What is the structure of propofol, which has the IUPAC name 2,6-diisopropylphenol? Propofol is an intravenous medication used to induce and maintain anesthesia.

Q: What is the correct IUPAC name for the alcohol shown here? A) dimethylpentanol B)…

A: This question belong to Nomenclature of organic compound. In this question, there are two option B),…

Q: Draw the structures for the four carboxylic acids of molecular formula C 5H 10O 2. Give the IUPAC…

A: Carboxylic acid: These are the organic acid with general formula of R-COOH, It contains carboxyl…

Q: Draw the molecule that corresponds to each IUPAC name. (a) (S)-hexan-3-amine; (b)…

A: (a)

Q: The correct IUPAC name of the following compound is: Но O a. 1,7-oxo-1-octanol O b.…

A:

Q: Which compound has the highest boiling point? A. methoxyethane B. trimethylamine C. ethylmethylamine…

A:

Q: Define Phenol–Formaldehyde .

A: Phenol is a chemical compound with an aromatic ring and -OH group attached to it. Formaldehyde is…

Q: What products are formed when an alcohol undergoes dehydration?

A:

Q: NH2 The IUPAC name of is: Br (a) 4-Bromo benzenamine (b) 4-Amino-1-bromobenzene (c) 4-Bromo…

A:

Q: Autooxidation of Benzaldehyde?

A:

Q: Draw a structure to correspond to each of the following names. a) Methyl-2-propanol b) Diphenyl…

A: a) Methyl-2-propanol name is ambiguous.  So, let us consider the name of given compound as…

Q: ОН HO HO

A:

Q: What intermolecular forces are present when 1-butanol is mixed with water?

A: Hydrogen bonding is present when 1-butanol is mixed with water. But ether only has weak dipole…

Q: Draw the structure for each of the following: a. 2-bromo-4-iodophenol            b.…

A: a). The name of the compound is 2-bromo-4-iodophenol, which shows that bromine and iodine atoms are…

Q: what are the structures for the dollowing written out compltetly b) hexonoate reacts with methyl…

A:

Q: What is the correct IUPAC name for the compound shown here? A) 2-butanol B) 3-butanol C) 2-pentanol…

A:

Q: What is a ketone with two functional groups and no fewer than 6 carbon atoms and has a medical…

A: This question is from biochemistry. Drugs which are used for medical purpose are all chemical…

Q: Which among the following is formed when alcohol is dehydrated? A. Aldehyde B. Ketone C. Alkene…

A: Dehydration means the removal of water molecule.

Q: 9. What is the IUPAC of the following compound? (CH3CH2)3COH a) 2-Ethyl-2-pentanol b)…

A: Given,

Q: What is the correct IUPAC name for the compound shown here? A) 2-methyl-3-propanol B) propanal C)…

A: Alcohols contain hydroxyl (OH) functional group.

Q: Draw the molecule that corresponds to each IUPAC name. (a) 3,3-dipropoxypentan-1-amine; (b)…

A: We are authorized to answer three subparts at a time, since you have not mentioned which part you…

Q: Give the IUPAC name for the following compound. a) ethyl propanoate b) ethyl propyl ester  c) ethyl…

A:

Q: what does 4-phenylcyclohexanol and 4-phenylcyclohexanone?

A: To write the structure of 4 -phenyl cyclo hexanol and 4 - phenylcyclohexanone.,

Q: What is the line structure and structural formula of 2-hydroxy-3-methoxy-1-hexanal?

A: Given :- IUPAC name =  2-hydroxy-3-methoxy-1-hexanal  To draw :-  Its line structure and structural…

Q: give the structure corresponding to each IUPAC name 1. 6,6-diethyl-4-nonanol

A: The IUPAC system provides a basic system that helps in the naming of organic compounds. The…

Q: The characteristic odor of fish is due to a mixture of alkylamines. Discuss about the alkylamines…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: What is the IUPAC name of the following compound? он O cis-4-ethylcyclohexanol O…

A:

Q: What is the IUPAC name of the following compound? H. (S)-3,4,4-trimethylpentanal O…

A: IUPAC nomenclature is used for naming of chemical organic compounds.

Q: . Based on the general IUPAC rules, which one of the following structures is 3-hydroxypropanal? он…

A: IUPAC stands for International Union for Pure and Applied Chemistry

Q: The IUPAC name for the following compound is: CH3-CH 2-CH a) acetaldehyde b) 1-ethanal c) propanal…

A: All chemical compounds can be named with certain rules which are purposed by IUPAC. It purposed to…

Q: distilled water compound and Diethyl ether compound

A: Answer : water- 1) molecular weight of water is 18 g/ mol  2) oxygen is connected with two hydrogen…

Q: Sulfur functional groups are often important in biological pathways. Consider the naming and…

A: Nomenclature:

Q: The common name of 1,2-ethanediol is ____________.     a. ethanol   b. antifreeze   c.…

A: 1,2-ethanediol is a alcohol which has two -OH group. It is also know as ethylene glycol. It's…

Q: What is the IUPAC name of the following molecule? 2-methyl-3-butanone 2-keto-3-methylbutane…

A: The molecule contains ketone and methyl groups as functional groups. The first priority is given to…

Q: 1. Write the correct IUPAC names for the following organic compounds: a) b) c) CI d)

A:

Q: Acetominophen is a widely used and an effective pain reliever. Identify the functional group circle…

A:

Q: what is the structure of a)butanol b) 2-propanol c) 2 methyl-2 propanol d) 2 methylbutanol

A: The compounds given are, a) Butanol  b) 2-propanol c) 2 methyl-2-propanol d) 2-methybutanol.

Q: Give the IUPAC name for the organic compound formed when 1-propanol is dehydrated in the presence of…

A: Dehydration of alcohol is done with concentrated sulphuric acid in high temperature.

Q: HO OCH3 но ОН A В ОН HO ОН РО D E

A: ->Hemiacetal is when one OH and one H , one OR  is present at same carbon  ->Acetal is when no…

Q: 1. Write the correct IUPAC names for the following organic compounds: a) b) c) CI

A: The given compounds have been named according to the rules set by the IUPAC by considering the…

Q: Does Phenols react with NaHCO3? Why or why not?

A: Phenols are more acidic than alcohols but less acidic than carboxylic acids.

Q: Draw a structure for each of the 2-ethyl-4-iodoaniline:

A: The given name is 2-ethyl-4-iodoaniline.

Q: The IUPAC name for the compound CH3-CH(CH3)-CH2-CH(NH2)-CH3 is a) 2-methylpentanamine

A: Rules for writing the IUPAC name, Prefix represents the substituent present in the molecule and its…

Q: Give acceptable names for two ketones ?

A: Solution-   2-Methylpentan-3-one  IUPAC naming of the given compound is correct because as we know…

Q: the following, which compound has the highest boiling point? a. Hexanoic acid b. 1-Hexanol c.…

A:

Q: Draw the hydrogen bonding that takes place between(a) two molecules of ethanol.(b) two molecules of…

A: