Using the given standard enthalpies of formation in the table to calculate A Horxn for this reaction. 2 CH3OH(1) + O2(g) → CH3COOH(I) + 2 H2O(1) AHof CH3OH(1) -238 kJ/mol CH3COOH(1) -487 kJ/mol H2O(1) -286 kJ/mol H₂O(g) -241 kJ/mol

Using the given standard enthalpies of formation in the table to calculate A Horxn for this reaction. 2 CH3OH(1) + O2(g) → CH3COOH(I) + 2 H2O(1) AHof CH3OH(1) -238 kJ/mol CH3COOH(1) -487 kJ/mol H2O(1) -286 kJ/mol H₂O(g) -241 kJ/mol

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter4: Energy And Chemical Reactions

Section4.10: Standard Formation Enthalpies

Problem 4.14PSP: Use data from Table 4.2 to calculate the standard combustion enthalpy for conversion of sulfur...

See similar textbooks

Related questions

Q: Question 7 Propose a chemical structure for the name below. Make sure to clearly define the…

Q: What is Lc-Ms-Ms system? Please don't use AI answering this question.

A: Step 1: Step 2: Step 3: Step 4:

Q: None

A: The IUPAC name for benzyl benzoate is derived as follows:Benzyl: This part of the name refers to the…

Q: How does a decrease in the temperature of a chemical reaction affect the reaction rate? The reaction…

A: Step 1: How Decreasing Temperature Lowers Reaction RatesChemical reactions occur when reactant…

Q: What is the enegry numbers for the table?1 calorie (cal) = 4.184 J1 kWh = 3.600 × 106 J

A: Please see the attached image for the solution. If there are queries,please do not hesitate to ask.…

Q: None

A: Let's analyze each change:An endothermic chemical reaction between two liquids results in gaseous…

Q: Draaw the starting structure that would lead to the major product shown under the provided…

Q: dont provide handwriting solution .....

A: References Smith, M. B. (2020). March's advanced organic chemistry: reactions, mechanisms, and…

Q: A nuclear power plant operates at 40.0 % efficiency with a continuous production of 1182 MW of…

A: Approach to solving the question:Please see attached photos for detailed solutions. Thank you.…

Q: Indicate the products X and Y that are obtained in the following reactions. Briefly comment on each…

A: References; Smith, M. B. (2020). March's advanced organic chemistry: reactions, mechanisms, and…

Q: What is the half-life (in y) of a radioisotope if it decays to 25.0% of its radioactivity in 16.5…

A: Please see the attached image for the solution. If there are queries, please do not hesitate to…

Q: Draw a Haworth projection of a common cyclic form of this monosaccharide:

A: The sugar in open chain form is a 5-carbon aldose (aldopentose) known as D-Arabinose.It is…

Q: In a negative feedback system like thyroid hormones, when the target hormones (T3, T4) are…

A: The statement is FALSE. Let's take a look at these diagrams of the Thyroid Hormone Feedback Loop…

Q: Using these metal ion/metal standard reduction potentials Cd2+(aq)|Cd(s)…

A: Standard reduction potentialsCd2+ + 2e- → Cd E˚ = -0.40 VCu2+ + 2e- → Cu…

Q: Propose an efficient synthesis for the following transformation: ΕΙΟ OEt The transformation above…

A: Step 1: Step 2: Step 3: Step 4:

Q: Show work, thank you!

A: The attached image mostly shows gray screen. No question was asked. It would be better to…

Q: Provide the major products, including steps

A: Step 1: Step 2: Step 3: Step 4:

Q: What is the chemistry of how spf blocks uv rays from the sun Please please please answer as fast as…

A: Sunscreen works by shielding the skin from the harmful effects of ultraviolet (UV) radiation, which…

Q: None

A: Step 1:We must be familiar with the different monosaccharide to be able to answer this question. One…

Q: Predict the products of the following reactions. Show stereochemistry when applicable.

A: The second reaction, the addition may occur via syn or anti pathway. So both cases are possible

Q: Please don't provide handwritten solution ...

A: The molecular ion, often represented as M+ (M - plus), is a term used in mass spectrometry and…

Q: The equation of tris(1, 10-phenanthroline)iron(II) in acid solution takes place according to the…

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: What are the uses of NMR in new drug discoveries?

A: Uses of NMR in New Drug DiscoveriesStructure Determination: NMR spectroscopy is used to determine…

Q: (a) A voltaic cell is constructed as follows: Zn | Zn2+ | H+ | H2 The half-cell reactions are:…

A: i. Given: Ecell°=???V;Ecell=0.45V;[Zn2+]=1.0M;PH2=1.0atm;[H+]=???MZn(s)∣Zn2+∣∣H+∣H2(g)Step 1:…

Q: Which starting material and reagents lead to the product shown?

A: Step 1: Step 2: Step 3: Step 4:

Q: 5. A 9.600 gram sample of lithium sulfate dissolved in water. This lowers the freezing point to…

A: Step 1: To solve this problem, we can use the formula for calculating the freezing point depression…

Q: ABCD Question 4 Please predict the product for each of the following reactions. Make sure to clearly…

Q: 3. Propose starting materials and reagents to achieve the following synthesis. Carbonyls with 3…

A: I can help you with understanding the general approach to this question based on the information in…

Q: 3. Provide a mechanism for Boc-protection. H2N. Дон Вос20 R R ΟΗ

A: Step 1 The amine attacks a carbonyl site on di-tert-butyl dicarbonate (Boc2O) resulting in…

Q: What is the systematic name for the molecule below? O 2,3-dimethyl-1-ethylcyclohexane O…

A: So, the systematic name for the given molecule is: 1-ethyl-2,3-dimethylcyclohexane

Q: Please write OUT the MECHANISM and briefly explain in WORDS the mechanism for the following…

A: Step 1:

Q: 16.36 For the reaction 2A+B+C+D+ 2E, data for a run with [A], 800 mmol/L and [B] = 2.00 mmol/L are…

A: Step 1:Step 2: Step 3: Step 4:

Q: Help balance.

Q: None

A: The reactant is an organic molecule with an amine (NH2) group and a ketone (C=O) group on adjacent…

Q: Please give a detailed stepwise mechanism for the following reactions. All arrows, charges, and…

A: Step 1: example is adol convention

Q: starting with ethyl acetoacetate and formaldehyde as your only source of carbons synthesize the…

Q: Question 5 Please predict the product for each of the following reactions. Make sure to clearly…

A: Sure, I can help you with the chemistry question in the imaHere's a breakdown of the reactions and…

Q: None

A: Step 1:When COOH group of one amino acid and NH2 group of other amino acid combine together by…

Q: Outline the steps you would take to conduct a thorough risk assessment of chemical hazards in the…

A: Analyzing the approach to conducting a thorough risk assessment of chemical hazards in the workplace…

Q: 1) A beaker containing calcium chloride (CaCl2) is divided by a membrane. Initially, the…

Q: Please don't provide handwritten solution.

A: reaction uses phosphoric acid (H3PO4)to dehydrate 2-methylcyclohexanol, eliminating water to form an…

Q: 9 Complete the last step of the mechanism by using curved arrows. Do not delete any pre-drawn bonds,…

Q: None

A: Aromatic resonance is a theory that explains why aromatic compounds are so stable.This idea entails…

Q: Chemistry

A: 1. M1V1 = M2V2Here , M1 = 0.3MV1 = 20ml , V2 = 100mlM2 = M1V1 / V2 0.3 * 20/ 1OO = 0.06M 2.…

Q: 1. Aldol reactions (condensation of two aldehydes or ketones to yield a ẞ-hydroxy carbonyl) can go…

A: However, I can provide some general information about these reactions and point you to some…

Q: Draw the most stable chair conformation of each of the following compounds. (a)cis-1,1,4 -…

A: Step 1: Step 2: Step 3: Step 4:

Q: Help me calculate.

A: Step 1:Step 2: Step 3: Step 4:

Q: In an acid-base titration between CH2O2 (formic acid) and NaOH, theequivalence point occurs when…

A: EQUIVALENCE POINTThe equivalence point in a titration is the point at which the moles of acid are…

Q: ABCD Question 6 Please predict the product for each of the following reactions. Make sure to clearly…

A: Two major steps occur in the ring opening of epoxide in acidic conditions.First, epoxide gets…

Q: None

A: Step 1:Find total valence electrons : Total number of valence electrons in SO3= 6 + (3×6)= 24 Step…

Question

i know the answer is -583kJ but I did not understand why. I would appreciate any help on how to solve this step by step, thank you :)

Using the given standard enthalpies of formation in the table to calculate A
Horxn for this reaction.
2 CH3OH(1) + O2(g) → CH3COOH(I) + 2 H2O(1)
AHof
CH3OH(1)
-238 kJ/mol
CH3COOH(1)
-487 kJ/mol
H2O(1)
-286 kJ/mol
H₂O(g)
-241 kJ/mol

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.
sample of natural gas is analyzed and found to be88.4% methane (CH4) and 11.6% ethane (C2H6) bymass. The standard enthalpy of combustion of methaneto gaseous carbon dioxide (CO2) and liquid water (H2O) is -891 kJ/mol. Write the equation for the combustionof gaseous ethane to carbon dioxide and water.Calculate the standard enthalpy of combustion of ethaneusing standard enthalpies of formation from Table R-11on page 975. Using that result and the standard enthalpyof combustion of methane in Table 15.3, calculate theenergy released by the combustion of 1 kg of natural gas.
Calculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.
The enthalpy changes for the following reactions can be measured: CH4(g) + 2 O2(g) CO2(g) + 2 H2O(g) rH = 802.4 kJ/mol-rxn CH3OH(g) + 32 O2(g) CO2(g) + 2 H2O(g) rH = 676 kJ/mol-rxn (a) Use these values and Hesss law to determine the enthalpy change for the reaction CH4(g) + O2(g) CH3OH(g) (b) Draw an energy level diagram that shows the relationship between the energy quantities involved in this problem.
One step in the manufacturing of sulfuric acid is the conversion of SO2(g) to SO3(g). The thermochemical equation for this process is SO2(g)+12O2(g)SO3(g)H=98.9kJ The second step combines the SO3 with H2O to make H2SO4. (a) Calculate the enthalpy change that accompanies the reaction to make 1.00 kg SO3(g). (b) Is heat absorbed or released in this process?
The reaction enthalpy for oxidation of styrene, C8H8, has been measured by calorimetry. C8H8() + 10 O2(g) 8 CO2(g) + 4 H2O() rH = 4395.0 kJ/mol Use this value, along with the data from Table 4.2, to calculate the standard formation enthalpy of styrene, in kJ/mol. Table 4.2 Selected Standard Formation Enthalpies, fH, at 25C
Assume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)
The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.
White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.
Use data from Table 4.2 to calculate the standard combustion enthalpy for conversion of sulfur dioxide, SO2(g), to sulfur trioxide, SO3(g). Table 4.2 Selected Standard Formation Enthalpies, fH, at 25C
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?