moles of urea can be produced from each of the following amounts of NH3? a.2molNH3b.0.45molNH3c.10gNH3d.2.0kgNH3
Over the years, the thermite reaction has been used for welding railroad rails, in incendiary bombs, and to ignite solid-fuel rocket motors. The reaction is Fe2O3(s)+2Al(s)2Fe(l)+Al2O3(s) What masses of iron(III) oxide and aluminum must be used to produce 15.0 g iron? What is the maximum mass of aluminum oxide that could be produced?
3.105 Nitric acid is often sold and transported as a concentrated 16 M aqueous solution. How many gallons of such a solution would be needed to contain the roughly 2.1109 pounds of HNO3 produced annually in the United States?
For the chemical reaction C3H8O2+4O23CO2+4H2O how many product molecules are formed when nine C3H8O2 molecules react?