QUESTION 22 Standard Reduction Potentials at Standard States and 25°C 3CU2*(aq) + 2AI(s) 3Cu(s) + 2AI3*(aq) Half-reaction E°V) Cu (ag + 2e Cuo +034 Al +3e> Alce -1.66 (a) For the reaction above, determine the standard free energy change (AGO) at 25°C using the table of standard reduction potentials. (b) In which direction is the above reaction spontaneous at standard state conditions? WHY?

QUESTION 22 Standard Reduction Potentials at Standard States and 25°C 3CU2(aq) + 2AI(s) 3Cu(s) + 2AI3(aq) Half-reaction E°V) Cu (ag + 2e Cuo +034 Al +3e> Alce -1.66 (a) For the reaction above, determine the standard free energy change (AGO) at 25°C using the table of standard reduction potentials. (b) In which direction is the above reaction spontaneous at standard state conditions? WHY?

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 99QAP: The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another...

See similar textbooks

Similar questions

Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Consider the following standard reduction potentials: Tl+(aq)+eTl(s)Ered=0.34VTl3+(aq)+3eTl(s)Ered=0.74VTl3+(aq)+2eTl+(aq)Ered=1.28V and the following abbreviated cell notations: (1) Tl|Tl+Tl3+,Tl+|Pt (2) Tl|Tl3+Tl3+,Tl+|Pt (3) Tl|Tl+Tl3+|Tl (a) Write the overall equation for each cell. (b) Calculate E° for each cell. (c) Calculate G° for each overall equation. (d) Comment on whether G° and/or E° are state properties. (Hint: A state property is path-independent.)
In biological systems, acetate ion is converted to ethyl alcohol in a two-step process: CH3COO(aq)+3H+(aq)+2eCH3CHO(aq)+H2OE=0.581V CH3CHO(aq)+2H+(aq)+2eC2H5OH(aq)E=0.197V (E°' is the standard reduction voltage at 25°C and pH of 7.00.) (a) Calculate G°' for each step and for the overall conversion. (b) Calculate E°' for the overall conversion.
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Zn|Zn2+(0.50M)Cd2+(0.020M)|Cd (b) Cu|Cu2+(0.0010M)H+(0.010M)|H2(1.00atm)|Pt
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Cu|Cu+(0.80M)Hg22+(0.10M)|Hg|Pt (b) Cr|Cr3+(0.615M)Ni2+(0.228M)|Ni
A metallurgist wants to gold-plate an object with a surface area of 17.21 in2. The gold plating must be 0.00200 in. thick (assume uniform thickness). (a) How many grams of gold (d=10.5g/cm3) are required? (b) How many minutes will it take to plate the object from a solution of AuCN using a current of 7.00 A? Assume 100% efficiency.
What is the voltage of a concentration cell of Cl ions where the concentrations are 1.045 and 0.085 M? What the spontaneous reaction?
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.
Consider a voltaic cell in which the following reaction takes place in basic medium at 25°C. 2NO3-(aq)+3S2(aq)+4H2O3S(s)+2NO(g)+8OH(aq) (a) Calculate E°. (b) Write the Nernst equation for the cell E. (c) Calculate E under the following conditions: PNO=0.994atm,ph=13.7,[S2]=0.154M,[NO3-]=0.472M, .
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.