Which ligand is more likely to form a high-spin complex?а.ethylenediamine (en)b.COС.CNd. Which of the following complexes exhibitJahn-Teller distrotion?а.[Cr(H20)6]Cl2b.[Cr(H20)6]Cl3С.[Fe(H20)6]3+d.[Mn(H20)6]Cl2

Hello. Since your question has multiple parts, we will solve the first question for you. If you want…

Answered: Which ligand is more likely to form a…

Science

Chemistry

Which ligand is more likely to form a high- spin complex? а. ethylenediamine (en) b. CO С. CN d. F

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section: Chapter Questions

Problem 95QRT

See similar textbooks

Related questions

Q: How many of the following complex(es) exhibit(s) Jahn-Teller distortion? (Hint: aqua is a weak field…

Q: So I am working with an octahedral complex that has two weak field ligands (Cl) and 4 strong field…

Q: Which species are more likely to act as ligands? (a) Positivelycharged ions or negatively charged…

A: (a) Determine the species that act like as ligands among positively charged ions or negatively…

Q: chelating ligands?

Q: [Cr(H₂O)₆]²⁺ is violet. Another CrL₆ complex is green.Can ligand L be CN⁻? Can it be Cl⁻?…

A: Given: [Cr(H₂O)₆]²⁺

Q: For the two complex ions [Mn(CN)6]4− and [Mn(H2O)6]2+ (a) Are all metal ligand bonds equal to…

A: We are given two complex, [Mn(CN)6]4−having CN as the pi acceptor an a strong field ligand.…

Q: 25. Which complex obeys the effective atomic number rule ? [Cr(NH3)6]3+ O [Co(NO2)6]3- O…

A: For effective atomic number rule, complex contains total number of electrons 36 or 54 ( means equal…

Q: The formations of [cis-PtCh(NH3)2] and [trans-PtCl½(NH3)2] are different although same ligands are…

A: The formation of above complex cab be explain by trans effect . the trans effect is the effect that…

Q: 13. A complex ion has been observed which starts with a violet color with six aqua ligands attached.…

Q: ) Figure 5 shows four energy diagrams, labelled A to D. The diagrams depict possible configurations…

Q: Association reaction is the only pathway for ligand substitution in a square planar complex because…

Q: Which complex ion includes a bond angle of 107°? A [Cr(NH;),J** B [CuCl,] C [CuClj?- D [Cr(H,O),1*

A: The Complex [CuCl4]2- exists in a discrete tetrahedral shape. Its crystal structure is taken from…

Q: How many places on the ligand EDTA can simultaneously bind to a single metal atom?

A: EDTA is a hexadentate ligand because only one ligand donate the electrons from six donor sites to…

Q: 36. What kind of a ligand "Ethylene diamine: H2N-CH2-CH2-NH2 is? a) Unidentate b) Bidentate c)…

A: Unidentate ligand :- ligand which has only one donor site. Bidentate ligand :- ligand which has two…

Q: Explain the following: (i) Nickel does not form low spin octahedral complexes. (ii) The Tt-complexes…

A: Nickel does not form low spin octahedral complexes. Because, the electronic configuration of Nickel…

Q: (a) Explain the hybridization and structure of the following complexes [Cu(NH3)4]SO4 Zn₂[Fe(CN)6]…

A: Given,

Q: (a) Draw all the possible isomers of [Fe(NH3);Br3] and for each isomer clearly indicate the…

A: a) There are two possible isomers of the given compound, fac and mer. These are shown as below:…

Q: 17

A: 18 electron Rule : Just as organic chemists have their octet rule for organic compounds, so do…

Q: Amongst the two listed in each question, which complex has a faster ligand exchange rate? Give a…

Q: Let’s consider octahedral Sc3+ and Ti3+ complexes. How many d electrons will each have? Sc3+: 0;…

A: How many d electrons will each have? Sc3+ and Ti3+

Q: Which complex will absorb visible light with the longest wavelength? O IVIH20)6]3+ [VBr6]3- [VCI6]3-…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: [FeL6]* complex (L indicates a monodentate ligand) has a magnetic moment of approximately 1.73 B.M.…

Q: Explain the differences between high-spin and low-spin metal complexes.

A: Complexes with weak field ligands have the same number of unpaired electrons as the free metal ion…

Q: How many unpaired electrons are there in a high-spin octahedral Fe2+ complex? A diagram will likely…

A: Octahedral Fe2+ complex:

Q: octahedral complex is found to absorb visible light, with the absorption maximum occurring at 507…

A: The absorption with maximum wavelength by an electron is equal to the energy difference between…

Q: 4) What is the shape of the complex ion? 5) Are the ligands strong or weak? 6) Is the compound high…

Q: Why is [Co(NH3)5NCS]Cl2 N-bonded but K3[Co(CN)5SCN] is S-bonded. Consider the amount of space…

A: Nitrogen have smaller size than sulphur so it is less crowded ligand than sulphur

Q: For the complex [Pt(NH3)2(H2O)2](NO3)2 draw the d-orbital splitting diagram for platinum (Pt) (high…

A: Pt forms square planar complex.

Q: The complex [Mn(NH3)6]2+ contains five unpaired electrons.Sketch the energy-level diagram for the d…

Q: True or false: a. Weak field ligands tend to form low spin complexes upon binding with metal…

Q: W, X, Y, and Z are different monodentate ligands.a. Is the square planar [NiWXYZ]2+ optically…

A: a)

Q: When the valence d orbitals of the central metal ion are split in energy in an octahedral ligand…

A: Question.1:- When the valance d-orbital of central atom split in energy in an octahedral ligand…

Q: How many unpaired electrons are in the low-spin octahedral complex [Co(CN),Jª¯? Provide your answer…

A: The no. Of unpaired electron in given complex = 1 (one).

Q: Name the following ligands: A.H2NCH2.CH2NH2 B. NO3 C. NH3 D. Br

A: a) Ethylenediamine b) Nitrato

Q: 2. Two octahedral complex are shown as below. OCH3 H3CO, OCH3 MeO2C CO,Me Al H3CO OCH3 MeO2C cO,Me…

A: We need to find the oxidation state of the central metal atom. Then we can be able to find the spin…

Q: H. F3C-M

A: Pi donor means ligand which donate pi electron density to metal . Pi acceptor means metal transfer…

Q: For the following transition metal complexes match the complex with its corresponding number of d…

A: The electronic configuration with the corresponding number of d electrons and low spin / high spin…

Q: Write the hybridization and shape of the following complexes: (i) [CO(NH3)6]3+ (ii) [NiCl4]2-…

A: Hybridization involves the mixing up of of atomic orbitals into new hybrid orbitals with different…

Q: The term free ion of metal contained in [Ti(H2O)6]3+ is.......... (atomic no. of Ti = 22) A. 2F B.…

A: Since you have posted multiple questions, we are entitled to answer the first only. 17) The complex…

Q: ligand

Q: The octahedral complex ion [MnCl1* has more unpaired spins than the octahedral complex ion…

A: For [MnCl6]4- The oxidation state for Mn is +2. Cl is a very weak field ligand so it will form a…

Q: The complex [Fe(CO)6]+2 exhibits π-acceptor behavior. Using ligand field theory, draw the molecular…

A: Ligand field theory is the theory which includes both the ionic and covalent bonding of the…

Q: Name the following complex: [Ni(en)2(F)(NO2)][PtCl3(py)]

A: bis(ethylenediamine)flurido(nitrito-N)nickel(III) trichloridopyridineplatinate(II)

Q: The type of isomerization in the following complex is 3+ 3- 3+ 3- NH3 NH3 CN NC CN Cr. NC CN CN NH3…

A: Solution : Coordination compounds consist of central metal atom or ion surrounded by ions…

Q: <p>Why are almost all tetrahedral complexes high-spin?

A: High spin means, there will be less pairing of electrons than unpaired electrons. For pairing of…

Q: Which one of the following complex ions has a square planner geometry? A [Cro B VO3 [MnO4] D [ZnCla]…

A: Correct option is E i.e. [PtCl4]2- Pt+2 has a d8 configuration. Cl- is a weak field ligand. So,…

Q: The octahedral complex ion [Co(NH3)6]** has fewer unpaired spins than the octahedral complex ion…

Q: What is the difference between a monodentate and a multidentate ligand? Is a chelating ligand…

A: A ligand contains 1 or more donor atoms which are coordinated to the central metal atom to form a…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

Which ligand is more likely to form a high-
spin complex?
а.
ethylenediamine (en)
b.
CO
С.
CN
d.

Which of the following complexes exhibit
Jahn-Teller distrotion?
а.
[Cr(H20)6]Cl2
b.
[Cr(H20)6]Cl3
С.
[Fe(H20)6]3+
d.
[Mn(H20)6]Cl2

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
Classify each ligand as monodentate, bidentate, and so on. (a) (CH3)3P (b) H2N(CH2)2NH(CH2)2NH2 (c) H2O
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.