2CH4(g) + 02 (g) → 2CH30H(e)->Use Hess' Law to caiculate the enthaipy change (in kJ-moi) of this reaction, given the foillowingknown thermochemical data:II20(P) → I120(g)CH4(g) + H20(g) → 3H2(g) + CO(g)2H20(f) → 02(g) + 2H2(g)2H2(g) + C0(g) → CH3OH(f)AH, = 44.00 k] - mol-1AH, = 206.1 kJ •mol-1AH, = 571.6 kJ • mol-1ΔΗ,AH, = -128.3 kJ • mol-1

Answered: Image /qna-images/answer/8c8e3660-9fc0-4fbf-85fa-af0b598e24e5.jpg

Answered: Use Hess' Law to caiculate the enthaipy…

Use Hess' Law to caiculate the enthaipy chan known thermochemical data: I1,0(8) - CH4(g) + H20(g)→ 3H2(g) + CO(g) 2H20(f) 02(g) + 2H2(g} 2H2(g) + C0(g) → CH3OH(f) → II,0(g)

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter2: The First Law Of Thermodynamics

Section: Chapter Questions

Problem 2.79E: The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C...

See similar textbooks

Related questions

Q: Calculate the energy required to heat 1.10kg of mercury from −8.3°C to 12.8°C. Assume the specific…

A: The Energy required to heat the given amount of mercury is determined by using the formula, Q = m x…

Q: What is the heat capacity of mercury in J⋅mol−1⋅∘C−1?

Q: Natural gas burns in air to form carbon dioxide and water, releasing heat. CH,(8) + 0,(8) - CO-(g) +…

A: Correct answer is (a) 0.115 g Heat required by water = heat released by methane combustion. Heat…

Q: It takes 57.5 J of energy to raise the temperature of 115.4 g of mercury from 23.61°C to 27.17°C.…

A: We know that the energy supplied is equal to the internal energy change of the molecules.

Q: * Enthalpy Constants Enthalpy H is a measure of the energy content of a system at constant pressure.…

A: The data given is,

Q: Calculate the heat capacity of a sample of radiator coolant if a temperature rise from -5 °C to 142…

A: Heat capacity: The amount of heat required to increase the temperature of a substance by one degree…

Q: Can the heat capacity of water be assumed when calculating the heat capacity of an unknown metal or…

A: The amount of heat absorbed (or released) by a fixed amount of a substance to change its temperature…

Q: Consider the following chemical reaction: C3H8(g) + H2(g) → C2H6(g) + CH4(g) Calculate the enthalpy…

A: In-order to find the enthalpy change of the desired reaction, the given reactions has to be written.

Q: O THERMOCHEMISTRY Using specific heat capacity to find temperature change A chemical reaction takes…

Q: You were walking along España Blvd. and you randomly picked up a piece of strange shiny rock that…

A: Given data of piece of strange shiny rock Mass = 42 g Heat required to raise the temperature =1383 J…

Q: 164. The specific heat capacity c of a metal is approximately related to its molar mass M follows:…

A: The specific heat capacity of a metal is related to its molar mass as follows,

Q: Calculate the energy required to heat 610.0 mg of mercury from -8.0 °C to 12.1 °C. Assume the…

Q: 6.89 Improvised Explosives Mixtures of fertilizer (ammonium nitrate) and fuel oil (a mixture of…

A: The expression of change in enthalpy is shown below: ∆H =∑n∆Hfproducts -∑m∆Hfreactants where;…

Q: A propane grill is used to cook ribeye steak and potatoes. About 0.470 L of propane (C,Hs) 1s…

A: Given information: Volume = 0.470 L Density of propane = 0.493 g/cm3 Enthalpy of reaction =…

Q: Use Hess’ Law in determining the change in enthalpy of the chemical reaction. Follow the steps that…

A: Given reactions are,

Q: Write an expression for the difference in internal energy between State A and State B in terms of…

A: The question is related to general chemistry where addition and subtraction of energy needs to be…

Q: An electric heater supplies energy to a 55.0 g block of Al. The temperature was originally 22.5 °C…

Q: When 1513 J1513 J of heat energy is added to 39.8 g39.8 g of hexane, C6H14,C6H14, the temperature…

A: Since, q =m×c×∆TWhere q =heat added to the system m =mass of given compound c…

Q: 12) From the following heats of combustion, CH,OH(1) + 0,(8) CO.(g) + 2H,0(1) AHn = -726.4 kJ/mol →…

A: 12) Given chemical reaction is, C(graphite) + 2H2(g) + 1/2O2 ---> CH3OH(l) The given reactions…

Q: 12.) A 36.0 g sample of liquid water at 100.0°C is heated to 145.0 C. How much heat does the water…

A: Given: mass of liquid water = 36.0 g Initial temperature of water = 100 oC Final temperature of…

Q: Use the appropriate data from the table to calculate the change in enthalpy for this reaction: Mg(s)…

Q: The same idea can be applied to chemical reactions. Not all reactions go directly from reactants to…

A: Given CO(g) + H₂(g) → C(s) + H₂O(g) C(s) + 2H₂(g) →CH4(g) Note : while solving i have taken…

Q: J is at initial temperature: 59.3 g+°C A 157 g sample of metal with specific heat: 0.396 C. What…

A: Given: Heat energy (Q) = 1.56 kJ = 1560 J Mass of metal (m) = 157 g Initial temperature of metal =…

Q: b) What is the change of enthalpy when 252 ml of methanol (density = 0.924 g/ml) are combusted to…

A: Given- Volume of methanol = 252 ml Density = 0.924 g/ml To find- Change in enthalpy of combustion…

Q: A 6.55 g sample of aniline (CeH,NH2, molar mass = 93.13 g/mol) was combusted in a bomb calorimeter.…

A: Answer

Q: Chemistry 1. A pool of lava exhibits Group of answer choices nuclear energy thermal energy…

A: Lava is extremely hot and average temperature is about 750°C .A pool can be used to produced…

Q: Calculate the change in the internal energy in the formation of SO3 using the following…

A: ∆H=∆E +∆NgRT Where ∆H = change in enthalpy ∆E= change in internal energy ∆Ng= change in no. Of…

Q: Calculate the energy required to heat 0.30kg of mercury from −5.1°C to 11.4°C. Assume the specific…

Q: 8. From the following heats of combustion, A,H° =-726.4 kJ mol A,H° =-393.5 kJ mol A,H° =-285.5 kJ…

A: Given data CH3OH(l) + 3/2O2(g) -------> CO2(g) + 2H2O(l), ------(1) ∆rH0=…

Q: Using the following thermochemical data, calculate Δ H f° of Ga 2O 3( s). 2GaCl3(s) + 3H2O(l) →…

A: Given 2GaCl3(s) + 3H2O(l) → Ga2O3(s) + 6HCl(g) ΔH° = 263.9 kJ/mol 2Ga(s) + 3Cl2(g) → 2GaCl3(s)…

Q: Mothballs are composed primarily of the hydrocarbon naphthalene ( C1oHs). When 1.121 g of…

A: ∆rU = -4269 KJ/mol = 4269 × 103 J/mol. Temperature(T) = 298 K Now, we have to calulate ∆rH of the…

Q: Sr (s) + C(graphite) + O,(g) → SrCO;(s) The information available is (1) Sr (s) + O2 (g) → SrO (s)…

A: Enthalpy is a state function i.e. the change that occur between the reactant i.e. inital state and…

Q: Dulong and Petit’s law states that specific heat capacity x atomic mass = 3R. If the specific heat…

A: Since according to the Dulong and Petit’s law, Specific Heat capacity X Atomic mass = 3 R where R =…

Q: Soog x 10369 14539 = 0.5kg 1. Calculate the kinetic energy (in J) of a bird weighing 500 g flying at…

A: Given -> Weight= 500 gm = 0.500 kg (1kg=1000gm) Velocity= 60.0 m/s

Q: THERMOCHEMISTRY Solving combustion thermochemistry problems Alec On a 10 day wilderness expedition…

A: We are given, The number of days: nd=10 The mass of water required every day: mw=3 kg The…

Q: D 8. Calculate the enthalpy change for the following reaction given the information below.…

A: Thermodynamic is the branch of chemistry that mainly deals with the heat transfer between system and…

Q: Calculate the energy change for a system undergoing an exothermic process in which 15.4 kJ of heat…

A: Given : Heat energy = 15.4 kJ Work done = 6.3 kJ

Q: Ammonia burns in the presence of a platinum catalyst to produce nitric oxide, NO.…

A: To find the heat of reaction for the below reaction. 4NH3g+5O2→4NOg+6H2Og Given that: N2g+O2g→2NOg;…

Q: The combustion of naphthalene (C10H8), which releases 5150.1 kJ/mol, is often used to calibrate…

A: When a combustion process takes place, a substance is burnt in the presence of oxygen molecule…

Q: (c) Consider the following chemical reaction: C;Hs(g) + H2(g) C2H6(g) + CH4(g) ΔΗ? %3D Calculate the…

A: In-order to find the enthalpy change of the desired reaction, the given reactions has to be written.

Q: Calculate the enthalpy of the reaction 2NO(9) + O2(9)→2NO2(9) given the following reactions and…

Q: You were walking along España Blvd. and you randomly picked up a piece of strange shiny rock that…

A: Given: Mass of piece ,m = 49.9 g Heat required, q = 790 J Change in temperature, ∆T = ( 74.8 -…

Q: 7. The combustion of sugar in a calorimeter is similar to the oxidation of sugar in the body. A…

Q: can

A: Dear student I have given answer to your question in the image format.

Q: For the reaction below, determine the difference in relevant particles that allow for determination…

A: Entropy change depend upon degree of randomness.If randomness increases entopy increases.and vice…

Q: 4. Phosphorus burns spontaneously in air to produce tetraphosphorus decaoxide, P,O1,(s): 4 P(s) + 5…

A: Reaction:- 4P + 5O2 -----> P4O10

Q: The heat capacity of air is much smaller than that of liquid water, and relatively modest amounts of…

A: Heat capacity is a form of energy required to raise the temperature of a body or substance by 1K

Question

2CH4(g) + 02 (g) → 2CH30H(e)
->
Use Hess' Law to caiculate the enthaipy change (in kJ-moi) of this reaction, given the foillowing
known thermochemical data:
II20(P) → I120(g)
CH4(g) + H20(g) → 3H2(g) + CO(g)
2H20(f) → 02(g) + 2H2(g)
2H2(g) + C0(g) → CH3OH(f)
AH, = 44.00 k] - mol-1
AH, = 206.1 kJ •mol-1
AH, = 571.6 kJ • mol-1
ΔΗ,
AH, = -128.3 kJ • mol-1

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
Microwave ovens convert radiation to energy. A microwave oven uses radiation with a wavelength of 12.5 cm. Assuming that all the energy from the radiation is converted to heat without loss, how many moles of photons are required to raise the temperature of a cup of water (350.0 g, specific heat =4.18J/gC) from 23.0C to 99.0C?
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
A 237-g piece of molybdenum, initially at 100.0 C, is dropped into 244 g of water at 10.0 C. When the system comes to thermal equilibrium, the temperature is 15.3 C. What is the specific heat capacity of molybdenum?
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
When 1.0 g of fructose, C6H12O6(s), a sugar commonly found in fruits, is burned in oxygen in a bomb calorimeter, the temperature of the calorimeter increases by 1.58 C. If the heat capacity of the calorimeter and its contents is 9.90 kJ/C, what is q for this combustion?
A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5 C and then dropped into a coffee-cup calorimeter containing 75.0 g of water at 21.7 C. When thermal equilibrium is reached, the final temperature is 24.3 C. Calculate the specific heat capacity of titanium.
Peanuts and peanut oil are organic materials and bum in air. How many burning peanuts does it take to provide the energy to boil a cup of water (250 mL of water)? To solve this problem, we assume each peanut, with an average mass of 0.73 g, is 49% peanut oil and 21% starch; the remainder is noncombustible We further assume peanut oil is palmitic acid, C16H32O2, with an enthalpy of formation of 848.4 kJ/mol. Starch is a long chain of C6H10O5 units, each unit having an enthalpy of formation of 960 kJ.
Nitrogen gas is confined in a cylinder with a movable piston under a constant pressure of 9.95 104 Pa. When 695 J of energy in the form of heat is transferred from the gas to the surroundings, its volume decreases by 1.88 L. What is the change in internal energy of the gas?