intsWhat is the formula of the complexcation?NH3ClINH3CoH3N'CINH3trans-[Co(NH,),CI]4O cis-[CoCl,(NH)J*cis-[Co(NH,),CI]*trans-[CoCl,(NH,),J

Answered: Image /qna-images/answer/b4052e19-26e9-4508-a148-2f0a9bfc3ffc.jpg

Answered: What is the formula of the complex…

Science

Chemistry

What is the formula of the complex cation? 1+ NH3 Cl WH3 Co 'CI H3N NH3

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter19: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 45E: Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?

See similar textbooks

Related questions

Q: e chemical formula of the following complex ions.

Q: Determine whether the complex ion [Fe(H2O)4Br2]+ can form geometric isomers.

A: Metal complexes that differ only in which ligand are adjacent to one another(cis) or directly across…

Q: Name the complex compounds or ions [[Ni(NH3)6]3[Co(NO2)6]2 [Pt (NH3)4Cl2] [PtCl6]…

A: The naming of coordination compound is based on the IUPAC nomenclature rule. The naming follows some…

Q: Which of the following will combine wth BH3 to form a stable complex ion? a. F- b. H- c. CN- d.…

A: Lewis acid is a compound having a vacant orbital which can accept an electron pair from a Lewis…

Q: Write down the IUPAC name of the following complex: K3[Fe(CN)6] (ii) Write the formula for the…

A: Organic chemistry involves nomenclature of compounds based on IUPAC rules. Similarly there are…

Q: A complex is written as NiBr2 . 6 NH3. If the complex is treated with excess AgNO3(aq), how many…

A: Calculate number of moles of AgBr will precipitate per mole of complex:

Q: What is the two possible isomer that could form from the synthesized complex? synthesized complex…

A: The complex given is K3[Fe(C2O4)3]·3H2O.

Q: chemical formula of the following complex ions.

Q: Determine the complex ion formed from the given reaction: Ca+2+ "-? Cál2 Cdl2 Cdl4 2 Cdl4+2

A: Cd2+ + I- ....> ? Above reaction is showing the formtaion of complex ion.

Q: Briefly define term. . complex ion

Q: complex ions.

Q: 8 The number of isomers of the complex ion [Co(en)3]³+ is 4 geometric isomers 2 optical isomers 2…

A: Given-> ->[Co(en)3]3+

Q: Which of the following will form the most stable complex with Pt2+ cation * O 2-2 Bipyridine…

A: The Pt will form the most stable complex with that ligand which is chelate ligands. Chelate ligands…

Q: The copper(I) ion forms a complex ion with CN2 according to the following equation: Cu+(aq) +…

A: The complex formation reaction is given as, 1) Cu+ (aq) + 3 CN- (aq) -----> Cu(CN)32- (aq)…

Q: The equilibrium equation for the formation of the complex PbBr42- is: Pb2+ + 4 Br = PbBr42-. Since…

A: kf is the formation constant for the complex. The higher the value of kf, the higher will be the…

Q: Structural, Geometric and Optical Isomers: For visual clarity, brackets [] and charges on the…

A: Given complex compound and we have to find the relationship between them.

Q: What is the IUPAC name of the complex [Ni(NH3)6]Cl2?

Q: (i) Write down the IUPAC name of the following complex :[Cr(NH3)2CI3(en)]Cl (en =…

A: We’ll answer the first question since the exact one wasn’t specified. Please submit a new question…

Q: 2. Calculate the molarity of FESCN²* in each of the standard solutions, assuming that the initial…

Q: What is the oxidation number of cobalt in the complex K3 [Co(C20.):].3H;0 ? A +6 B -6 C +3 D -3

A: When the given complex compound get Dissociates , it gives following ions/Molecules obtained- K3 […

Q: unstable

A: Given that A complex compound that has a central ion with a larger ratio of charge and radius.

Q: Which of the following will form the most stable complex with Pt2+ cation * 2-2 Bipyridine…

A: The question is based on the concept of coordination chemistry. We have to identify which of the…

Q: ng complex ions.

Q: The name of gold metal center when the complex ion exists in anionic state is а. argentate b. aurate…

A: We need to find which of these name is used for Gold metal in anionic complex.

Q: The formula of the complex: dibromobisoxalatoaurate(II) ion :

A: The given complex is dibromobisoxalatoaurate(II)ion.

Q: 104. The Hg+ ion forms complex ions with I as follows: Hg* (ag) +1 (ag) = Hgl" (aq) +1(ag) =…

A: Equilibrium concentration is defined as the state when reactants and products are present in the…

Q: The copper(I) ion forms a complex ion with CN2 according to the following equation:Cu+(aq) +…

A: Chemical equation Given Cu+(aq) + 3CN-(aq) ↔ Cu(CN)32-(aq) K = 1.0 * 1011 ................. A…

Q: What is the name of the complex [Cu(NH3)4(H2O)212*? O none of these O diaquatetrammoniumcopper(II) O…

A: To choose the correct name of the given complex In order to write the name of a complex, first all…

Q: The equilibrium equation for the formation of the complex PbBr42- is: Pb2+ + 4 Br = PbBr42. Since…

A: Pb belongs to group 14th element and shows two type of oxidation states i.e. +2 & +4. In above…

Q: In the complex ion, [Cr(ox)2(H2O)2]° the coordination number (C.N.) and oxidation number (O.N.) of…

A: Answer of this question:- Coordination number- it is defined as the number of coordinate bonds…

Q: Q3/ the dissociation constant for [Cu(NH3),] complex is 2.1x10°. The solubility product constant for…

A: Given: Dissociation constant for [Cu(NH3)4]2+ complex = 2.1 X 10-9 The solubility product constant…

Q: 50. How many unpaired electrons would you expect for each complex ion? [Cr(CN)6]*- b. [MnF]+…

A: a. [Cr(CN)6]4- Here, the central metal ion is Cr2+. We know Cr(24)=Ar3d54s1So, Cr2+=Ar3d4 A low spin…

Q: How many unpaired electrons would you expect for the complex ion: [Co(NH3 )6]4+

A: We will. Calculate unpaired electron in given molecule

Q: Which of the following complex ions has geometric isomers? explain a) [Co(NH3)6]³+ b) [Co(en)3]³+ c)…

A: For geometrical isomerism all the ligand should not be same.

Q: In the experiment on "Chemical Equilibrium and Le Chatelier's Principle", what complex ion is…

Q: The number of isomers of the complex ion [Co(en)3]³+ is 4 geometric isomers 2 optical isomers 2…

A: Here we are required to find the number of isomer .

Q: Structural, Geometric and Optical Isomers For visual clarity, brackets [] and charges on the complex…

Q: CI PH3 2 1 PH3 Pt Pt Pt CI Cl 3 3

A: Applying concept of trans effect.

Q: 1. Which of the following statement/s is/are TRUE regarding the formation of Cd(OH).- complex ion? *…

A: Lewis acids : They accept electrons. Lewis base : They donate electrons. Thus Cd2+ is a lewis acid…

Q: Copper(II) ions form a complex ion in the presence of ammonia [Cu(NH3)4 2+] [Cu2*(ag)][NH3]4…

A: The reaction is Cu2+aq+4NH3aq→CuNH342+aq ICE table can be drawn as…

Q: Co(H2O)62+(aq) + 4 Cl–(aq)⇄CoCl42–(aq) + 6 H2O a) Would a saturated solution of ammonium chloride…

A: In the given reaction, the colour of the reactant is pink while that of the product is blue.…

Q: Which of the following will combine with BH3 to form a stable complex ion

A: The HSAB concept is an important method to explain the stability of compounds and it is widely used…

Q: What is the total electron count of this complex? BAr". BArF4 СудР — Со — РСУ2 ČHĄSIME3 H-N-

Q: (i) Write down the IUPAC name of the following complex :[CO(NH3)5Cl]2+(ii) Write the formula for the…

A: i) The IUPAC name of the given complex [CO(NH3)5Cl]2+ is, Pentaamine chlorido-Cobalt (III) ion

Q: Pb(OH)2 (s) is amphoteric and forms the complex ion Pb(OH)42−(aq) with excess OH− (aq) in solution.…

A: Balanced reaction is givrn below

Q: Please answer all the parts or leave for someone else. Name each of the following complex…

Q: What is the concentration of Cu2+ in a solution of the complex ion Cu(NH3)42+ formed by reaction of…

Q: Which of the following metal ions will be the most likely to form complex ions? Calcium Potassium O…

Question

ints
What is the formula of the complex
cation?
NH3
Cl
INH3
Co
H3N
'CI
NH3
trans-[Co(NH,),CI]
4
O cis-[CoCl,(NH)J*
cis-[Co(NH,),CI]*
trans-[CoCl,(NH,),J

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?
Draw the Crystal field diagrams for [Fe(NO2)6]4- and [FeF6]3-. State whether each complex is high spin or low spin, paramagnetic or diamagnetic, and compare ?oct to P for each complex.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
The complex was synthesized with the formula [Co(CO)2(CN)2Br2] The spectreinfrared shows two bands that are attributed to C-O stretching, and only one for theC-N stretching Are bromides cis- or trans-? explain.
The complex trans-[Co(en)2Cl2]+ undergoes substitution of Cl- by H2O slower than the complex trans-[Co(en)2Cl2]. explain the reason for the difference
1. Co(NH3)63+ is a low-spin complex while CoF63- is a high-spin complex. Give a rational for this difference by applying valence bond theory (i.e. illustration the hybridization and filling up of the metal orbitals). Which is the inner orbital complex and the outer orbital complex?
The factor determining the mechanism observed in the substitution reactions of square plane complexes is that these complexes are not saturated with coordination. Right?False?
Determine the formula for a complex ion with metal ion X+2 and ligand Y-1 from the following Job's plot. A) XY+1 B) XY4-2 C) XY6-4 D) XY5-3 E) XY2 F) XY3-1
What is the expected number of Fe-Febondsper Fe atom in the complex ?