Use your graph equation to calculate the expected mass loss for your Epson salt sample, then  use percent error equation from the density lab to compare your actual mass lost and the value predicted from the equation. Where did the lost mass go? Explain

Q: Be sure to answer all parts. Which of the following arrangements of elements within the same group…

A:

Q: Question 13 of 20 Provide the correct systematic name for the compound shown here. |||||CH₂ CH3

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Predict the product for each of the following reactions: 1) 03 HO OH a A 2) DMS [H*] Dean-Stark A B…

A:

Q: Chemistry mutation asp in 1mry?

A: In the question I suppose we need to describe what it means mutation asp in 1mry.

Q: 3. Solutions of aqueous CaCl, and aqueous CuSO, are mixed in a beaker. a) Write the balanced…

A: a) The balanced molecular equation:

Q: few of noble gas (nonmetals) have ome cationic chemistry that is more haracteristic of a metal True…

A: The statement, "A few of noble gases(non metals) have some cationic chemistry that is more…

Q: Exothermic reactions are favored by high temperatures. True O False

A:

Q: → 3)CH₂COOH + H₂O 4) H₂O + CH₂COO NH4+ + CIO Ỳ HOC + Nha — Nhat

A: The conjugate acid–base pairs contains two substances that differ  by the presence of a proton (H⁺)

Q: If 1 mole of water have 20.0 g of H2O, calculate the number of molecules. (molar mass H=1, O=16)

A:

Q: Determine the average reaction rate for the production of oxygen gas between 180s and 320s. Show all…

A: Rate of reaction is change in concentration with time.Here the points at different time is not…

Q: Calculate the enthalpy change of the reactants Mg + 2 HCl ΣAH reactant ( 0 + 2 ( 92.3 ) =

A: The amount of energy lost or gained during the course of the reaction is known as the Enthalpy…

Q: The equilibrium constant for a particular reaction has been measured at differe 1/1 Determine the…

A:

Q: O H-C-H true false H H3C-N-CH3 1) 2) CH3l å

A: Correct answer :   Explanation The given reaction is mannich reaction. The Mannich reaction is…

Q: * Atoms which form covalent bonds not have any valence electrons. False True

A:

Q: 15) At elevated temperatures, nitrogen dioxide decomposes to nitrogen oxide and oxygen: NO2 (g) → NO…

A:

Q: Outline methods for the preparation of acetophenone (phenyl methyl ketone) starting from the…

A:

Q: Kindly please Write the calculation/solution. Thank you

A: We have given  [Na3PO4] = 0.200 N  Mass of dolomite = 1 g  Percentage of MgCO3 in dolomite = 14.01…

Q: When acetylene gas, C2H2, burns, how many liters of O2 at STP are used for every 7.78 mol of…

A:

Q: *** Match the following reaction names with schemes in questions 21-24: D) Swern Oxidation A)…

A:

Q: How many grams of solid sodium cyanide should be added to 1.00 L of 0.116 M hydrocyanic acid…

A: Given-> Volume of HCN = 1.00 L Molarity of HCN = 0.116 M pH = 9.990  Ka(HCN) = 4.00 × 10-10

Q: The concentration of a solution can be expressed in a variety of ways such as qualitatively

A: Concentration of solution can be expresse in variety of ways.

Q: Prepare each of the following compounds by using any inorganic reagents necessary: 1)…

A:

Q: NO₂ Euta -S-CH3 NO₂ Br & 8=S=O

A:

Q: Consider a Cu electrode is immersed in sea water. What occurs to the Cu ions? Cu ions and…

A: If the copper electrode is immersed in the sea water which has NaCl present, in the cathode…

Q: 8. Draw a plausible mechanism for each of the following transformations: -OH for conc. H₂SO4 heat a.…

A: Short explanation : Conc. sulfuric acid is donate its proton to alcohol and formation of…

Q: Farnesyl pyrophosphate (FPP) is an intermediate in the mevalonate pathway used in the biosynthesis…

A: Farnesyl pyrophosphate (FPP) is an intermediate in the biosynthesis of terpenes and steroids in the…

Q: A few of noble gas (nonmetals) have some cationic chemistry that is more characteristic of a metal…

A: There are many noble gas which are reactive under certain conditions and form Cations like Xe[PtF6].

Q: Given the reactions shown below, identify the reactant that is a. oxidized: b. reduced: c. reducing…

A:

Q: 6. What forces compounds to take on specific shapes based on the number of atoms and lone pair…

A:

Q: Consider the first three written formulas, and then use Hess’ law to find the change in enthalpy ,…

A: Given,        2 ClF  +  O2  → F2O                                       ∆H = 167.4 KJ/mol        2…

Q: 5. Describe each of the following as a measured number or an exact number: 12 roses 5 books 12…

A:

Q: nsider this reaction: 2C1₂0, (g) → 2Cl₂ (g) +50₂ (8) certain temperature it obeys this rate law.…

A:

Q: Which of the following polymers represents a polyester? A) Compound I B) Compound II C) Compound III…

A: In polyester compound there will be repeating ester (-COOR) unit . And here ,among the four…

Q: Oxidation process can happen between metal and organic solvent. O False O True

A: Metals in their elemental state, as well as many metal salts, cannot be dissolved in common…

Q: 3. Identify the type of reaction show below as addition, elimination, condensation, substitution,…

A: Here we are required to find the type of reaction.

Q: Exper. # 1 2 3 4 5 2H: (g) +2NO (g) → N: (g) + 2H₂O (g) [NO] mol/L [H.] mol/L 0.0010 0.0040 0.0020…

A:

Q: Determine the pH during the titration of 19.8 mL of 0.212 M hydroiodic acid by 0.155 M barium…

A:

Q: How to fold a filter paper

A: Fold the filter paper into half and after that again fold it in half so that it will become quarter…

Q: Design a buffer that has a pH of 7.24 using one of the weak base/conjugate acid systems shown below.…

A:

Q: Chemistry What are the adsorption isotherms other than Langmuir and Freundrich? Also, can you tell…

A: a) There are three different adsorption isotherm processes        (i) Langmuir adsorption isotherm…

Q: please help...draw a physical structure of the molecule

A: In the given problem we need to draw as a 2D physical structure of the molecule.

Q: a. At equilibrium the concentrations of the ionized substances are: [C6H5NH₂] = 0.0537 mol/L…

A: Given , [C6H5NH2]=0.0537molL[C6H5NH3+]=4.79×10-6molL[OH-]=4.79×10-6molL

Q: 6. What is the solubility of Pbl, in 0.0426 M Pb(NO3)2 solution? Ksp = 7.9x10-⁹

A:

Q: Predict the FINAL (?) product (or a mixture of products) for the following synthetic transformation:…

A: Elimination reaction of alkyl halide: Alkyl halide gives an elimination reaction by reacting with a…

Q: 5. In each of the following cases compare the bonds identified in red, and determine which bond you…

A: -> Strength of bond is proportional to bond dissociation energy . ->Bond length is inversely…

Q: What is the evidence that a chemical reaction took place?

A:

Q: : In some application, there are used CHy as a fuel to produce energy, during analysis gases of…

A:

Q: The rate constant of a certain reaction is known to obey the Arrhenius equation, and to have an…

A:

Q: 8) The product of Claisen condensation is a) a-keto ester b) B-keto ester c) 8-keto ester 9)…

A:

Q: Please show all the calculations. I have these information available: 32.00 mL of 1 butanol and…

A:

States of Matter

The substance that constitutes everything in the universe is known as matter. Matter comprises atoms which in turn are composed of electrons, protons, and neutrons. Different atoms combine together to give rise to molecules that act as a foundation for all kinds of substances. There are five states of matter based on their energies of attraction, namely solid, liquid, gases, plasma, and BEC (Bose-Einstein condensates). 

Chemical Reactions and Equations

When a chemical species is transformed into another chemical species it is said to have undergone a chemical reaction. It consists of breaking existing bonds and forming new bonds by changing the position of electrons. These reactions are best explained using a chemical equation.