Answered: There are 2.01 multiplied by 10^25…

Science

Chemistry

There are 2.01 multiplied by 10^25 formula units of CaCl2 on a balance what is the mass in grams?

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter4: Calculations Used In Analytical Chemistry

Section: Chapter Questions

Problem 4.13QAP

See similar textbooks

Related questions

Q: How many milligrams of iron(I) chloride result when 15.5 mg of iron is reacted with an excess of…

A: Since you have posted multiple questions, we are entitled to answer the first only. Please repost…

Q: H. Balance the chemical equation below, r of Conservation of Mass.

A: Law of conservation of mass states that mass can neither be created nor be destroyed in a chemical…

Q: The catalytic converter on your automobile converts carbon monoxide (CO) to carbon dioxide (CO2) by…

A: Given: mass of CO = 25.0 g molar mass CO = 28.01 g/mol molar mass O2 = 32.0 g/mol

Q: For the following reaction, 25.3 grams of calcium hydroxide are allowed to react with 28.2 grams of…

Q: A reaction for the reduction of copper is shown below (as an unbalanced reaction - that's how I will…

Q: For the following reaction, 4.38 grams of hydrochloric acid are mixed with excess iron(III) oxide.…

Q: A sunscreen preparation contains 2.50% by mass benzyl salicylate (2.50g benzyl salicylate/100g…

A: Given : weight of benzyl salicylate = 2.50 g in 100 g sunscreen And one tube contains 4 ounces of…

Q: When the equation _Sio2 +_C - _ Sic +. CO - is correctly balanced using whole-number coefficients,…

A: Given compound balance the reaction Here Sio2 have 1 coefficient Carbon have 3 SiC have 1 CO have 2…

Q: For the following reaction, 48.6 grams of potassium hydrogen sulfate are allowed to react with 24.6…

Q: For the following reaction, 29.9 grams of calcium hydroxide are allowed to react with 24.9 grams of…

A: The complete balanced reaction is : Ca(OH)2 (aq) + 2HCl (aq) -----------> CaCl2 (aq) + 2H2O (l)…

Q: Balance the following chemical equation: K2S(s) + HBr(aq) >H2S(g) + KBr(aq)

A: A balanced chemical equation is that in which all the reactants and products are written with their…

Q: What is the mass, in grams, of 2.84 x 10^23 atoms of lead?

A: Given that, No of atoms lead = 2.84 x 10 23 atoms We know that, 1 mole = 6.022 x 1023 atoms i.e,…

Q: balance the equation H2O(l) + CO2(g) + CH3 COONa(aq)

Q: Balance the following equation: 8Be - - > 4Не + X 2 4. O 4Li 3 О 12С O 4He O 8He

Q: (3.000x103 kg) of copper oxide. You check and find that you have 404.9 kg of ammonia gas available…

A: Mass of CuO = 3.000 tonnes = 3000kg= 3×106 g Molar mass of CuO = 79.545 g/mol Moles = 3×106…

Q: Balance chemical equation: H2(g)+ P4(s)---PH3(g)

Q: For the following reaction, 45.5 grams of iron(II) chloride are allowed to react with 144 grams of…

A: Consider the given reaction is as follows; iron (II) chloride aq + silver nitrate aq →…

Q: Balance the following Equation : Fe3O4 (s) + CO (g) = Fe (s) + CO2 (g)

Q: Given the unbalanced equation: PbCl2 + NazCrO4 --> PbCrO4 + NaCl. When properly balanced, the sum of…

A: Given: 1. To Balance the given reaction. 2. To find the sum of the balancing coefficients.

Q: For the following reaction, 24.9 grams of sodium chloride are allowed to react with 58.3 grams of…

Q: How many grams of sugar would you use to prepare 8.81 × 10ʻmL of a 1.00 mass/volume % solutio Enter…

A: Weight by volume percentage is defined as the percentage of mass of solute in grams per 1 mL of…

Q: Elemental phosphorus reacts with chlorine gas according to the equation P4(s) + 6Cl2 (g)➡️ 4PCl3 (l)…

A: The reaction taking place is given as, => P4 (s) + 6 Cl2 (g) --------> 4 PCl3 (l) Given :…

Q: Iron(III) oxide reacts with carbon monoxide according to the equation…

A: No of moles = Given massMolar massmass = No of moles x molar massLimiting Reactant⇒In chemical…

Q: Balance the following equation by Algebraic method. P205 + H20 – H3PO4

A: In balance chemical reaction number of each atom on reactant side is equal to number of each atom on…

Q: 2. When solutions of potassium hydroxide and aluminum nitrate are mixed, aqueous potassium nitrate…

Q: For the following reaction, 0.104 moles of zinc oxide are mixed with 8.64 grams of water.zinc oxide…

A: The given balanced reaction is as follows,

Q: below (as an unbalanced reaction - that's how I will almost always give you reactions. ALWAYS check…

A: The mass of unreacted CuO can be calculated by finding limiting reagent. Limiting reagent is the…

Q: For the following reaction, 68.5 grams of barium hydroxide are allowed to react with 37.5 grams of…

A: Answer: Given reaction is: Ba(OH)2(aq)+H2SO4(aq)→BaSO4(s)+2H2O(l) To find out the limiting reagent,…

Q: For the following reaction, 24.2 grams of calcium hydroxide are allowed to react with 27.4 grams of…

A: Given that, mass of Ca(OH)2 = 24.2 g , molar mass = 74 g mol-1 mass of HCl = 27.4 g , molar mass =…

Q: Balance the equation below by typing in the correct coefficients 02 (g) C3H8 (g) H2O (g) CO2 (8) +

A: Answer :- Here I have explained complete solution :--- So Firstly , to balance these equations, list…

Q: For the following reaction, 28.4 grams of calcium hydroxide are allowed to react with 24.8 grams of…

A: The number of moles of a substance is determined as the mass of the substance upon its molar mass.…

Q: What is the mass of 4.01mol of NaOH in grams and milligrams?

A: given, moles of NaOH = 4.01 moles molar mass of NaOH = 40.0 g/mol

Q: For the following reaction, 23.1 grams of sodium chloride are allowed to react with 57.1 grams of…

A: Moles of NaCl = given massmolar mass=23.158.5= 0.395 mol Moles of AgNO3 = given massmolar…

Q: Balance the following equation: Mgo Cl2 + v 02 MgCl2

Q: A substance breaks down into its component elements when it is heated. If 68.0 g of the substance is…

A: The law of conservation of mass states that, mass can neither be created nor destroyed. The mass of…

Q: The reaction between potassium chlorate and red phosphorus takes place when you strike a match on a…

A: Given, Mass of KClO3 = 41.3 g Moles of KClO3 can be calculated as:

Q: Iron is found in Earth's crust as several iron compounds: Calculate the mass (in kg) of each…

Q: For the following reaction, 60.2 grams of barium hydroxide are allowed to react with 38.3 grams of…

Q: For the following reaction, 135 grams of silver nitrate are allowed to react with 29.6 grams of…

A: Interpretation: From the given reaction, 135 g of silver nitrate react with 29.6 g of copper, the…

Q: For the following reaction, 28.3 grams of calcium hydroxide are allowed to react with 24.4 grams of…

A: Here we have to calculate maximum amount of calcium chloride formed, limiting reagent and amount of…

Q: Consider the following reaction. Na2CO3 + Mg(NO3)2 --> MgCO3 + 2NaNO3 Assuming the reaction goes…

Q: 9. What is the mass of calcium chloride that will be produced when 23.25 mL of 0.2351 M hydrochloric…

A: The balanced chemical equation can be written as, Ca(OH)2+2HCl→CaCl2+2H2O

Q: BALANCE THE EQUATION N2H4(L) ARROW NH3(G) + N2(G)

A: Given Equation N2H4(l) → NH3(g) + N2(g) Balance equation = ?

Q: Balance the chemical equation: N2(g) + 02(g) -----> ?

A: The molecular nitrogen and molecular oxygen reacts to give nitrogen dioxides

Q: For the following reaction, 29.3 grams of calcium hydroxide are allowed to react with 32.4 grams of…

A: Limiting reactant :- A reactant which is present in lesser number of moles than required as per…

Q: Balance the following chemical equations (type corresponding coefficients (1, 2, 3, ...) in blanks).…

A: BALANCED REACTION 2 NO2 + F2 ---> 2 NO2 F

Q: For the following reaction, 29.0 grams of calcium hydroxide are allowed to react with 24.6 grams of…

Q: For the following reaction, 72.0 grams of barium chloride are allowed to react with 64.0 grams of…

Q: Balance chemical equation: N2(g)+ H2(g)-----NH3(g)

A: Interpretation - To balance the given chemical equation - Introduction - As the given…

Q: For the following reaction, 48.5 grams of potassium hydrogen sulfate are allowed to react with 23.0…

A: Given-> Weight of KHSO4 = 48.5 gm Weight of KOH = 23.0 gm

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

There are 2.01 multiplied by 10^25 formula units of CaCl2 on a balance what is the mass in grams?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.
One molecule of a compound weighs 2.93 x 10-22 g. The molar mass of this compound is:
what is the percent by mass of sugar in a mixture that contains 157 g of salt, 1.215 kg of flour and 759 g of sugar?
A solution of CaCl2 in water forms a mixture that is 28.0% calcium chloride by mass. If the total mass of the mixture is 703.7 g, what masses of CaCl2 and water were used?
A solution of CaCl2 in water forms a mixture that is 37.5% calcium chloride by mass. If the total mass of the mixture is 551.7 g, what masses of CaCl2 and water were used? mass of CaCl2: mass of water:
3,10 How many moles of anions are in 37.6 g of AlF3? Express the amount in moles to three significant digits.
Balance the following equation by algebraic method. C4H10 + O2 → CO2 + H2O
A solution of CaCl2 in water forms a mixture that is 40.5% calcium chloride by mass. If the total mass of the mixture is 983.2g, what masses of CaCl2 and water we used? mass of CaCl2= g mass of water= g
What is the mass of 4.01mol of NaOH in grams and milligrams?
After a hydrate of sodium carbonate weighing 1.000 g is heated in a crucible for 15 minutes to drive off the water and allowed to cool, its final mass is 0.875 g. What is the mass % water in the hydrate?