Which of the following colorful octahedral complex ion solutions should have the longest Amax ? More information is needed to make a determination. Mn(CN)3CI33- Mn(CN)2CI43- Mn(CN)5CI3- Mn(CN)Cl53- Mn(CN)4CI23-

Which of the following colorful octahedral complex ion solutions should have the longest Amax ? More information is needed to make a determination. Mn(CN)3CI33- Mn(CN)2CI43- Mn(CN)5CI3- Mn(CN)Cl53- Mn(CN)4CI23-

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 4ALQ

See similar textbooks

Related questions

Q: Determine whether the complex ion [Fe(H2O)4Br2]+ can form geometric isomers.

A: Metal complexes that differ only in which ligand are adjacent to one another(cis) or directly across…

Q: 5.16 Classify the following complex ions as inert or labile: (a) [Ru(NH3)5py]3+ (b) [Cr(acac)3] (c)…

A: The metal ion having d electron 0,1,2,7,8,9 electron are labile. The metal ion having d electron…

Q: Give formulas for the following complex ions. tetracarbonyldihydroxochromium(III) ion

A: Given, The formula of tetracarbonyldihydroxochromium(III) ion is:

Q: Given the complex, [Rh(en)2(NO2)2]NO2 1) Name it. 2) What is the oxidation state of the metal? 3)…

Q: Two ligands, A and B, both form complexes with a particular metalion. When the metal ion complexes…

Q: Draw the structure of the complex ions below: (a)…

A: A complex ion consists of a metal ion at the centre with a number of ligands (other molecules or…

Q: What is the coordination number of the chromium ion in the complex ion [Cr(NH₃)₄Cl₂]⁺?

A: The compounds which contain a central metal atom or ion surrounded by oppositely charge ion or…

Q: The complex diamminedichloroplatinum(II), [Pt(NH3)2CI2], is diamagnetic and exhibits geometrical…

A: If we check the oxidation state of Pt Pt + 0 - 2 = 0 Pt = 2 NH3 being neutral molecule contributes…

Q: A complex ion has been observed which starts with a violet color with six aqua ligands attached. It…

A: In transition metal complexes the d orbital of the central metal ion gets split into two sets of…

Q: Write the formula for each complex ion or coordinationcompound.a. hexaaquanickel(II) chlorideb.…

A: Write the formula for each complexion or coordination compound. a. hexaaquanickel(II) chlorideb.…

Q: In the visible region of the spectrum, the trans-[Co(NH3)4Cl2] ion + shows a band at 15,000 cm-1.…

A: This question is related to Crystal field theory which explains the breaking of degeneracies of…

Q: Draw the Lewis structure of the complex ion SbS₃³⁻. How many bonds does the central atom have?

A: Draw the Lewis structure of the complex ion SbS₃³⁻. How many bonds does the central atom have?

Q: For the following complex ion: The transition metal has an oxidation number of with ligands…

Q: What is the formula for the complex ion pentaammineaquaruthenium(III) ?

A: The given complex ion is = pentaammineaquaruthenium(III) The formula of the complex ion =?

Q: Consider the complex ion [Ag(NH3)2Cl2(C2O4)]3- What is the oxidation state of the metal atom? Write…

A: Note: According to the rules we can answer only first three parts. Pls repost others Given:…

Q: Identify the charge on the metal in the following complex ions or compounds. 1. [Cu(CN)4]?- 2.…

Q: The name of gold metal center when the complex ion exists in anionic state is а. argentate b. aurate…

A: We need to find which of these name is used for Gold metal in anionic complex.

Q: <p>How can you tell whether a complex ion is optically active?

A: The activity of a complex can be found out by observing the structure of the complex and also…

Q: 9b. Name the complex ion Cr(CN)(NO₂)(H₂O)(NH3] and note that it can exhibit chiral properties. There…

Q: 1. What is the coordination number of Ni in the complex? 2. What is the oxidation number of Ni? 3.…

A: Given, NiNH34ClO42Required, 1. The coordination number of Ni in…

Q: 2) Using the stepwise formation constants given, calculate the net formation constant for the…

A: The stepwise complexation of Cu2+ and en (H2NCH2CH2NH2) are - Cu2+ +…

Q: Determine the number of unpaired electrons for [OsCl6]3- complex.

Q: Give formulas for the following complex ions. pentaammineaquaruthenium(III) ion

Q: 1. What is the coordination number of the central metal atom? 2. What formula should appear inside…

A: Coordination complex contains one central atom or ion i.e. basically metallic and is named as…

Q: When a coordination compound CoCl3.6NH3 is mixed with AgNO3, 3 moles of AgCl are precipitated per…

A: Interpretation: A coordination compound CoCl3.6NH3 is mixed with AgNO3, 3 moles of AgCl are…

Q: Write the IUPAC name of the complex [Cr(NH3)4Cl2]+. What type of isomerism does it exhibit?

A: IUPAC name for [Cr(NH3)4Cl2]+ is tetraaminedichlorochromium (III)

Q: 15.. An example of a diamagnetic complex ion (no unpaired electrons) is: a) (FeF6]4- b) [Fe(H2O)6]2+…

A: We know that If complex has unpaired electrons, then the complex is paramagnetic Complex. if…

Q: Based on the reaction below, what is the correct K, expression for the this complex ion? 3+ Co3+ +…

A: Kf for equilibrium reaction is :- Kf = [product]÷[reactant]

Q: The oxidation state of cobalt in the complex Mg2[COF6] is: 1 a. +4 b. +1 C. +2 d. +3 If the specific…

A: 1. Each Mg and F has +2 and -1 charge respectively. That's why : 2(+2)+x+6(-1) = 0 Or, x = +2…

Q: Which of the following complex ions has geometric isomers? explain a) [Co(NH3)6]³+ b) [Co(en)3]³+ c)…

A: For geometrical isomerism all the ligand should not be same.

Q: a) Calculate the concentration of Zn+2 in a 0.01 M solution of Zn(NO3)2 and containing an added NH3…

A: Zn2+ + 4NH3 ⇌ [Zn(NH3)42+] It is the overall reaction equation.Now, moles of Zn = 0.01As per the…

Q: Which of the following colorful octahedral complex solutions should have the longest Amax? Mn(CO)62…

Q: The formula of the complex: `NH2 H2N. Co. H2N ‚NH2

A: The compounds having coordination covalent bonds which form when metal ions react with polar…

Q: In the complex Hs(CN)54 how many transition allowed could this complex have 2 4 None of them

A: Calculation of oxidation state in Hs(CN)54-: x+(-1×5)=-4x=+1 The electronic configuration of Hs+ is…

Q: Answer the following questions related to the complex ions shown in the figure. Notice that there…

A: The nomenclature and oxidation state of the coordination compounds can be evaluated by the rules of…

Q: What is the coordination number of Ni in the complex? What is the oxidation number of Ni? What…

A: Coordination Compound - chemical compounds that have nonmetal atoms or groups of atoms, known as…

Q: ÇO,Me MeO2C, .CO2ME N' Mn N' MeO2C `CO2ME CO2ME

A: what's the hybridisation of the metal in the complex ?

Q: The pentacarbonylferro complex (0) has a trigonal bi-pyramid geometry. Demonstrate the orbital…

A: In this question, it is given that pentacarbonylferro complex (0) has a trigonal bi-pyramid…

Q: How many stereoisomers does the octahedral complex [Ni(bipy)2BR2] have? How many of these…

A: Given compound is [Ni(bipy)2Br2].

Q: Provide the formula for the following complex ion:tetraamminemanganese(II) ion

A: Here we need to draw the formula of tetra ammine manganese (II) ionThis ion contains four ligands…

Q: Write out structure representations for all isomers of the following complexes: (c) Pd(en)(SCN)2…

Q: For each of the following transition metal complex ions (a) [FeBr2(OH)(NO3)]¹- (b) [RhF3(SCN)3]4-…

Q: Which of the following describe the following complex ion? FESCN} Cl2 Fe is the metal through which…

A: In all complex the ligand are connected by metal atom Here in this complex Fe is the central metal…

Q: Note the complexes: i) [Co(en)3]3+; ii.) [RuBr4(en)]-; iii.) [RuClF(en)2]+ Which of the…

Q: How does the Tanabe-Sugano diagram predict the color of a complex

A: Coloured complexes: Colors of transition metal complexes result from absorption of a smallportion…

Q: Name the following complex ions. formula name olo

Q: Give the coordination number for each metal ion in the following compounds:(a) [Co(CO3)3]3− (note…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: For this three part question consider this complex ion: (Note that CO is a strong field ligand)…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

Which of the following colorful octahedral complex ion solutions should have the longest
Amax ?
More information is needed to make a determination.
O Mn(CN)3CI33-
Mn(CN)2CI43-
Mn(CN)5C13-
Mn(CN)CI53-
Mn(CN)4CI23-

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
What is the coordination number of the central metal atom in the following complexes? (a) [Fe(H2O)63+] (b) [Pt(NH3)Br3] (c) [V(en)Cl42] (d) [Au(CN)2+]
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.