Without doing any calculations, determine the sign of ASgys for each of the following chemical reactions. Drag the appropriate items to their respective bins. Reset Help CH (g) + 202(g)→ CO2(g) + 2H2O(1) HC1 (g) + NH3 (g) → NH,CI (s) 203 (g) → 302 (g) PCl3 (1) + Cl2(g)→PC15(s) As greater than 0 AS smaller than 0

Without doing any calculations, determine the sign of ASgys for each of the following chemical reactions. Drag the appropriate items to their respective bins. Reset Help CH (g) + 202(g)→ CO2(g) + 2H2O(1) HC1 (g) + NH3 (g) → NH,CI (s) 203 (g) → 302 (g) PCl3 (1) + Cl2(g)→PC15(s) As greater than 0 AS smaller than 0

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter17: Chemcial Thermodynamics

Section: Chapter Questions

Problem 17.66QE

See similar textbooks

Similar questions

How is the sign of q, heat, defined? How does it relate to the total energy of the system?
What is the sign of the work when a refrigerator compresses a gas (the system) to a liquid during the refrigeration cycle?
Identify the sign of the work when a fuel-oxygen mixture (the system) burns, propelling an automobile (part of the surroundings).
When a rocket is launched, the burning gases are the source of the motion. If the system is the rocket (including fuel), what is the sign of the work?
The statement Energycan beneithercreatednor destroyedis sometimes used as an equivalent statement of the first law of thermodynamics. There areinaccuracies to the statement, however. Restate it tomake it less inaccurate.
Coal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.
Ethanol burns in air or oxygen according to the equation C2H5OH(l)+3O2(g)2CO2(g)+3H2O(g) Predict the sign of S for this reaction.
Three gas-phase reactions were run in a constant-pressure piston apparatus as shown in the following illustration. For each reaction, give the balanced reaction and predict the sign of w (the work done) for the reaction. . If just the balanced reactions were given, how could you predict the sign of w for a reaction?
Nickel metal reacts with carbon monoxide to form tetra-carbonyl nickel, Ni(CO)4: Ni(s)+4CO(g)Ni(CO)4(g) This reaction is exploited in the Mond process in order to separate pure nickel from other metals. The reaction above separates nickel from impurities by dissolving it into the gas phase. Conditions are then changed so that the reaction runs in the opposite direction to recover the purified metal. (a) Predict the sign of S for the reaction as written above. (b) Use tabulated thermodynamic data to calculate H, S , and G for the reaction. (c) Find the range of temperatures at which this reaction is spontaneous in the forward direction.
When a gas expands, what is the sign of w? Why? When a gas contracts, what is the sign of w? Why? What are the signs of q and w for the process of boiling water?