When the Ti3+ ion is complexed by ligands X (a neutral molecule) and Y" (an anion) it gives octahedral species of the type [TIX)6)3+ and [Ti(Y)6)³, respectively, which have two different colours. The complex containing ligand X shows a single absorbance in the visible region with a peak maximum at 520 nm, while that containing Y has a peak maximum at 580 nm. Which of the two ligands produces the higher crystal field splitting energy (CFSE) for Cu2+? O a. The crystal field splitting is not caused by the ligand as one complex is a cation and one is an anion O b. The CFSES for the two complexes are the same O. Ligand X produces the higher CFSE O d. Ligand Y produces the higher CFSE

When the Ti3+ ion is complexed by ligands X (a neutral molecule) and Y" (an anion) it gives octahedral species of the type [TIX)6)3+ and [Ti(Y)6)³, respectively, which have two different colours. The complex containing ligand X shows a single absorbance in the visible region with a peak maximum at 520 nm, while that containing Y has a peak maximum at 580 nm. Which of the two ligands produces the higher crystal field splitting energy (CFSE) for Cu2+? O a. The crystal field splitting is not caused by the ligand as one complex is a cation and one is an anion O b. The CFSES for the two complexes are the same O. Ligand X produces the higher CFSE O d. Ligand Y produces the higher CFSE

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section: Chapter Questions

Problem 105QRT

See similar textbooks

Similar questions

Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
The glycinate ion, H2NCH2CO2, formed by deprotonation of the amino acid glycine, can function as a bidentate ligand, coordinating to a metal through the nitrogen of the amino group and one of the oxygen atoms. Glycinate ion, a bidentate ligand A copper complex of this ligand has the formula Cu(H2NCH2CO2)2(H2O)2. For this complex, determine the following: (a) the oxidation state of copper (b) the coordination number of copper (c) the number of unpaired electrons (d) whether the complex is diamagnetic or paramagnetic
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Nickel and palladium both form complexes of the general formula M(PR3)2Cl2. (The ligand PR3 is a phosphine such as P(C6H5)3, triphenylphosphine. It is a Lewis base.) The nickel(II) compound is paramagnetic whereas the palladium(II) compound is diamagnetic. (a) Explain the magnetic properties of these compounds. (b) How many isomers of each compound are expected?