The following reaction is known to have a very large equilibrium constant. 4 NH;(g) + 5O2(g) 4 NO(g) + 6 H,O(liq) a. Predict the sign of AS'rxn , with a brief explanation. b. Based on your answer to part a. predict the sign of AH°rxn c. Using the tabulated values from Appendix G the OpenStax textbook find AGºrxn , AHºrxn , ASºrxn for the reaction.

The following reaction is known to have a very large equilibrium constant. 4 NH;(g) + 5O2(g) 4 NO(g) + 6 H,O(liq) a. Predict the sign of AS'rxn , with a brief explanation. b. Based on your answer to part a. predict the sign of AH°rxn c. Using the tabulated values from Appendix G the OpenStax textbook find AGºrxn , AHºrxn , ASºrxn for the reaction.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section16.6: Gibbs Free Energy

Problem 16.6PSP

See similar textbooks

Similar questions

The decomposition of diamond to graphite [C(diamond) C(graphite)] is thermodynamically favored, but occurs slowly at room temperature. a. Use fG values from Appendix L to calculate rG and Keq for the reaction under standard conditions and 298.15 K. b. Use fH and S values from Appendix L to estimate rG and Keq for the reaction at 1000 K. Assume that enthalpy and entropy values are valid at these temperatures. Does heating shift the equilibrium toward the formation of diamond or graphite? c. Why is the formation of diamond favored at high pressures? d. The phase diagram shows that diamond is thermodynamically favored over graphite at 20,000 atmospheres pressure (about 2 GPa) at room temperature. Why is this conversion actually done at much higher temperatures and pressures?
Consider the reaction N2O2(g) 2NO2(g) where PNO2=0.29 atm and PN2O4=1.6. For this reaction at these conditions. G = 1000 J and G = 6000 J. Which of the following statements about this reaction is(are) true? a. The reverse reaction is spontaneous at these conditions. b. At equilibrium. PN2O4 will be greater than 1.6 atm. c. The value of K for this reaction is greater than 1. d. The maximum amount of work this reaction can produce at these conditions is 6000 J. e. The reaction is endothermic.
What is the third law of thermodynamics? What are standard entropy values, S, and how are these S values (listed in Appendix 4) used to calculate S for a reaction? How would you use Hesss law to calculate S for a reaction? What does the superscript indicate? Predicting the sign of S for a reaction is an important skill to master. For a gas-phase reaction, what do you concentrate on to predict the sign of S? For a phase change, what do you concentrate on to predict the sign of S? That is, how are Ssolid, Sliquid, and Sgas related to one another? When a solute dissolves in water, what is usually the sign of S for this process?
Consider the reaction of 2 mol H2(g) at 25C and 1 atm with 1 mol O2(g) at the same temperature and pressure to produce liquid water at these conditions. If this reaction is run in a controlled way to generate work, what is the maximum useful work that can be obtained? How much entropy is produced in this case?
Given the following information at 25C, calculate G at 25C for the reaction 2A(g)+B(g)3C(g) Substance Hf(kJ/mol) S(J/molK) A(g) 191 244 B(g) 70.8 300 C(g) 197 164 a 956 kJ b 956 kJ c 346 kJ d 346 kJ e 1.03 103 kJ
Impure nickel, refined by smelting sulfide ores in a blast furnace, can be converted into metal from 99.90% to 99.99% purity by the Mond process. The primary reaction involved in the Mond process is Ni(s)+4CO(g)Ni(CO)4(g) a. Without referring to Appendix 4, predict the sign of S for the above reaction. Explain. b. The spontaneity of the above reaction is temperature-dependent. Predict the sign of Ssurr, for this reaction. Explain c. For Ni(CO)4(g), Hfo=607KJ/mol and S = 417 J/K mol at 298 K. Using these values and data in Appendix 4, calculate H and S for the above reaction. d. Calculate the temperature at which G = 0 (K = 1) for the above reaction, assuming that H and S do not depend on temperature. e. The first step of the Mood process involves equilibrating impure nickel with CO(g) and Ni(CO)4(g) at about 50C. The purpose of this step is to convert as much nickel as possible into the gas phase. Calculate the equilibrium constant for the above reaction at 50.C. f. In the second step of the Mood process, the gaseous Ni(CO)4 is isolated and heated to 227C. The purpose of this step is to deposit as much nickel as possible as pure solid (the reverse of the preceding reaction). Calculate the equilibrium constant for the preceding reaction at 227C. g. Why is temperature increased for the second step of the Mood process? h. The Mond process relies on the volatility of Ni(CO)4 for its success. Only pressures and temperatures at which Ni(CO)4 is a gas are useful. A recently developed variation of the Mood process carries out the first step at higher pressures and a temperature of l52C. Estimate the maximum pressure of Ni(CO)4(g) that can be attained before the gas will liquefy at 152C. The boiling point for Ni(CO)4 is 42C and the enthalpy of vaporization is 29.0 kJ/mol. [Hint: The phase change reaction and the corresponding equilibrium expression are Ni(CO)4(l)Ni(CO)4(g)K=PNi(CO)4 Ni(CO)4(g) will liquefy when the pressure of Ni(CO)4 is greater than the K value.]
Use S values to calculate the standard entropy change, rS0, for each of the following processes and comment on the sign of the change. (a) KOH(s) KOH(aq) (b) Na(g) Na(s) (c) Br2() Br2(g) (d) HCl(g) HCl(aq)
In the laboratory, POCl3 (phosphorus oxychloride) is used in the manufacture of phosphate esters, which are used in flame retardants and pesticides. It can be prepared by the following reaction at 25C: 2PCl3(g)+O2(g)2POCl3(g) H=572kJ;G=518.7kJ(a) Calculate S. Is the sign reasonable? (b) Calculate S for POCl3. (c) Calculate for POCl3.
Yeast can produce ethanol by the fermentation of glucose (C6H12O6), which is the basis for the production of most alcoholic beverages. C6H12O6(aq) 2 C2H5OH() + 2 CO2(g) Calculate rH, rS, and rG for the reaction at 25 C. Is the reaction product- or reactant-favored at equilibrium? In addition to the thermodynamic values in Appendix L, you will need the following data for C6H12O6(aq): fH = 1260.0 kl/mol; S = 289 J/K mol; and fG = 918.8 kl/mol.