LOSCIOU In carbon combustion, the oxidation of solid carbon to produce carbon monoxide is represented below: noi olimondogyd ad ot 1100qan div not 2C(s)+O2(g)→2CO(g) Use the following reaction enthalpies to find the enthalpy of the above reaction. C(s)+O2(g)>CO2(g) AH=-394 kJ 2CO2(g) 2C0(g)+O2(g) AH=+283 kJ aten ai senoni blot- noitase lo stm odt ni the ligeid sttete s

LOSCIOU In carbon combustion, the oxidation of solid carbon to produce carbon monoxide is represented below: noi olimondogyd ad ot 1100qan div not 2C(s)+O2(g)→2CO(g) Use the following reaction enthalpies to find the enthalpy of the above reaction. C(s)+O2(g)>CO2(g) AH=-394 kJ 2CO2(g) 2C0(g)+O2(g) AH=+283 kJ aten ai senoni blot- noitase lo stm odt ni the ligeid sttete s

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter4: Energy And Chemical Reactions

Section: Chapter Questions

Problem 65QRT

See similar textbooks

Similar questions

sample of natural gas is analyzed and found to be88.4% methane (CH4) and 11.6% ethane (C2H6) bymass. The standard enthalpy of combustion of methaneto gaseous carbon dioxide (CO2) and liquid water (H2O) is -891 kJ/mol. Write the equation for the combustionof gaseous ethane to carbon dioxide and water.Calculate the standard enthalpy of combustion of ethaneusing standard enthalpies of formation from Table R-11on page 975. Using that result and the standard enthalpyof combustion of methane in Table 15.3, calculate theenergy released by the combustion of 1 kg of natural gas.
Calculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
Write reactions for which the enthalpy change will be a. Hf for solid aluminum oxide. b. the standard enthalpy of combustion of liquid ethanol, C2H5OH(l). c. the standard enthalpy of neutralization of sodium hydroxide solution by hydrochloric acid. d. Hf for gaseous vinyl chloride, C2H3Cl(g). e. the enthalpy of combustion of liquid benzene, C6H6(l). f. the enthalpy of solution of solid ammonium bromide.
Is the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)
Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
A cubic piece of uranium metal (specific heat capacity = 0.117 J/C g) at 200.0C is dropped into 1.00 L deuterium oxide ("heavy water;" specific heat capacity = 4.21 I J/C g) at 25.5C. The final temperature of the uranium and deuterium oxide mixture is 28.5C. Given the densities of uranium (19.05 g/cm3) and deuterium oxide (1.11 g/mL). what is the edge length of the cube of uranium?
Starting with equation 2.27 andthe original definitionof enthalpy, derive the fact that Cp-=Cv-+R