Answered: What is the IUPAC name of…

What is the IUPAC name of CH3CH(CI)CH,CH,CH(OH)CH3? A 5-Chloropentan-2-ol B 5-Chlorohexan-2-ol C 2-Hydroxy-5-chlorohexane 2-Chloro-5-hydroxyhexane

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter22: Organic And Biological Molecules

Section: Chapter Questions

Problem 3Q

See similar textbooks

Related questions

Q: What is the IUPAC name of the following compound? CI Br 2-bromo-3-chlorocyclohexene…

A: for IUPAC nomenclature numbering will start from alkene position, hence the carbon which is contain…

Q: 1. Give the IUPAC name and the common name of the following: CH3 -N-CH CHg - N - CH, 0 7. CH₂-C-OH…

A: Multiple question given here.

Q: What is the IUPAC name of the ether that has the structure shown? -O-CH3

A: We have to predict the iupac nomenclature of given structure.

Q: 1. Name each compound according to the IUPAC system. a) CH,CH,CHCH,CH,CH, CH, b) CH,CHCH,CH,CHCH,CH,…

A: Note: As per our guidelines, we are supposed to do only three subparts when question with multiple…

Q: What is the IUPAC name of this structure? Br O 4-bromo-5-ethyl-2-methylpentan-1-ol O…

Q: What is the IUPAC name for the following molecule? OH 3-hydroxyhexen-4-one…

Q: The IUPAC name of the compound H- is (a) 5-formylhex-2-en-3-one (b) 5-methyl-4-oxohex-2-en-5-al (c)…

Q: The correct IUPAC name for the following structure is: Br Br Select one: O a…

Q: Give the IMPAC name for each compound. 1. COOH COOH 2. Br 3. CH3 CHz COOH

A: Given we know about the iupac naming rule

Q: The correct IUPAC name for the following molecule is CH₂ CH₂-C-CH₂-CH=CH₂ ÓH a)…

A: Here we are required to find the IUPAC name for the given organic compound.

Q: What is the IUPAC name of this compound? H. O 2-Ethyl-4-methyl-5-oxo-2-hexanone O…

A: Answer--> 2-Ethyl-4-methyl-5-oxohexanal

Q: What is the IUPAC name of the following alkyl halide? H;CI I) trans-p-bromotoluene II)…

A: IUPAC nomenclature describes the structure of the compounds in a unique way.Every compound has given…

Q: What is the IUPAC name of the following molecule? a E O 3-ethyl-4-sec-hexyl-hexan-3-ol O…

Q: What is the IUPAC name of the following compound? a. trans-1-isopropyl-4-methylcyclopentane b.…

A: In this question, we will write the IUPAC name of the compound. You can see the details solution…

Q: 6. What is the correct IUPAC name of the following compound? A)…

A: We will be naming the above mentioned organic compound by using IUPAC nomenclature rule.

Q: Choose the appropriate IUPAC name for the following structure: Br. ....…

A: The systematic name of organic compounds based on IUPAC nomenclature system. IUPAC nomenclature…

Q: What is the IUPAC name of the following compound? O (E)-5-methyl-2-hexen-5-ol O…

Q: What is the IUPAC name for the following structure? -CH2CH3 CI O 2-chloro-2-ethyl cyclohexane O…

A: What is the IUPAC name for the following structure?

Q: What is the IUPAC name of the following compound? a. (R)-1-chloro-3-methyl-2-cyclohexene b.…

A: ANS. Option C. (R)-3-chloro-1-methylcyclohexene

Q: 8. Give the IUPAC name for each alkene. CH3 CH2CH2CH3 C=C Br a.

A: The given compound consist of an double bond between two carbon atoms. Hence, it is an alkene.

Q: What is the IUPAC name of CH3-CH2-CH-C-CH2-CH2 a CH3 3-chloro-4-heptanone…

A: ->For IUPAC name first of identify long chain which contains functional group . ->Then give…

Q: The correct IUPAC name for this compound is: O a. cis-1,5-dicyclohexyl-1-pentene O b.…

A: For the given compound: The parent atom is the hydrocarbon chain with a double bond…

Q: CH-CH3 CH3-CH2-CH2-CH-CH-CH3 CH2 ČH-CH3 What is the IUPAC name of this structure? OA.…

A: The given compound is: The longest carbon chain in the given compound is a 7-membered chain as…

Q: The correct IUPAC name is OH 2-methyl-3-butyn-1-ol 4-methyl-2-pentyn-5-ol 3-methyl-2-butyn-4-ol…

A: Applying rule of IUPAC nomenclature. Select long carbon chain and give the proper naming of suffix…

Q: Give the IUPAC name for each of the following compounds: 1. Br a) (CH3);C-COOH b) CH;-ĊH-CH,-COOH…

A: a) b)

Q: Provide the correct IUPAC name for the compound shown here. f HO 3- 4- 5- 7- sec- tert- iso 6- 2- di…

Q: . What is the IUPAC of the following compound но. a) 5-Hydroxy-3-ethyl-1-hexene b)…

A: The rules for writing IUPAC name of the molecule are: 1) Find the longest carbon chain in the…

Q: What is the complete IUPAC name for the following compound: H IOH H3C OH Select one: а.…

Q: H;C. CH3 What is the systematic IUPAC name of this compound? H;C Select one: a.…

A: Find the IUPAC nomenclature

Q: Choose an IUPAC name for the structure in 13-a O a. cis-1-isopropyl-2-methylcyclohexane O b.…

A: IUPAC name of a compound is given according to many rules. For the naming of any organic compound…

Q: 4. What is the IUPAC name of the following compound? CH3-CH-CEC-CH2-CH-CH3 CH3-CH2 CH2-CH3 (a)…

A: The given compound is an alkyne. The IUPAC name of alkynes end with a suffix "-yne".

Q: 1: Assign an IUPAC name to each of the iollowing compounds: 1. CH3-C-O- C-CH2-CH, 2.…

Q: What is the IUPAC name of the following compound? * CEN H2 | H2 H3C-CEC ---C-C -OH H3C…

A: The IUPAC name of the given compound is, 2-Hydroxymethyl-2-methylhex-4-yne nitrile

Q: 1. Give the IUPAC name for each of the following: a. CH3-CH2-CH2-C-OH | b. CH3-CH2-C-0-CH2-CH3 c.…

A: give Numbering to the longest carbon chain then Write name.

Q: What is the IUPAC name for the following compound? A) 3,5-dimethylhex-4-en-2-ol B)…

Q: What is the IUPAC name of this structure? HO O (E)-4-methylhex-4-en-1-ol O (Z-6-methylhex-2-en-6-ol…

A: The IUPAC nomenclature is a process of giving the scientific names to the organic compounds. This…

Q: What is the IUPAC name of the following compound? * CEN H2 | H2 H3C-CEC-C-C-C-OH H3C O…

Q: Question attached

A: Note: Since you have posted a question with multiple subparts, we will solve the first three…

Q: What is the IUPAC name for the compound shown? CH3 H3C- -CH-CH2-CH2-CH3 CH3 CH2-CH3 IUPAC name:

A: Answer IUPAC name for the compound

Q: 1. Give the IUPAC names for the following alcohols. (а) ОН OH (Ь) ОН (с) НО CH3CHCH2CHCHCH3…

A: Rules for IUPAC nomenclature: 1) select the longest carbon chain as parent chain. 2) identify the…

Q: Which is the correct IUPAC name of this molecule? CH3 _요 CH₂ -CH-CH₂-CHCI…

A: We have to find the IUPAC Name of the molecule.

Q: Question 5: what is the IUPAC name for the following molecule?

Q: The IUPAC Name for the following Compound is CH3 H;C H2 H2 H3C-C -C-C-C -C-C-C-CH3 H2 H2 H H2 H2…

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: What is the IUPAC name of the following compound? CI Br O 2-bromo-3-chlorocyclohexene O…

A: Which of the following is correct

Q: What is the IUPAC name of the following compound? CH3 CH3-C=C-CH2-CH-CH3 Select one: A.…

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3 (b) HO¬(CH2)8¬OH

A: (a) Given chemical formula, CH3CH(OH)(CH2)4CH(OH)C(CH3)3 IUPAC name of the given diol is…

Q: CH3-CH2-CH2 C-CH2 ČH3-CH2-CH2-CH3 12. What is the correct IUPAC name for the compound above? a.…

A: IUPAC (International Union of Pure and Applied Chemistry) helps to give a systematic name for any…

Q: What is the IUPAC name of the following compound? CH3 H;C O a. (R)-3-methyl-4-hexyne O b.…

A: The IUPAC name of the compound is given below

Q: Give the IUPAC name for the compound below. * CH3 H,C. 'CI OH 2-Chloro-5-hydroxyhexane…

A: IUPAC nomenclature of the given compound = ?

Q: What is the IUPAC name of the following compound? H. CI Br O 2-bromo-4-chlorobenzaldehyde…

Question

What is the IUPAC name of CH3CH(CI)CH2CH2CH(OH)CH3?
A 5-Chloropentan-2-ol
B) 5-Chlorohexan-2-ol
c) 2-Hydroxy-5-chlorohexane
D 2-Chloro-5-hydroxyhexane

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

General Physical Properties of Organic Compounds

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is the IUBAC name CH3 I CH3----CH----CH2CH3
Give the IUPAC name of the least water-soluble compound in each pair. Pair Name CH3-CH2-CH2-OH or CH3-CH2-OH CH3-CO-CH3 or CH3-CH2-CH2-CO-CH3 CH3-CHO or CH3-CH2-CH2-CHO
Give iupac name for this diol CH3CH(OH)(CH2)4CH(OH)C(CH3)3
What is the IUPAC names of 1. CH3CH2COOCH2CH3 2. CH3CH2-CO-O-CO-CH2-CH2-CH3
Give the IUPAC name of each of the following compounds. (a) CH3CH2CH2-----OH (b) CH3---CH2---C----H || O (c) CH3CH2CH2CH2---C--CH3 || O (d) CH3---CH2----CH2----C---OH || O
Draw the structure corresponding to each IUPAC name. a.3-ethyl-2-methylhexane b. sec-butylcyclopentane c.4-isopropyl-2,4,5-trimethylundecane d.cyclobutylcycloheptane e.3-ethyl-1,1-dimethylcyclohexane f. 4-butyl-1,1-diethylcyclooctane g.6-isopropyl-2,3-dimethyldodecane h. 2,2,6,6,7-pentamethyloctane i. cis-1-ethyl-3-methylcyclopentane j. trans-1-tert-butyl-4-ethylcyclohexane
Identify the IUPAC name of the given structure. A. 2 - methylhexan-5-one B. 5 - methylhexan-2-one C. 2 - heptanone D. 5 - heptanone Identify the IUPAC name of the given structure. A. 4 - bromopentan-3-one B. 1 - bromobutan-2-one C. 2 - bromobutan-one D. None of the above
The following names are incorrect by IUPAC rules. Determine the correct IUPAC name for each compound. a. 2-Methyl-4-pentene b. 3-Methyl-2,4-pentadiene c. 3-Methyl-3-cyclopentene d. 1,2-Dimethyl-3-cyclohexene
The following names are incorrect by IUPAC rules. Determine the correct IUPAC name for each compound. a. 2-Ethyl-2-pentene b. 4,5-Dimethyl-4-hexene c. 3,5-Cyclopentadiene d. l,2-Dimethyl-4-cyclohexene
Explain why each is an incorrect IUPAC name and write the correct IUPAC name for the intended compound. (a) 1,3-Dimethylbutane (b) 4-Methylpentane (c) 2,2-Diethylbutane (d) 2-Ethyl-3-methylpentane (e) 2-Propylpentane (f) 2,2-Diethylheptane (g) 2,2-Dimethylcyclopropane (h) 1-Ethyl-5-methylcyclohexane
What is the IUPAC name for the following compound ? A. 3,7-dichloro-5-ethyl-6-methyloctane B. 2-chloro-3-methyl-4-(2-chlorobutyl)hexane C. 2,6-dichloro-4-ethyl-3-methyloctane D. 3-chloro-5-(2-chloro-1-methylpropyl)heptane E. 2,3,4,6-dichloroethylmethyoctane
Give IUPAC name for CH3 | H3C-CH2-C-CH2-C-H | || CH3 O