16? P= 0.98 atmo?n = 655g CH4 -) moles 40.84R= 0.0821= Kx 16. Methane, CH4, is being considered for use as an alternative automotive fuel to replace gasoline. One gallon ofgasoline could be replaced by 655 g of CH4. What is the volume of this much methane at 25 °C and 745 torr?PV=nRT745 torr 1 atm6.98 am)(u) = 16.84 moles) (0.821 m) (298k)0.980.98 atm98U=0.9604 V = 9791.9960660.96040.9604= 10195.7476710196L CH17. Iodine, I2, is a solid at room temperature but sublimes (converts from a solid into a gas) when warmed. What is thetemperature in a 73.3-mL bulb that contains 0.292 g of 1₂ vapor at a pressure of 0.462 atm? PART0.462 atm(0.462 am)(0.07330)=6.0115065122m) (082) (1) 73.3m²| IL0.03 38646-9.445705162×10³T1000P=V= 73.3mL) L 0.0733Ln = 0.2929 1₂ -0.0011505122 mois 9.445705162x105R=0.0821T= ?T= 358.518495118. How many grams of gas are present in 0.100 L of CO₂ at 307 torr and 26 °C?359 KPV=nRT(040am)(.lcoL) tn[,0,0%2 (240)P= 0.40 T = 299k24.547900.040424.5479The triple point temperature: -75 °CThe state of the gas at -65°C and 9,000kPa: liquid24.5479 = 0.0016457626.00 164578 mois Co> 44.01960₂moisPressure (kPa)1,000,000-100,000-V=100 Ln= ? gramsR = 0.0821-0.072 g CO₂19. An unknown gas effuses 1.66 times more rapidly than CO₂. What is the molar mass of the unknown gas?Rate A√mmB(1536 ) (144)니니44g/m01.03Bate B mmA15.94g/mc) CH4X2.7610,000-1000-6559 CH4 ImaCHy = 40.84Півондени100-445705162x10-5Solidunknown ges S CH420. Arrange each the following set of compounds in order of increasing boiling point temperature and explain yourthe arrangement ofreasoning: HCl, H₂O, SiH4Stronger the bend +Theboiling point depends onthere fore theSi Hy< Hc< H₂0higher the boiling paint will be.10--100 -75-50H₂o has the highest boiling point because it has hydrogen bonds and hydrebonds are the strongest intermolecularwhich in this case have the SecondPhase21. Use the followingbond of a molecule: HCI is polar coldierstrongest bond / second strongest highest baPaint. S. Hy has the lowest boiling paintBOTGR covalent bonds wdiagram for carbon dioxide to indicate: en boitthe triple point pressure: 100K PaLiquid0 TcTemperature ("C)760 torr26°C+273=299K=0.98 atm50307 tom latmSCF0.292932 | Mol 1₂ = 0.0011253.89 22 90512= 0.0733L100760 forr = 0.404atmat +65°C and 11,000 kPa: Supercritfiu(sc

Answered: Image /qna-images/answer/dcc67e7e-2cae-43a1-8ffd-ea4803bff2ab.jpg

n = 6559 CH4 → moles 40.84 0.0821 R= T= 25% +273 = 298 K X 16. Methane, CH4, is being considered for use as an alternative automotive fuel to replace gasoline. One gallon of gasoline could be replaced by 655 g of CH4. What is the volume of this much methane at 25 °C and 745 tom? PV=nRT 655g CHy ImaCHy = 46.84 Півондени 745 760 ON torr 1 atm = 0.98 atm 98 atm V = ? 0.98 am)(u) = 40.84 moles) (0.82101) (298k) 0.98 atm98 U= 0.9604 V = 9791.996०७७ 0.9604 0.9604 17. Iodine, I₂, is a solid at room temperature but sublimes (converts from a solid into a gas) when w temperature in a 73.3-mL bulb that contains 0.292 g of 1₂ vapor al P= 0.462 atm = 10195.74767 101961 CH₂

n = 6559 CH4 → moles 40.84 0.0821 R= T= 25% +273 = 298 K X 16. Methane, CH4, is being considered for use as an alternative automotive fuel to replace gasoline. One gallon of gasoline could be replaced by 655 g of CH4. What is the volume of this much methane at 25 °C and 745 tom? PV=nRT 655g CHy ImaCHy = 46.84 Півондени 745 760 ON torr 1 atm = 0.98 atm 98 atm V = ? 0.98 am)(u) = 40.84 moles) (0.82101) (298k) 0.98 atm98 U= 0.9604 V = 9791.996०७७ 0.9604 0.9604 17. Iodine, I₂, is a solid at room temperature but sublimes (converts from a solid into a gas) when w temperature in a 73.3-mL bulb that contains 0.292 g of 1₂ vapor al P= 0.462 atm = 10195.74767 101961 CH₂

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter5: Gases

Section: Chapter Questions

Problem 5.101PAE

See similar textbooks

Similar questions

In the Mthode Champenoise, grape juice is fermented in a wine bottle to produce sparkling wine. The reaction is C6H12O6(aq)2C2H5OH(aq)+2CO2(g) Fermentation of 750. mL grape juice (density = 1.0 g/cm3) is allowed to take place in a bottle with a total volume of 825 mL until 12% by volume is ethanol (C2H5OH). Assuming that the CO2 is insoluble in H2O (actually, a wrong assumption), what would be the pressure of CO2 inside the wine bottle at 25C? (The density of ethanol is 0.79 g/cm3.)
5-114 Carbon dioxide gas, saturated with water vapor, can be produced by the addition of aqueous acid to calcium carbonate based on the following balanced net ionic equation: (a) How many moles of wet CO (g), collected at 60.°C and 774 torr total pressure, are produced by the complete reaction of 10.0 g of CaCO3 with excess acid? (b) What volume does this wet CO2 occupy? (c) What volume would the CO2 occupy at 774 torr if a desiccant (a chemical drying agent) were added to remove the water? The vapor pressure of water at 60.°C is 149.4 mm Hg.
5-107 If 60.0 g of NH3 occupies 35.1 L under a pressure of 77.2 in. Hg, what is the temperature of the gas, in °C?
You have an equimolar mixture of the gases SO2 and O2, along with some He, in a container fitted with a piston. The density of this mixture at STP is 1.924 g/L. Assume ideal behavior and constant temperature and pressure. a. What is the mole fraction of He in the original mixture? b. The SO2 and O2 react to completion to form SO3. What is the density of the gas mixture after the reaction is complete?
Ethanol, C2H5OH, is produced industrially from ethylene, C2H4, by the following sequence of reactions: 3C2H4+2H2SO4C2H5HSO4+( C 2 H 5)2SO4C2H5HSO4+( C 2 H 5)2SO4+3H2O3C2H5OH+2H2SO4 What volume of ethylene at STP is required to produce 1.000 metric ton (1000 kg) of ethanol if the overall yield of ethanol is 90.1%?
Ethanol, the alcohol used in automobile fuels, is produced by the fermentation of sugars present in plants. Corn is often used as the sugar source. The following equation represents the fermentation of glucose, the sugar in corn, by yeast to produce ethanol and carbon dioxide. C6H12O6(aq)2C2H5OH(aq)+2CO2(g) Ethanol is combusted in an automobile engine according to the equation C2H5OH(l)+3O2(g)2CO2(g)+3H2O(g) What would be the total volume of CO2 gas formed at STP when 3.00 kg of sugar is fermented and the ethanol is then combusted in an automobile engine?