Phosphorous pentachloride decomposes according to the reaction PCI, (g) = PCI, (g) + Cl, (g) A 14.7 g sample of PCl, is added to a sealed 1.25 L flask and the reaction is allowed to come to equilibrium at a constant temperature. At equilibrium, 33.2% of the PCI, remains. What is the equilibrium constant, Ke, for the reaction?

Phosphorous pentachloride decomposes according to the reaction PCI, (g) = PCI, (g) + Cl, (g) A 14.7 g sample of PCl, is added to a sealed 1.25 L flask and the reaction is allowed to come to equilibrium at a constant temperature. At equilibrium, 33.2% of the PCI, remains. What is the equilibrium constant, Ke, for the reaction?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 62QRT

See similar textbooks

Similar questions

At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
12.103 Methanol, CH3OH, can be produced by the reaction of CO with H2, with the liberation of heat. All species in the reaction are gaseous. What effect will each of the following have on the equilibrium concentration of CO? (a) Pressure is increased, (b) volume of the reaction container is decreased, (c) heat is added, (d) the concentration of CO is increased, (e) some methanol is removed from the container, and (f) H2 is added.
Explain why the development of a vapor pressure above a liquid in a closed container represents an equilibrium. What are the opposing processes? How do we recognize when the system has reached a state of equilibrium?
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
The decomposition of PCl5(g) to form PCl3(g) and Cl2(g) has Kc = 33.3 at a high temperature. If the initial concentration of PCl5 is 0.1000 M, what are the equilibrium concentrations of the reactants and products?
Methanol, a common laboratory solvent, poses a threat of blindness or death if consumed in sufficient amounts. Once in the body, the substance is oxidized to produce formaldehyde (embalming fluid) and eventually formic acid. Both of these substances are also toxic in varying levels. The equilibrium between methanol and formaldehyde can be described as follows: CH3OH(aq)H2CO(aq)+H2(aq) Assuming the value of K for this reaction is 3.7 1010, what are the equilibrium concentrations of each species if you start with a 1.24 M solution of methanol? What will happen to the concentration of methanol as the formaldehyde is further converted to formic acid?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
12.101 An engineer working on a design to extract petroleum from a deep thermal reservoir wishes to capture toxic hydrogen sulfide gases present by reaction with aqueous iron(II) nitrate to form solid iron(II) sulfide. (a) Write the chemical equation for this process, assuming that it reaches equilibrium. (b) What is the equilibrium constant expression for this system? (c) How can the process be manipulated so that it does not reach equilibrium, allowing the continuous removal of hydrogen sulfide?
Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.