PLEASE--HELPP Part ACalculate the standard cell potential for each of the following electrochemical cells.Standard Electrode Potentials at 25 °CE° (V)2 Ag*(ag) + Pb(s) → 2 Ag(s) + Pb²+ (ag)Reduction half-reactionAg+(aq) +e¯ →Ag(s)0.80Express your answer using two decimal places and include the appropriate units.Pb2+ (aq) + 2 e- →Pb(s)-0.13ClO2(9) +e¯ →ClO2¯(aq)0.95HÀ?I2(s) +2 e →2I-(aq)0.54Zn²++ (s) +2 e¯ →Zn(s)E ell =ValueUnits-0.76O2 (9) + 4 H† (ag) + 2 e¯ →2 H2O(1)1.23SubmitRequest Answer

In this question we will be calculating electrochemical potential of the given reaction which came…

Part A Calculate the standard cell potential for each of the following electrochemical cells. Standard Electrode Potentials at 25 °C Reduction half-reaction E° (V) 2 Ag* (ag) + Pb(s) → 2 Ag(s) + Pb²+ (aq) Ag*(aq) +e →Ag(s) 0.80 Express your answer using two decimal places and include the appropriate units. РЬ (аg) + 2 е —РЫ(8) ClO2 (9) + e →CIO2 (ag) I2(8) + 2 e +2I (aq) Zn²+ (s) +2 e¯ →Zn(s) -0.13 0.95 ? 0.54 Eell = Value Units -0.76 O2(9) + 4 H† (aq) +2 e →2 H2O(1) 1.23 Submit Request Answer

Part A Calculate the standard cell potential for each of the following electrochemical cells. Standard Electrode Potentials at 25 °C Reduction half-reaction E° (V) 2 Ag* (ag) + Pb(s) → 2 Ag(s) + Pb²+ (aq) Ag*(aq) +e →Ag(s) 0.80 Express your answer using two decimal places and include the appropriate units. РЬ (аg) + 2 е —РЫ(8) ClO2 (9) + e →CIO2 (ag) I2(8) + 2 e +2I (aq) Zn²+ (s) +2 e¯ →Zn(s) -0.13 0.95 ? 0.54 Eell = Value Units -0.76 O2(9) + 4 H† (aq) +2 e →2 H2O(1) 1.23 Submit Request Answer

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter20: Electrochemistry

Section20.1: Voltaic Cells

Problem 13SSC

See similar textbooks

Similar questions

Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Consider a cell reaction at 25°C where n=4 . Fill in the following table.
Consider a cell reaction at 25°C where n=2 . Fill in the following table.