aa.124. The equilibrium constant, K, for the following reaction is 5.00×10 at 642 K.CoCl₂(g) CO(g) + Cl₂(g)An equilibrium mixture of the three gases in a 6.40 L container at 642 K contains 0.282 M COCI₂, 0.119 M CO and 0.119 MCl₂. What will be the concentrations of the three gases once equilibrium has been reestablished, if the volume of the container isincreased to 12.4 L?[COCI₂]=[co][Cl₂]MMM

The given equilibrium equation for the chemical reaction is COCl2(g) ⇔CO(g)+Cl2(g) K…

The equilibrium constant, K, for the following reaction is 5.00×102 at 642 K. CoCl₂(g) CO(g) + Cl₂(g) An equilibrium mixture of the three gases in a 6.40 L container at 642 K contains 0.282 M COCl₂, 0.119 M CO and 0.119 M Cl₂. What will be the concentrations of the three gases once equilibrium has been reestablished, if the volume of the container is increased to 12.4 L? [CoCl₂)= [co] [Cl₂] M M M

The equilibrium constant, K, for the following reaction is 5.00×102 at 642 K. CoCl₂(g) CO(g) + Cl₂(g) An equilibrium mixture of the three gases in a 6.40 L container at 642 K contains 0.282 M COCl₂, 0.119 M CO and 0.119 M Cl₂. What will be the concentrations of the three gases once equilibrium has been reestablished, if the volume of the container is increased to 12.4 L? [CoCl₂)= [co] [Cl₂] M M M

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter15: Principles Of Chemical Reactivity: Equilibria

Section: Chapter Questions

Problem 6PS: The equilibrium constant Kc, for the reaction 2 NOCI(g) 2 NO(g) + Cl2(g) is 3.9 103 at 300 C. A...

See similar textbooks

Similar questions

At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Two molecules of A react to form one molecule of B, as in the reaction 2 A(g) B(g) Three experiments are done at different temperatures and equilibrium concentrations are measured. For each experiment, calculate the equilibrium constant, Kc. (a) [A] = 0.74 mol/L, [B] = 0.74 mol/L (b) [A] = 2.0 mol/L, [B] = 2.0 mol/L (c) [A] = 0.01 mol/L, [B] = 0.01 mol/L What can you conclude about this statement: If the concentrations of reactants and products are equal, then the equilibrium constant is always 1.0.
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
12.103 Methanol, CH3OH, can be produced by the reaction of CO with H2, with the liberation of heat. All species in the reaction are gaseous. What effect will each of the following have on the equilibrium concentration of CO? (a) Pressure is increased, (b) volume of the reaction container is decreased, (c) heat is added, (d) the concentration of CO is increased, (e) some methanol is removed from the container, and (f) H2 is added.
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
The equilibrium constant Kc, for the reaction 2 NOCI(g) 2 NO(g) + Cl2(g) is 3.9 103 at 300 C. A mixture contains the gases at the following concentrations: [NOCl] = 5.0 103 mol/L, [NO] = 2.5 103 mol/L, and [Cl2] = 2.0 103 mol/L. Is the reaction at equilibrium at 300 C? If not, in which direction does the reaction proceed to come to equilibrium?
The equilibrium constant, Kc, for the reaction N2O4(g) 2 NO2(g) at 25 C is 5.9 103. Suppose 15.6 g of N2O4 placed in a 5.000-L flask at 25 C. Calculate the following; (a) the amount of NO2 (mol) present at equilibrium; (b) the percentage of the original N2O4 that is dissociated.
Gaseous acetic acid molecules have a certain tendency to form dimers. (A dimer is a molecule formed by the association of two identical, simpler molecules.) The equilibrium constant Kc at 25C for this reaction is 3.2 104. a If the initial concentration of CH3COOH monomer (the simpler molecule) is 4.0 104 M, what are the concentrations of monomer and dimer when the system comes to equilibrium? (The simpler quadratic equation is obtained by assuming that all of the acid molecules have dimerized and then some of it dissociates to monomer.) b Why do acetic acid molecules dimerize? What type of structure would you draw for the dimer? c As the temperature increases would you expect the percentage of dimer to increase or decrease? Why?
For the reaction N2(g)+3H2(g)2NH3(g) show that Kc = Kp(RT)2 Do not use the formula Kp = Kc(RT)5n given in the text. Start from the fact that Pi = [i]RT, where Pi is the partial pressure of substance i and [i] is its molar concentration. Substitute into Kc.