Given the following thermochemical equations:C2H29) +5 02(9)2C02(g) + H201)AH° = -1229.5 kJAH° = -393.5 kJC(6) + 02(g) → C02(g)1H2(9) +5 02(9) → H20)AH° = -285.5 kJ2Calculate the enthalpy (in kJ) for this reaction:206) + H2(g) → C,H2(9)

Answered: Image /qna-images/answer/dfb9ba0f-c3ed-40f6-93c0-e9ae266e6a7b.jpg

Answered: the enthalpy (in kJ) for this reaction:…

Science

Chemistry

the enthalpy (in kJ) for this reaction: 2C(s) + H2(g) → C2H2(9)

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter10: Liquids And Solids

Section: Chapter Questions

Problem 97E: A substance, X, has the following properties: Specific Heat Capacities Hvap 20.kj/mol C(s) 3.0j/gC...

See similar textbooks

Related questions

Q: For the chemical reaction Ca (s) + ½ O2 (g) → CaO (s) AH° = -635 kJ/mol. What is the enthalpy for…

A: The change in enthalpy of a reaction is used to determine the endothermic reaction or exothermic…

Q: 2 NO2 (g)= N2O4 (g) Delta H = - 57.2 kJ what is the enthalpy change when 45.7 grams of dinitrogen…

A: 2 NO2 (g)= N2O4 (g) Delta H = - 57.2 kJ what is the enthalpy change when 45.7 grams of dinitrogen…

Q: Using standard heats of formation, calculate the standard enthalpy change for the following…

A: Standard Enthalpy change for chemical reaction can be calculate by using the standard heat of…

Q: Use the graphs below to determine the enthalpy of reaction for the conversion of butane, C4H10, to…

A: The two graphs given are,

Q: AH = -296.83 kl <= (6)20+ (SIS SO2(g) calculate the reaction enthalpy for 202(g) +2 S(s) 2502@)

A: Enthalpy of the reaction can be described as the amount of heat absorbed or evolved in the chemical…

Q: Given the standard enthalpy changes for the following two reactions: (1) 4C(s) + 5H2(g) C,H10(g) AH°…

Q: What is the enthalpy change for producing 1.00 kg of acetic acid by this reaction?

Q: What is the enthalpy change when 189 g of NH3 are produced? The standard enthalpy of formation of…

A: Standard enthalpy of formation :- The enthalpy change accompanied the process of formation of one…

Q: In the reaction, C(s) + O2(g) → CO2(g), the enthalpy of formation CO2(g) is lower than enthalpies of…

A: Since the net enthalpy of the reaction C(s) + O2(g) → CO2(g), is given by enthalpy of reaction =…

Q: (1) N2(g) + 202(g)→2NO2(g) AH° = 66.4 kJ (2) 2N½0(g)2N2(g) + O2(g) AH° = -164.2 kJ what is the…

A: Given, N2(g)+2O2(g)→2NO2(g) ∆Ho=66.4kJ--------(1)2N2O(g)→2N2(g)+O2(g) ∆Ho=-164.2kJ--------(2)

Q: Write a balanced standard formation reaction and a balanced standard combustion reaction for each of…

A: The standard formation of a reaction is defined as the reaction in which only one mole of the…

Q: When 0.238 g of sodium metal is added to an excess of hydrochloric acid, 2470 J of heat are…

A: 2Na(s) + 2 HCl (aq) -->2NaCl(aq) + H2(g) Enthaly of reaction=? Na has molar mass=23 0.238g of…

Q: what is the standard enthalpy change for the reaction: (3) C2H4(g) + H2(g)C2H6(g) AH° = ?

Q: If 20.0 g of CH4 reacts with excess oxygen, what is the change in enthalpy for the reaction?…

A: The reaction considered is the combustion of methane and it is exothermic.

Q: calculate the standard enthalpy change for each of the following reactions: (a) N2(g) + O2(g) ⟶…

Q: Ammonia reacts with oxygen as follows: 4NH3(g) + 702(g) → 4NO2(g) + 6H20(g) AH° = -1132 kJ Calculate…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Determine the enthalpy of reaction, ∆H, for the formation of nitrogen oxide. N2O (g) + NO2 (g)…

A: The given reaction is: N2Og + NO2g → 3NOg The change in enthalpy of…

Q: using the standard enthalpies of formation, what is the standard enthrall of reaction?…

A: Standard enthalpy of formation of CO2 = -393.5 kJ/molStandard enthalpy of formation of H2 = 0…

Q: When 0.615 g of sodium metal is added to an excess of hydrochloric acid, 6390 J of heat are…

Q: Determine the enthalpy change for the following reaction when 10.9 g of NH3 is formed. N2 (g) + 3…

Q: Given the following reaction, calculate the enthalpy of reaction. Identify whether the reaction is…

Q: When 0.278 g of sodium metal is added to an excess of hydrochloric acid, 2890 J of heat are…

A: The balanced reaction given is, => 2 Na (s) + 2 HCl (aq) → 2 NaCl (aq) + H2 (g) Given: Mass of Na…

Q: What is the change in enthalpy in kilojoules when 3.24 g of CH,OH ga completely reacted according to…

A: The question is based on the concept of chemical thermodynamics. we have to calculate the enthalpy…

Q: For a given sample of CH3OH, the enthalpy change during the reaction is 82.3 kJ. How many grams of…

A: The reaction will be:

Q: For the chemical reaction Ca (s) + 2 O2 (g) CaO (s) AH° = -635 kJ/mol. What is the enthalpy for the…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Use table 5.3 to calculate the enthalpy change for the combustion of 1 mol of ethanol CHOH(1) +…

A: ∆H°f [C2H5OH(l)] = -235.2 kJ/mol ∆H°f [O2(g)] = 0 kJ/mol ∆H°f [CO2(g)] = -393.5 kJ/mol ∆H°f [H2O(l)]…

Q: Determine the enthalpy (in kJ/mol) for the reaction 4 NH: (g) + 5 Oz (g) → 4 NO (g) + 6 H2O (g).

Q: What is the standard enthalpy change for the reaction:3NO2(g) + H2 O(l) ⟶ 2HNO3(aq) + NO(g)…

A: The standard enthalpy of formation is called the heat of formation or the standard heat of…

Q: The enthalpy of formation for H20(1) is -285.8 kJ-mol-1. Which expression describes the enthalpy…

A: To find enthalpy change

Q: Using standard heats of formation, calculate the standard enthalpy change for the following…

A: Difference between enthalpy of formation of product to the enthalpy of formation of reactant is…

Q: The standard enthalpy change for the following reaction is -731 kJ at 298 K. 2 N2(g) + 4 H2(g) + 3…

A: Rule : on dividing the reaction with any constant, the value of enthalpy change also gets divided by…

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction? CO(g) +…

Q: SnCl2 (k) → Sn (k) + Cl2 (g) +325.1 kJ 2 SnCl2 (k) + 2 Cl2 (g) → 2 SnCl4 (s) -372.4 kJ Using the…

A: The reaction enthalpy, ∆H, is the energy that is involved in carrying out a reaction. Energy may be…

Q: When 0.215 g of sodium metal is added to an excess of hydrochloric acid, 2230 J of heat are…

A: Enthalpy is a thermodynamic property which is equal to the heat content of the system.

Q: For the chemical reaction Ca (s) + ½ O, (g) → CaO (s) AH° = -635 kJ/mol. What is the enthalpy for…

A: The given reaction is, 2CaO(s) ---> 2Ca(s) + O2(g) The chemical reaction given is, 1) Ca(s) +…

Q: Determine the enthalpy for this reaction: Express your answer in kilojoules per mole to one decimal…

Q: Using the table of standard formation enthalpies that you'll find under the ALEKS Data tab,…

Q: -) Calculate the enthalpy of the reaction from the enthalpies of formation: CH49 + 2 O2(g) → CO2(g)…

Q: In which of the reactions below is ÄH (enthalpy change) not an enthalpy of formation? O a. Mg(s) +…

A: The standard enthalpy change of formation is equal to the sum of the standard enthalpies of…

Q: The enthalpy for formation of NH3(g) is -45.9 kJ/mol. What is the reaction enthalpy for the…

Q: 12. The enthalpy change of a reaction does not depend on: (a) Initial and final enthalpy change of…

A: Given: Different statements regarding enthalpy change To find: Statement on which enthalpy change…

Q: For the chemical reaction Ca (s) + ½ O₂ (g) → CaO (s) ∆H° = -635 kJ/mol. What is the enthalpy for…

A: To calculate enthalpy for reaction:

Q: According to the following reaction, what is the change in enthalpy (kJ) per mole of the reaction?…

A: Enthalpy of Reaction: The difference in enthalpy between products and reactants ( HrxnHrxn ) is the…

Q: Using standard heats of formation, calculate the standard enthalpy change for the following…

A: Solution: Standard enthalpy of formation is the difference in the enthalpy of formation…

Q: The enthalpy change for reaction N2 + 3H2(g) → 2NH3(g) is -92.2kJ. The enthalpy of formation of…

A: Enthalpy of formation is enthalpy change when one mole of substance formed from its constituent…

Q: Calculate ΔΗ°rxn for the combustion of carbon monoxide, producing CO2 in KJ.…

A: The heat of a reaction can be calculated by knowing the standard enthalpies of formation of…

Q: Given the following reactions: N2(g) + 202(g) –→ 2NO2(g) AH = 66.4 kJ 2NO(g) + O2(g)→ 2NO2(g) AH =…

Q: What is the enthalpy change when a 50.00 g sample of methane undergoes complete combustion according…

Q: 21.0°C to 27.5°C. calculate the enthalpy change for the reaction in kJ/mol HCl, assuming that the…

A: We need to calculate the enthalpy change for reaction of HCl and NaOH using the given data.

Q: When 0.215 g of sodium metal is added to an excess of hydrochloric acid, 2230 J of heat are…

Concept explainers

Thermochemistry

Thermochemistry can be considered as a branch of thermodynamics that deals with the connections between warmth, work, and various types of energy, formed because of different synthetic and actual cycles. Thermochemistry describes the energy changes that occur as a result of reactions or chemical changes in a substance.

Exergonic Reaction

The term exergonic is derived from the Greek word in which ‘ergon’ means work and exergonic means ‘work outside’. Exergonic reactions releases work energy. Exergonic reactions are different from exothermic reactions, the one that releases only heat energy during the course of the reaction. So, exothermic reaction is one type of exergonic reaction. Exergonic reaction releases work energy in different forms like heat, light or sound. For example, a glow stick releases light making that an exergonic reaction and not an exothermic reaction since no heat is released. Even endothermic reactions at very high temperature are exergonic.

Question

Given the following thermochemical equations:
C2H29) +
5 02(9)
2C02(g) + H201)
AH° = -1229.5 kJ
AH° = -393.5 kJ
C(6) + 02(g) → C02(g)
1
H2(9) +5 02(9) → H20)
AH° = -285.5 kJ
2
Calculate the enthalpy (in kJ) for this reaction:
206) + H2(g) → C,H2(9)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
Consider the combustion of propane: C3H8(g)+5O2(g)3CO2(g)+4H2O(l)H=2221KJ Assume that all the heat in Example 7-3 comes from the combustion of propane. What mass of propane must be burned to furnish this amount of energy assuming the heat transfer process is 60.% efficient?
In earlier times, ethyl ether was commonly used as an anesthetic. It is, however, highly flammable. When five milliliters of ethyl ether, C4H10O(l)(d=0.714g/mL), are burned in a bomb calorimeter, the temperature rises from 23.5C to 39.7C. The calorimeter contains 1.200 kg of water and has a heat capacity of 5.32 kJ/C. (a) What is qH2o? (b) What is qcal? (c) What is q for the combustion of 5.00 mL of ethyl ether? (d) What is q for the combustion of one mole of ethyl ether?
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
Fructose is a sugar commonly found in fruit. A sample of fructose, C6H12O6, weighing 4.50 g is burned in a bomb calorimeter that contains 1.00 L of water (d=1.00g/mL). The heat capacity of the calorimeter is 16.97 kJ/PC. The temperature of the calorimeter and water rise from 23.49C to 27.72C. (a) What is q for the calorimeter? (b) What is q for water in the calorimeter? (c) What is q when 4.50 g of fructose are burned in the calorimeter? (d) What is q for the combustion of one mole of fructose?
Chlorine trifluoride is a toxic, intensely reactive gas. It was used in World War II to make incendiary bombs. It reacts with ammonia and forms nitrogen, chlorine, and hydrogen fluoride gases. When two moles of chlorine trifluoride react, 1196 kJ of heat are evolved. (a) Write a thermochemical equation for the reaction. (b) What is Hf for ClF3?
A substance, X, has the following properties: Specific Heat Capacities Hvap 20.kj/mol C(s) 3.0j/gC Hfus 5.0kj/mol C(l) 2.5j/gC bp 75C C(g) 2.5j/gC mp 15C
There is 3930 J of energy added to a 79.8-g sample of H2 gas. By how much doesthe temperature change?
When hydrazine reacts with oxygen, nitrogen gas and steam are formed. (a) Write a thermochemical equation for the reaction. (b) How much heat is evolved or absorbed if 1.683 L of steam at 125C and 772 mm Hg are obtained?
White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.