Answer both questions Using the provided table and the equation below, determine the heatof formation (in kJ/mol) for PbS.2 PbS (s) + 3 O2 (g) →2 SO2 (g) + 2 PbO (s) AH° = -828.4 kJ/molSubstanceAH? (kJ/mol)O2 (g)SO2 (g)-296.9PbO (s)-217.3 Consider these electron transitions in a hydrogen atom:I. n = 2→n = 1II. n = 3 n = 1III. n= 1 →n = 4Which of the electron transitions would release the most energy?A) IB) IIC) IID) I, II, and III release the same amount ofenergy

Note : According to the rule we can solve first question. For another question please repost it.…

Using the provided table and the equation below, determine the heat of formation (in kJ/mol) for PbS. 2 PbS (s) + 3 O2 (g) → 2 SO2 (g) + 2 PbO (s) AH° = -828.4 kJ/mol Substance AH (kJ/mol) O2 (g) SO2 (g) -296.9 PbO (s) -217.3

Using the provided table and the equation below, determine the heat of formation (in kJ/mol) for PbS. 2 PbS (s) + 3 O2 (g) → 2 SO2 (g) + 2 PbO (s) AH° = -828.4 kJ/mol Substance AH (kJ/mol) O2 (g) SO2 (g) -296.9 PbO (s) -217.3

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 77E: Give the definition of the standard enthalpy of formation for a substance. Write separate reactions...

See similar textbooks

Related questions

Q: Ammonium perchlorate mixed with powdered aluminium powers the space shuttle booster rockets:…

A: Given data: 2 NH4ClO4g + 2 Als → Al2O3s + 2 HClg + 2 NOg + 3 H2Og The heat of formations of the…

Q: 4.78 x 10 kJ E) 1,040 kJ 51.Methanol (CH,OH) burns according to the equation 2CH,OH(I) +…

A: The given reaction is,

Q: Calcium hydroxide, which reacts with carbon dioxide to form calcium carbonate, was used by the…

A: Given, moles of CaCO3 formed = 3.8 mol

Q: 5.62 Write the equation for calculating the enthalpy of a reaction. Define all the terms.

A: The equation for calculating the enthalpy of a reaction has to be given and all the terms have to…

Q: 2. (a) The industrial process for the production of sulphuric acid has three steps. S (s) + O2 (g)…

Q: Consider these reactions, where M represents a generic metal. 1. 2 M(s) + 6 HCI(aq) 2 MCI, (aq) + 3…

A: Given data: 2M(s) + 3Cl2(g) ------> 2MCl3(s) Enthalpy of reaction is given below:

Q: Given the following thermochemical equations, 2Cu + S(s) → Cu2S(s) AH° = -79.5 kJ S(s) + O2(g) →…

A: We have to predict the standard enthalpy of formation of CuO.

Q: Fe,O3(s), with carbon monoxide, CO(g), as shown in the balanced equation below: Fe,O3(s) + 3CO(g) →…

A: given (1) CO(g) + 1/2O2(g) → CO2(g) ΔH° = -283 kJ (2) 2Fe(s) + 3/2O2 (g) →…

Q: Hydrocarbons, compounds containing only carbon and hydrogen, are important in fuels. The combustion…

A: Hi, as you have posted 2 questions and have not mentioned which question we have to solve. Hence we…

Q: 8. Determine the enthalpy for the following reaction, given AH (NH3(g)) =-46.1 kJ/mol, AH, (NO(g)) =…

Q: 2. A 35 g metal ball made up of a mixture of element X and element Y is heated up to 77°C and…

A: Solution and calculation see below

Q: Consider these reactions, where M represents a generic metal. 1. 2 M(s) + 6 HCI(aq) 2 MCI, (aq) + 3…

Q: The combustion of 0.1583 g benzoic acid increases the temperature of a bomb calorimeter by 2.52°C.…

Q: 1.The combustion of methane gas, the principal constituent of natural gas, is represented by the…

A: Recall the given reaction CH4g + 2 O2g → CO2g + 2 H2Ol , ∆H°=-890.3 kJ We have to find the mass…

Q: Consider the hypothetical case of removing the magnesium sulfate from solution and reforming the…

A: The heat energy released when new bonds are made between the ions/molecules and water molecules is…

Q: How much heat is released by the formation of 18.0 g of CACO,? Show the conversions required to…

Q: 3. The production of steel from iron involves the removal of many impurities in the iron ore. The…

A: All elements in their standard states (oxygen gas, solid carbon in the form of graphite, etc.) have…

Q: Consider these reactions, where M represents a generic metal. 2 M(s) + 6 HCl(aq) – 2 MC, (aq) + 3 Н,…

A: The reactions given are,

Q: A scientist measures the standard enthalpy change for the following reaction to be -820.7 kJ…

Q: 3. A 1.25-g sample of ammonium nitrate dissolves in water to make 35.0 mL of solution in an…

A: Given, Mass of NH4NO3 = 1.25 g Volume of the solution = 35.0 mL Initial temperature= Ti = 24.6 0C…

Q: Magnesium burns in air to produce a bright light and is often used in fireworks displays. The…

Q: enthalpy change for the following reaction to be -826.6 kJ : Fe2O3(s) + 2 Al(s)Al2O3(s) + 2 Fe(s)…

A: Heat of reaction is defined as difference of energy of product and energy of Reactant. If heat of…

Q: Consider these reactions, where M represents a generic metal. 1. 2 M(s) + 6 HCI(aq) → 2 MCI, (aq) +…

A: In-order to find the enthalpy change of the desired reaction, the given reactions has to be written.

Q: Given the equation for a hypothetical reaction, 5A + 3B > 7C + 3D, and the following standard…

A: Hello. Since you have posted multiple questions and not specified which question needs to be solved,…

Q: Given the thermo-chemical equation N, (g) + 3 H, (g) → 2 NH, (g) AH = -91.8 kJ %3D How much energy…

A: Nitrogen reacts with hydrogen to form ammonia. The equation for the balanced chemical reaction is as…

Q: When 2.0 mole of ZnO(s) decomposes to Zn(s) and O2 (g), the Δ H = 696 kJ of heat energy. What does…

A: Reaction involved:- 2ZnO(s) = 2Zn(s) + O2 (g) ∆H = 696 kJ

Q: Consider these reactions, where M represents a generic metal. 1. 2 M(s) + 6 HCI(aq) 2 MCI, (aq) + 3…

A: We need to obtain the equation with the unknown enthalpy change from the equations with the known…

Q: Given these reactions, where X represents a generic metal or metalloid 1) H, (g) + 0,(g) → H,O(g)…

A: Given,

Q: 1.) The internal energy of a system increases 253 J , while the system loses 93 J of heat.…

A: Internal energy (∆E) :- It is the energy of a thermodynamic system which is present in that…

Q: Consider these reactions, where M represents a generic metal. 2 M(s) + 6 HCI(aq) 2 MCI, (aq) +3H,…

A: The enthalpy of the equation 2M(s) + 3Cl2(g) -----> 2MCl3(s) is calculated below.

Q: 5. Enthalpy of formation a. For which of these reactions at 25 °C does the enthalpy change represent…

A: a) Standard enthalpy of formation is the change in enthalpy when one mole of compound is formed from…

Q: Hydrazine, N2 H4, is a colorless liquid used as a rocket fuel. What is the enthalpy change for the…

Q: combustion for each of the gases and then balance. Are these reactions endothermic or exothermic?…

A: Hydrocarbons burns in presence of air to give CO2 and water. C3H8 + 5O2 -> 3CO2 + 4H2O + heat…

Q: Consider these reactions, where M represents a generic metal. 1. 2 M(s) + 6 HCl(aq) 2 MCl, (aq) + 3…

A: By using the few reactions we can calculate the enthalpy of a particular reaction .

Q: Hydrazine, N3H4, is a colorless liquid used as a rocket fuel. What is the enthalpy change for the…

A: ΔH is an extensive property....

Q: Consider these reactions, where M represents a generic metal. 1. 2 M(s) + 6 HCI(aq) 2 MCI;(aq) +…

A: In the above reactions we only need 2 reactions to calculate the enthalpy of the following reaction;…

Q: Which of the following signs on q and w represent a system that is doing work on the surroundings,…

A: Energy can exchange as heat in case the system and surroundings are at different Temperature and are…

Q: Using the equations 2 Fe (s) + 3 CI, (g) → 2 FeCl, (s) AH° = -800.0 kJ/mol Si(s) + 2 CI, (g) → SICI,…

A: The value of ∆H of a thermochemical equation changes with the changes made in chemical equation If…

Q: Soapstone is a type of metamorphic rock that is used as an ice alternative to cool drinks without…

Q: Ammonium perchlorate mixed with powdered aluminium powers the space shuttle booster rockets:…

A: The given data: ∆Hf(H2O ,l) = -285.1 kJ/mol ∆Hf(NO, g) = 90.4 kJ/mol ∆Hf(HCl ,g) = -92.3 kJ/mol…

Q: 2. A 35 g metal ball made up of a mixture of element X and element Y is heated up to 77C and dropped…

Q: Consider these reactions, where M represents a generic metal. 1. 2 M(s) + 6 HCI(aq) → 2 MCl, (aq) +…

Q: Consider these reactions, where M represents a generic metal. 1. 2 M's) + 6 HCI(аq) 2 MCl, (aq) + 3…

Q: When 5.12 g of NaOH were dissolved in 51.55 g water in a calorimeter at 24.5°C, the temperature of…

A: Given: The mass of water, (m1) = 51.55 g. The mass of NaOH, (m2) = 5.12 g. The specific heat of…

Q: Nitric acid can be formed in two steps from the atmospheric gases nitrogen and oxygen, plus hydrogen…

Q: When N2(g) react with O2(g) to form N20(g) according to the following equation, energy is absorbed…

A: If any system absorb heat then system has profit of energy or it requires energy to complete the…

Q: Consider these reactions, where M represents a generic metal. 2 M(s) + 6 HCI(aq) → 2 MCI, (aq) + 3…

Q: Acetic acid, CH3COOH, is contained in vinegar. Suppose acetic acid was formed from its elements,…

A: The given Reactions and data are- 1. CH3COOH(l) + 2 O2(g) -> 2 CO2(g) + 2 H2O(l) , ∆H° = -871…

Q: 8. The oxidation of the sugar glucose, C6H1206 is described by the following equation: C6 H12 O6 (s)…

A: The oxidation of glucose can be described by following reaction: C6H12O6 (s)+ 6O2 (g) →6CO2 (g) +…

Q: Consider the following reaction: C3H8 + 5 O2 --> 3 CO2 + 4 H2O If the overall reaction has an…

A: Enthalpy of reaction = -2220 KJ/mole This means that 2220 KJ heat is released when 1 mole of C3H8…

Concept explainers

Micelles and Biological Membrane

Micelles are the type of lipid molecules that organize themselves in spherical shape in aqueous solutions. The production of the micelle is a reply to the amphipathic behavior of fatty acids. It means that they consist of both hydrophobic regions and hydrophilic regions. In micelles, polar head groups (hydrophilic groups) produce an outer layer associated with water whereas nonpolar tails (hydrophobic groups) are organized in the interior.

Question

Answer both questions

Using the provided table and the equation below, determine the heat
of formation (in kJ/mol) for PbS.
2 PbS (s) + 3 O2 (g) →2 SO2 (g) + 2 PbO (s) AH° = -828.4 kJ/mol
Substance
AH? (kJ/mol)
O2 (g)
SO2 (g)
-296.9
PbO (s)
-217.3

Consider these electron transitions in a hydrogen atom:
I. n = 2→n = 1
II. n = 3 n = 1
III. n= 1 →n = 4
Which of the electron transitions would release the most energy?
A) I
B) II
C) II
D) I, II, and III release the same amount of
energy

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Analysis

VIEW

Calculation

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Assume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)
n Section 10.7, two characteristics of enthalpy changes for reactions are listed. What are these characteristics? Explain why these characteristics are true.
Is the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)
The thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?
9.41 Under what conditions does the enthalpy change equal the heat of a process?
Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.
The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).
When 2.50 g of methane burns in oxygen, 125 kJ of heat is produced. What is the enthalpy of combustion per mole of methane under these conditions?
The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.
Compounds with carboncarbon double bonds, such as ethylene, C2H4, add hydrogen in a reaction called hydrogenation. C2H4(g)+H2(g)C2H6(g) Calculate the enthalpy change for this reaction, using the following combustion data: C2H4(g)+3O2(g)2CO2(g)+2H2O(l);H=1411kJC2H6(g)+72O2(g)2CO2(g)+3H2O(l);H=1560kJH2(g)+12O2(g)H2O(l);H=286kJ
You discover that you cannot carry out a particular reaction for which you would like the enthalpy change. Does this mean that you will be unable to obtain this enthalpy change? Explain.
Ethanol, C2H5OH, is used as a fuel for motor vehicles, particularly in Brazil. (a) Write the balanced equation for the combustion of ethanol to CO2(g) and H2O(g), and, using the data in Appendix G, calculate the enthalpy of combustion of 1 mole of ethanol. (b) The density of ethanol is 0.7893 g/mL. Calculate the enthalpy of combustion of exactly 1 L of ethanol. (c) Assuming that an automobile’s mileage is directly proportional to the heat of combustion of the fuel, calculate how much farther an automobile could be expected to travel on 1 L of gasoline than on 1 L of ethanol. Assume that gasoline has the heat of combustion and the density of n—octane, C8H18(Hf=208.4kJ/mol;density=0.7025g/mL).