For the following transition metal complexes match the complex with its corresponding number of d electrons:A = [PtFj?-B = [Zn(H2O)a]?*C= [Ru(CN),J*-D = [Cr(OH)2(ox)2]3-E = [Au(NO2)4] For the following transition metal complexes determine whether they are low spin or high spin:A = [PtFj2-B = [Zn(H2O)4]²*C= [Ru(CN)&]4-D = [Cr(OH)2(ox)2]³-E = [Au(NO2)4]You will need to use the following information:A. = f (gion)

The electronic configuration with the corresponding number of d electrons and low spin / high spin…

Answered: For the following transition metal…

For the following transition metal complexes match the complex with its corresponding number of d electrons: A = [PtF2- B = [Zn(H2O)a]?* C= [Ru(CN),+ D = [Cr(OH)2(ox)2]3- E = [Au(NO2)4] %3!

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter19: Transitition Metals, Coordination Chemistry And Metallurgy

Section: Chapter Questions

Problem 19.51QE

See similar textbooks

Related questions

Q: Rhol(PPhs)s 9volume eICCtronsinRn in Cr which are The L-type ligands? Oxidanon State of Rn,cr…

A: The L type ligands in [RhCl(PPh3)3] is PPh3; i.e. triphenylphosphine. The L type ligand in Cr(CO)6…

Q: [Cr(H₂O)₆]²⁺ is violet. Another CrL₆ complex is green.Can ligand L be CN⁻? Can it be Cl⁻?…

A: Given: [Cr(H₂O)₆]²⁺

Q: Name the following complexes and draw the structures of one possible isomer of each: (i)…

A: Note - Since you have asked multiple question, we will solve the first question for you. If youwant…

Q: [Cr(H2O)6] 2+ is violet. Another CrL6 complex is green. Can ligand L be CN-? Can it be Cl-? Explain.

A: The octahedral splitting energy of transition elements is the difference in the energy of the…

Q: Which ions are unlikely to form colored coordination complexes in an octahedral ligand environment?…

A: Colour for the complex is arise due to electronic transition. If no any transition possible compound…

Q: CI H20, 1H,0 Co 'CI H2 H20

Q: 3. The following complexes are charged. Give possible cou neutral coordination compound. Include the…

A: In this question, name, charge and stoichiometry of counterions are to be determined which are used…

Q: The complex was synthesized with the formula [Co(CO)2(CN)2Br2] The spectre infrared shows two bands…

A: The complex synthesized is: [Co(CO)2(CN)2Br2]

Q: Predict which complex has more unpaired electrons and whether the complexes will be paramagnetic or…

A: We can determine magnetic behaviour by using crystal field theory.

Q: (b) Give 5 properties of metal ions that will affect the structure and bonding in coordination…

A: The answer is attached below-

Q: Which of the following octahedral complexes is expected to show optical isomerism? Select one: HgN,…

A: The complex that has plane of symmetry is optically inactive. The complex that has no plane of…

Q: Platinum(IV) is readily complexed by ethylenediamine. Draw the structuresof both enantiomers of the…

A: Ethylenediamine (en) is a bidentate chelating ligand in coordination compounds with the two donor…

Q: 5(а) [CoF6]* is a high-spin octahedral complex. Using the crystal field splitting diagram, explain…

A: We have to tell why [CoF6]3- is paramagnetic and we have to give the formula of given name of…

Q: In the coordination compound (NH4)2[Fe(OH2)F;], the e is octahedrally coordinated. (a) Based on the…

A: a) The given compound is (NH4)2[Fe(OH2)F5] or [Fe(OH2)F5]2-. The oxidation state of Fe is +3 and it…

Q: 4) What is the shape of the complex ion? 5) Are the ligands strong or weak? 6) Is the compound high…

Q: Which complex ion possesses the largest number of unpaired electrons? 21 23 24 25 26 27 28 29 30 Sc…

A: We have to see the splitting diagram. And nature of ligand to predict the unpaired electron. Strong…

Q: The high spin d complex [Cr(H20]z2* is labile but the low spin d' complex ion [Cr(CN)6]+ is inert.…

Q: The complex [Mn(NH3)6]2+ contains five unpaired electrons.Sketch the energy-level diagram for the d…

Q: Two Fe(II) complexes have low spin but different ligands. The solution of one is green, while the…

A: Given:- Two Fe(II) complexes have low spin but different ligands. The solution of one is green,…

Q: Write the coordination number and oxidation state of Platinum in the complex [ Pt ( en ) , C1₂ ]

Q: Which complex is expected to have a white color ? O [cu(NH3)4]2+ O K3[TICI6] O (TI(H20)6]C13 O…

A: →The color of the complex in transition metals is governed by the d‐d transitions. If…

Q: 2. For each of following complexes specify a) The complex ion b) The ligands (draw them if they are…

A: a) K4[Fe(ox)3]→4K++[Fe(ox)3]4- The complex ion is [Fe(ox)3]4-. b) The ligand is oxalate, c) The…

Q: OCH3 H3CO, LOCH3 Fe Al H3CO* OCH3 OCH

A: CFSE stands for the crystal field stabilization energy. it measures the amount of stabilization…

Q: In the given complex of [Fe(CO)6] having CO ligand, carbon and oxygen both having lone pair of…

A: if wae observe the carbon monoxide molecule it has a dative bond.

Q: 3. form 93. In order to form a complex ion 1. the central metal ion or atom shouls have low laying d…

A: Metal complexes are formed by forming metallic or coordiantion bonds with neutral or negative atoms…

Q: Write the formula and the name of each complex ion- a complexion with Co3+ as the central ion and…

A: (1) a complexion with Co3+ as the central ion and three NH3 molecules and three CN-ions as ligands…

Q: a) name and draw the possible isomers of the complex in the compound [Cr(NG3)4Br2]Br.

Q: The high spin d complex [Cr(H2O]6²* is labile but the low spin dď complex ion [Cr(CN)6]4- is inert.…

A: in both the complex the Cr is +2 oxidation state ,that is d4 electronic configuration, in presence…

Q: SAIC Ex7.1 Name and draw structures of the following complexes: a) [Ni(CO)4], b) [Ni(CN)4] , v)…

A: a) [Ni(CO)4] - Tetracarbonylnickel (0) b) [Ni(CN)4]2- - Tetracyanonickelate (II) ion c) [CoCl4]2-…

Q: A complex absorbs photons with an energy of 4.51 * 10-19 J. If this is the only place in the visible…

A: Given: Energy, E=4.51×10-19 J

Q: Below are five pairs of transition metal complexes. For each pair, select the complex that is more…

A: Since you have posted multiple subparts , we are doing first 3 for you. To do the rest repost the…

Q: The octahedral complex ion [CoF6]3– is paramagnetic with four unpaired 3d-electrons, whereas the…

Q: 4. (a) Transition metals form complexes by combining with ligands. What is (i) A transition metal?…

A: (i) A transition metal In the periodic table, the elements are classified into four blocks namely,…

Q: abilization Energy for the following complexes and classify the complexes as diamagnetic vs…

A: Crystal field stabilization energy (cfse) is the energy of splitting of d- orbital of a metal center…

Q: What is the formula for the complex ion made by iron(IIl) with 4 aqua and two thiosulfato (S,0022)…

A: Known Metal ion - Fe3+ ; ligands are 4 aqua - 4 H2O S2O32- Complex should be written in square…

Q: 23.28: a,b,c

A: The central metal ion in the complex K3[FeCN6] is Fe. The K atoms are written out of the…

Q: The ion [Fe(CN)6]3- has one unpaired electron, whereas[Fe(NCS)6]3- has five unpaired electrons. From…

A: The coordination complexes can be defined as the complex compounds which have coordinate linkage…

Q: The coordination complex [Cr(CO)6] forms colorless,diamagnetic crystals that melt at 90 °C. (a) What…

A: (a)

Q: For each of the following complexes: a. [Fe(Br)s]3- i. Calculate the number of d electrons. ii. Draw…

Q: Write the IUPAC name of the complex [CoBr2(en)2]+. (b) What type of isomerism is shown by the…

A: Since you have posted multiple questions, we will solve only first question for you. If you want any…

Q: 9 A complex with the composition [MA₂B₂]X₂ is found to have no geometrical isomers. Both A and B are…

A: [MA2B2]X2 ->The coordination number of metal is 4.

Q: What is the coordination number for the transition metal in the following complexes? a)…

A: To calculate coordination numbers of complexes , we have to look about ligands surrounding the…

Q: What kind of isomerism can the following complexes have? [Cd(NH3)2Cl4]SO4 , and [Mn(H2O)2(NH3)3OH]+

A: The exchange of the ions without changing the identity of a complex molecule is called Ionization…

Q: b) Experimentally, it is found that the value of Ao varies with the chemical nature of the ligand…

A: In presence of the strong ligand (CO) the value of the crystal field splitting energy is higher and…

Q: Consider the complexes d bis(ethylenediamine) nickel(II), [Ni(en)₂]+², versus tetracyanidoferrate…

A: Paramagnetic substances have unpaired electrons and diamagnetic substances have paired elections.

Q: Crystal field splitting can impact the properties of coordination complexes. In particular, whether…

Q: For which member of the following pairs of complexes would Δo be the larger and why: (a)…

A: Δo is the crystal field splitting energy i.e the difference between eg and t2g orbitals. In…

Question

For the following transition metal complexes match the complex with its corresponding number of d electrons:
A = [PtFj?-
B = [Zn(H2O)a]?*
C= [Ru(CN),J*-
D = [Cr(OH)2(ox)2]3-
E = [Au(NO2)4]

For the following transition metal complexes determine whether they are low spin or high spin:
A = [PtFj2-
B = [Zn(H2O)4]²*
C= [Ru(CN)&]4-
D = [Cr(OH)2(ox)2]³-
E = [Au(NO2)4]
You will need to use the following information:
A. = f (gion)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?