kindly answer both. no need for detailed explanation. thank you! What is the effect on the electrode potential if the pH of the following redox system is increased?ClO4 + 2H* + 2e-2 cl03¯ + H20E° = 1.19 VO It will become more positiveO It will become less positiveThere will be no effect1. O It will become zeroWhich of the following statements is INCORRECT about the redox titration curve?Dilution of the analyte/titrant significantly affects the observed potentialThe potential at the beginning of the titration cannot be calculatedThe more positive the E°cell for the titration reaction, the steeper is the slope at the equivalence point region of the curve2.The potential at half the equivalence point is given by the standard reduction potential of the analyte.

Answered: Image /qna-images/answer/c47e3c50-f295-4a4a-913f-bee866cd891e.jpg

What is the effect on the electrode potential if the pH of the following redox system is increased? clO4 + 2H* + 2e-2 cl03¯ + H20 E° = 1.19 V O I t will become more positive O t will become less positive O There will be no effect It will become zero

What is the effect on the electrode potential if the pH of the following redox system is increased? clO4 + 2H* + 2e-2 cl03¯ + H20 E° = 1.19 V O I t will become more positive O t will become less positive O There will be no effect It will become zero

Chemical Principles in the Laboratory

11th Edition

ISBN:9781305264434

Author:Emil Slowinski, Wayne C. Wolsey, Robert Rossi

Publisher:Emil Slowinski, Wayne C. Wolsey, Robert Rossi

Chapter32: Voltaic Cell Measurements

Section: Chapter Questions

Problem 2ASA

See similar textbooks

Related questions

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: The given redox reaction is 4Br-(aq) + N2(g) + 4H2O(l) → 2Br2(l) + N2H4(aq) + 4OH-(aq) Calculate the…

Q: The standard reduction potentials for two pairs of redox species are shown below. Which species is…

A: Answer: Cu+1(aq) Explanation: The one which is having more standard reduction potential (SRP) value…

Q: A student measures the potential of a cell made up with 1 M CuSO4, in one solution and 1 M AgNO3, in…

Q: The emf of the cell reaction The standard electrode potentials for the half cell reactions are: Zn →…

Q: Cell potential Electrons flow from the anode to the cathode in a voltaic cell. The difference in…

A: The solution is given below -

Q: Calculate the potential developed by a voltaic cell using the following reaction if all dissolved…

A: Given reaction: 2 Fe2+ (aq) + H2O2 (aq) + 2H+ (aq) → 2 Fe3+ (aq) + 2 H2O (l) It is given that all…

Q: Calculate the electromotive power of a galvanic cell that consists of a normal hydrogen electrode…

Q: 7. A voltaic cell based on the reaction between aqueous Br2 and vanadium(III) ions has Ecel = 0.73 V…

Q: (a) How many moles of mercury will be produced by electrolysing 1.0 M Hg(NO3)2 solution with a…

A: a.

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: The given equation is given as, Mn2+aq+4H2Ol+5Fe3+aq→MnO4-aq+8H+aq+5Fe2+aq

Q: The cell potential of the following cell is determined using an unspecified concentration of acid.…

Q: Calculate the potential developed by a voltaic cell using the following reaction if all dissolved…

A: We have to calculate the cell potential.

Q: galvanic cell formed from the following two half-reactions? Assume that the cell temperature is 38°C…

A: Galvanic cell reaction, Cd2+(aq) +Mg(s) --->Cd(s) + Mg2+(aq) E°cell = E°c - E°a = -0.403…

Q: A galvanic cell is set up using the redox reaction below at 298 K. If the cell has a standard cell…

A: In a galvanic cell, the Gibbs free energy is related to standard cell potential as,…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

Q: Use the reduction potential above to solve for the cell potential E°cell in volts for the corrosion…

A: The cell reaction for corrosion of zinc is as below: Zn(s) + 1/2 O2 (g) + H2O (l) -------> Zn2+…

Q: A galvanic cell was constructed where one electrode was a Cu2*(aq)|Cu(s) electrode and the other was…

A: In general,in a galvanic(voltaic) cell, the electrode at which reduction takes place is written on…

Q: Calculate the standard potential, E°, for this reaction from its ΔG° value.…

Q: The free energy of an electrochemical cell is given by the equation: AG = -nFE Where: AG = Gibbs…

Q: Consider the table of the standard electrode potentials at 25 °C: Reduction half-reaction E° (V)…

A: From given picture I am solving part B however you have not mentioned but it seems that part A is…

Q: Upload a picture (*.png, *.tiff, *.tif, * pdf. *.jpg) of your hand-written work in response to the…

A: a.) Write the expression for change in standard Gibbs free energy of reaction in terms of standard…

Q: (c) The magnitudes but not the signs of the standard electrode potentials of two metals, X and Y…

A: In this given question we have to find out standard emf of a cell made up of X and Y metal.

Q: 3.) Consider that the following half reaction is assigned a half cell voltage of 0.00 V. Hg (aq) + 2…

Q: Following is a diagram of a voltaic cell. If the standard reduction potentials for Zn2+ (aq, 1 M) +…

A: A Galvanic cell is made up of an anode and a cathode. Reduction reaction occurs at cathode whereas…

Q: Batteries are charged and discharged due to the concentration of the solutions inside. Calculate the…

A: The standard Reduction potential of Zn2+, E◦red.= -0.76 V The standard Reduction potential of X2+,…

Q: Calculate the cell potential, E, for the given reactions at 25.00 °C using the ion concentrations…

Q: At 298K, a particular voltaic cell contains two electrodes Al(s) | Al^3+(aq) and Ca(s)| Ca^2+(aq)…

A: The cell given is Al(s) | Al3+ (aq) and Ca(s) | Ca2+ (aq) From the given reduction reactions of Ca…

Q: Using the Nernst equation and the table for standard electrode potentials, determine the voltage of…

Q: What is the calculated value of the cell potential at 298K for an electrochemical cell with the…

A: GivenCl2(g) + Cu(s) → 2 Cl-(aq.) + Cu2+(aq.)Oxidation half Cu(s) → 2 e- + Cu2+(aq.)Reduction half…

Q: Calculate the cell potential given the standard reduction potentials for the half reactions of the…

Q: Consider these two entries from a fictional table of standard reduction potentials. X³+ + 3e → X(s)…

Q: A galvanic cell is set up using the redox reaction below at 298 K. If the cell has a standard cell…

A: Since the value of ΔG0 is given by ΔG0 = -nFE where E = standard cell potential = 0.31 F =…

Q: d)Calculate the Kredox e) Using Nernst equation, determine electrode potential at the given…

A: Standard electrode potential values are : ECo2+/Coo = -0.28 V EPb2+/Pbo = -0.13 V Overall…

Q: Calculate the potential developed by a voltaic cell using the following reaction if all dissolved…

Q: Given the following two standard reduction half-reaction calculate what the standard cell potential…

Q: Consider these two entries from a fictional table of standard reduction potentials. X3+ + 3e- X(s)…

A: The solution is as follows :

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

A: Here we are required to calculate the standard reaction free energy for the given redox reaction.

Q: 8. The following redox reaction occurs at 25.0°C: 5F22*(aq) + MnO4 (aq) + 8H*(aq) → Mn2 (aq) +…

A: Electrochemistry is the branch of chemistry which studies the change of chemical energy into…

Q: Given the following standard reduction potentials, what is E°cell for the reaction that will occur…

A: According to the electro chemical cell, we have the following relation: E0cell=Ecathode-Eanode Where…

Q: Calculate the potential developed by a voltaic cell using the following reaction dissolved species…

Q: write the half-reaction and standard potential of the right half-cell electrode for each of the…

A: The right half-cell electrode is the cathode.

Q: Batteries are charged and discharged due to the concentration of the solutions inside. Calculate the…

A: Given, The voltage of a battery made from zinc in a 0.1M solution of Zn2+ and a metal X in a 1 M…

Q: Calculate the potential developed by a voltaic cell using the following reaction if all dissolved…

Q: A nonstandard cell or half-cell potential can be calculated using the Nernst equation: RT InQ nF E=…

A: Ans.

Q: Consider a cell constructed from standard Q2+/Q and D+/D electrodes. Q and D are symbols of…

Q: Calculate the potential for each cell as written at 25 ∘C.25 ∘C. Indicate whether the metal…

A: We have to tell the potential of given cell and identify cathode and anode. Given, E°…

Q: 3.) Consider that the following half reaction is assigned a half cell voltage of0.00 V Hg (aq) +2 e…

A: Standard Potential can be calculated as- Ecell∘=EReduction∘-EOxidation∘ or Ecell∘=ECathode∘-EAnode∘

Question

kindly answer both. no need for detailed explanation. thank you!

What is the effect on the electrode potential if the pH of the following redox system is increased?
ClO4 + 2H* + 2e-2 cl03¯ + H20
E° = 1.19 V
O It will become more positive
O It will become less positive
There will be no effect
1. O It will become zero
Which of the following statements is INCORRECT about the redox titration curve?
Dilution of the analyte/titrant significantly affects the observed potential
The potential at the beginning of the titration cannot be calculated
The more positive the E°cell for the titration reaction, the steeper is the slope at the equivalence point region of the curve
2.
The potential at half the equivalence point is given by the standard reduction potential of the analyte.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a pH meter at 25 00C is given by the equation where contains the potential of the reference electrode and all other potentials that arise in the cell that are not related to the hydrogen ion concentration. Assume that = 0.250 V and that a. What is the uncertainty in the values of pH and [H+] if the uncertainty in the measured potential is 1 m V ( 0.001 V)? b. To what precision must the potential be measured for the uncertainty in pH to be 0.02 pH unit?
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
The cell potential of the following cell at 25C is 0.480 V. ZnZn2+(1M)H+(testsolution)H2(1atm)Pt What is the pH of the test solution?
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?