Part B Write the correct formulas for the products for reaction: An aqueous solution of calcium chloride is mixed with aqueous potassium carbonate to produce solid calcium carbonate and aqueous potassium chloride. Express your answers as chemical formulas separated by a comma | ΑΣΦ Submit Part C Request Answer Write a balanced equation for reaction An aqueous solution of calcium chloride is mixed with aqueous potassium carbonate to produce solid calcium carbonate and aqueous potassium chloride Express your answer as a chemical equation. Identify all of the phases in your answer. AE ? A chemical reaction does not occur for this question Submit Request Answer

Q: Explain what Tollen's test is all about.

A: We have been asked about Tollens test. In chemistry, there are various qualitative  tests that are…

Q: ZnCl₂ (aq) + 2Na (s) - Zn (s) + 2NaCl(aq) CuCl,(aq) + Mg(s) → MgCl,(aq) + Cu(s) Ca(s) + ZnCl₂ (aq) →…

A: When a reactant is oxidized, the oxidation number of elements in the reactant increases.  When a…

Q: Answer the questions in the table below about the shape of the xenon tetrafluoride (XeF4) molecule.…

A: we have to determine the total electron groups and arrangement of the electron groups in XeF4

Q: НО, multiple steps НО, Que What are the synthesis steps for above?

A:

Q: A 0.16-g sample of a purified protein is dissolved in water to give 2.0 mL of solution. The osmotic…

A: Given:- mass of solute= 0.16 g Volume(V) = 2 mL = 0.002 L  Osmotic presure (π) = 18.1 torr =…

Q: The instructions were to define if the molecule was aromatic or antiaromatic. If the element (such…

A: Answer of this question :-

Q: What quantity in moles of Li₂S will be required to completely react with 51.8 mL of 0.100 M…

A: Lithium sulfide reacts with iron(III) nitrate to form iron(II) sulfide and lithium nitrate. The…

Q: The following mechanism has been proposed for the reaction between nitrogen monoxide and oxygen in…

A: Given,  Step.1 :- 2NO ----> N2O2  Step.2 :- N2O2 + O2 ------> 2NO2  (a). Identify the…

Q: What is the role of helium gas in gas chromatography? O stationary phase O It does not play a role…

A:

Q: Chemistry Propose synthetic route using the starting material(s) on the left. Eto 8. 0. l. l OEt H…

A:

Q: ALCOHOLS 1. WHY IS ETHANOL MORE SOLUBLE IN WATER THAN 1-HEXANOL? 2. WHAT IS DENATURED ALCOHOL? AND…

A: Given:  ALCOHOLS 1- ETHANOL IS MORE SOLUBLE IN WATER THAN 1-HEXANOL We have to write why ethanol is…

Q: 5. Suggest mechanisms for these reactions, commenting on the choice of reagents and solvents. How…

A:

Q: CH3CH₂CH(CH2CH3)CH₂CH₂CH3 Draw the molecule on the canvas by choosing buttons from the Tools (for…

A: Given -> 1-> CH3CH2CH(CH2CH3)CH2CH2CH3 2-> CH3CH(CH3)CH2CH2OH

Q: Multiply or divide the following measurements. Be sure each answer you enter contains the correct…

A: Question is about the measurements. We have to calculate the multiplication value and division value…

Q: Ammonium perchlorate (NH4ClO4) is a powerful solid rocket fuel, used in the Space Shuttle boosters.…

A: Concept:  Any reaction ,first should be balanced by taking equal number of atoms on both side to…

Q: ASAP What are the IUPAC name of the following?

A: A question based on nomenclature that is to be accomplished.

Q: Using the Rydberg calculate the emission wavelengths and state the region of the electromagnetic…

A: For the hydrogen like atom the electronic transition occurs between n2 and n1. If the corresponding…

Q: Why is it hard to obtain the melting point of caffeine?

A: To answer: Why is it hard to obtain the melting point of caffeine?

Q: Convert 1.53 x 1024 atoms of carbon to moles of carbon. 1.53 x 1024 atoms = x10 TOOLS mol C

A: Given,  Number of atoms of carbon = 1.53 x 1024 atoms  Find number of moles of carbon = ?  Using the…

Q: Ⓒ Macmillan Learning A silver ring is composed of 3.01 x 1023 atoms. Calculate the mass of the ring…

A:

Q: 4.1 4.2 4. Classify the following molecules as: (Write the letter answers only) A. Constitutional…

A:

Q: h) Find Moles of Reaction (Mg is the limiting reagent, so calc how many moles of Mg reacted from…

A: The heat released or absorbed (q) when the temperature of any substance is raised is calculated as:…

Q: 3. An injection (ARANESP) contains in each millilitre, 60 ug of darbepoetin alpha, 0.05 mg of…

A: According to given question,

Q: b. Identify the electron donor, electron acceptor, the type of metabolism/nutrient type and whether…

A:

Q: What is the IUPAC name of this organic compound?

A: The IUPAC name of the compound can be written on the basis of the number of carbon atoms in the main…

Q: As a particle geometry deviates from that of a sphere (MW unchanged), the result on the…

A: Sedimentation coefficient is the ratio of particle's sedimentation velocity to aplied…

Q: HO. multiple steps HO. what is synthesis for above?

A:

Q: 2. Determine the empirical formula of the oxide of nickel, showing your work cle 3. Name the…

A: Please find your solution below : Empirical formula of a compound is the formula that gives only the…

Q: Table sugar (sucrose) is hydrolyzed to form glucose (a simple sugar) according to the following…

A: Given thermo chemical reactions are : 1) C12H22O11(s)+1202(g)-->12CO2(g)+ 11H₂O(g) ;…

Q: ortal https://app.101edu.co ii Handshake 121 D2L Ch. 1 Introduction -... Aktiv Chemistry Connect-Bio…

A: • The neutralization reaction is :-      Ba(OH)2 + 2 HNO3 ---> Ba(NO3)2 + 2 H2O…

Q: How many molecules are in 1.7 moles of ammonia, NH3? a) 1.0x1024 molecules b) 3.5x1023 molecules c)…

A:

Q: Identify the polarity of pregablin

A: The bonds formed between two elements of considerable different electronegativity are polar.  Hence…

Q: What is the IUPAC name of this organic compound?

A: The IUPAC name of the compound can be written on the basis of the number of carbon atoms in the main…

Q: The gas phase reaction between hydrogen and iodine is proposed to occur as follows: step 1: I2 → 2 I…

A: Given that,  The gas phase reaction between hydrogen and iodine occur in two steps  step 1:    I2 ➔…

Q: Consider the following unbalanced reaction. P4(s) + F2(g)  PF3(g) What mass of F2 is needed to…

A:

Q: A chemist must prepare 100. ml. of 1.00 M aqueous barium acetate (Ba(C,H,O.),) working solution.…

A: Here we are required to find the volume of barium acetate solution needed to prepare 100 ml of 1M of…

Q: NaOH(aq) + HBrO (aq) reaction CH₂CH₂OH (1) + 30₂(g) Mg1₂(aq) + Pb(NO3)₂(aq) → Mg(NO3)₂(aq) + PbI₂…

A: Acid base reactions involves acid and base to form salt and water. Double replacement reaction…

Q: The rate of the reaction A + 2 B 3 C + D was reported as 2.7 mol/dm3∙s. State the rates of formation…

A: The rate of the formation of the product or the rate of disappearance of the reactants is known as…

Q: A chemist adds 40.0 mL of a 0.071 mmol/L aluminum sulfate (Al₂(SO;),) solution to a reaction flask.…

A: Molarity (M) is a concentration term for a solution. The molarity of the given solution is defined…

Q: НО

A:

Q: One mole of ag and one mole of au contain the same number of atoms true or false

A: Yes

Q: Chalk is composed of calcium carbonate. This water-insoluble compound is formed when a solution of…

A:

Q: at are the anodic, the cathodic, and the overall reactions responsible for the ntial of the…

A:

Q: Predict the sign of AG for an exothermic reaction with a decrease in entropy. A negative B cannot…

A: According to the second law of thermodynamics, the spontaneous nature of the reaction is determined…

Q: ) What is the pH of a 50.0 mL buffer containing 0.25 M NH3 and 0.45 M NH4NO3?

A:

Q: STARTING AMOUNT X How many gram of Cal: are needed to completely precipitate the Ag+ ions as Agl…

A: Calcium iodide reacts with silver nitrate to form calcium nitrate and precipitate of silver iodide.…

Q: Calculate the number of atoms in a 3.22 x 10³ g sample of strontium. number of atoms: atoms

A: we have to calculate number of atoms of strontium

Q: Which of the following would be effective in separating iso-butanol and cyclopentane? iso-Butanol…

A: Simple distillation is only effective for mixtures when boiling points of the liquids are minimum…

Q: Macmillan Sucrose (table sugar) has a molar mass of 342.30 g/mole. How many sucrose molecules are in…

A:

Q: The graph below shows the titration of 9.15 g of a strong acid with 1.00 M NaOH. Which strong acid…

A: Given, mass of strong acid = 9.15 g Concentration of NaOH solution = 1.00 M = 1.00 mol/L Volume of…

States of Matter

The substance that constitutes everything in the universe is known as matter. Matter comprises atoms which in turn are composed of electrons, protons, and neutrons. Different atoms combine together to give rise to molecules that act as a foundation for all kinds of substances. There are five states of matter based on their energies of attraction, namely solid, liquid, gases, plasma, and BEC (Bose-Einstein condensates). 

Chemical Reactions and Equations

When a chemical species is transformed into another chemical species it is said to have undergone a chemical reaction. It consists of breaking existing bonds and forming new bonds by changing the position of electrons. These reactions are best explained using a chemical equation.