Answered: Write a balanced chemical equation…

Write a balanced chemical equation based on the following description: aqueous iron(III) chloride reacts with aqueous ammonium sulfide to make aqueous ammonium chloride and solid iron(III) sulfide

Chemistry & Chemical Reactivity

9th Edition

ISBN:9781133949640

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter3: Chemical Reactions

Section: Chapter Questions

Problem 1PS: Write balanced chemical equations for the following reactions. (a) The reaction of aluminum and...

See similar textbooks

Related questions

Q: II. Write a balanced chemical equation and give the type of chemical reaction involved in each of…

A: A balanced chemical reaction is the one in which the moles of each atom present in the reaction are…

Q: Balance the following equation by filling the gaps with appropriate numbers. Ca + HCI CaCl2 H2

Q: Write a balanced chemical equation based on the following description: a. solid chromium reacts…

A: Answer: Balancing of a chemical equation is based on the principle of conservation of mass which…

Q: Write a balanced chemical equation based on the following description: solid potassium oxide reacts…

A: Given,

Q: Write a balanced chemical equation based on the following description: aqueous potassium phosphate…

A: The balanced chemical reaction is as follows:

Q: One way the U.S. Environmental Protection Agency (EPA) tests for chloride contaminants in water is…

Q: Write a balanced chemical equation based on the following description: Gaseous C5 H4 reacts with…

A: Combustion :- The process of burning a compound in excess of air or oxygen is known as combustion…

Q: The nitrogen content of an impure laboratory reagent labelled (NH4)2Ce(NO3)6 was analyzed by…

A: 'Since you have posted multiple questions. We will solve only first one as per our guideline. If you…

Q: If you blow carbon dioxide gas into a solution of calcium hydroxide, a milky-white precipitate of…

A: When we blow carbon dioxide gas into a solution of calcium hydroxide, a milky-white precipitate of…

Q: Write a balanced chemical equation based on the following description:aqueous potassium phosphate…

Q: Write a balanced chemical equation based on the following description: the reaction of gaseous C₅H₄…

A: The reactants given are 1) gaseous C5H4 i.e C5H4 (g) 2) Oxygen gas i.e O2 (g) And the products…

Q: What acid and what base would react in aqueous solution so that the following salts appear as…

Q: A sample of 0.3220 g of an ionic compound containing the bromide ion (Br−) is dissolved in water and…

A: Calculate the number of moles of AgBr formed. Number of moles = Given massMolar massNumber of moles…

Q: Suppose an EPA chemist tests a 250.mL sample of groundwater known to be contaminated with…

A: The 12mM silver nitrate added here will react until all of the contaminated iron(III) chloride is…

Q: Iron forms a sulfide with the approximate formula Fe,Se. Assume that the oxidation state of sulfur…

A: Given that, An iron sulfide compound with molecular formula = Fe7S8 oxidation state of sulfur = -2…

Q: Write a balanced chemical equation based on the following description: solid cesium reacts with…

A: 6Cs (s) + 2 CsNO (s) -------> 4Cs2O (aq) + N2(g)

Q: 4. Solid barium reacts with cold water to produce aqueous barium hydroxide and hydrogen gas. Write a…

A: Ba(s) + 2H2O(l) --> Ba(OH)2 (aq) + H2(g)

Q: Write a balanced equation describing each of the following chemical reactions. a. Solid aluminum…

A: In a chemical reaction, the reactants combine together to form products.

Q: Aluminum and iodine are both ground into a fine powder and combined in a heatproof dish where a…

A: Aluminum + iodine gives Al2I6 Al + I2 --> Al2I6 In next step we will balance this reaction.

Q: Write the balance equation for the following reactions Give reasons for the following reactions?i.…

A: i. Hydrogen + Chlorine = Hydrogen chloride The balanced equation of the above reaction is, In the…

Q: 6)a. Potassium permanganate c. Calcium carbonate e. Ferric carbonate g. Sodium sulfite i. Iron (II)…

A: Potassium permanent = KMnO4 Calcium Carbonate = CaCO3 Ferric Carbonate = FeCO3 Sodium sulfite =…

Q: The compound sodium thiosulfate pentahydrate, Na, S, O3-5H2O, is important commercially to the…

A: The reaction taking place is given as, => S8 (s) + Na2SO3 (aq) + H2O (l) → Na2S2O3·5H2O (s)…

Q: Write a balanced equation for the combustion of gaseous methane (CH4)(CH4), a majority component of…

A: We will write a balanced equation for the combustion of gaseous methane (CH4)(CH4), a majority…

Q: Write a balanced equation for the combination reaction that takes place when iron(III) oxide is…

A: Constituent elements are exist in its natural elemental form.

Q: Write the balanced NET ionic equation for the reaction when aqueous MgS0g and aqueous Ba(NO3)2 are…

A: The reaction is: MgSO4(aq) + Ba(NO3)2(aq) → Mg(NO3)2(aq) + BaSO4(s) Ionic reaction is: Mg2+(aq) +…

Q: 7. The major component of Gasoline is Octane (C,H,9) which is mixed with oxygen in the cylinders of…

A: when compound is burned with help of oxygen and form carbon dioxide and water and amount of energy.

Q: Write a balanced chemical equation based on the following description: solid barium carbonate…

A: A chemical reaction is symbolic representation of the conversion of substances to new substances. In…

Q: Write the balanced molecular equation that occurs when calcium carbonate reacts with hydrochloric…

Q: What are the conditions for the precipitation of sulphur from the sample solution in DETERMINATION…

A: Sulphur containing samples in presence of excess BaCl2 solution would precipitate as BaSO4. The…

Q: 6NH2OH + 2Bi2Bi(OH)3 + 3N2H4 In the above reaction, what is the oxidation state change of…

A: The oxidation state (OS) of an element corresponds to the number of electrons, e-, that an atom…

Q: Write a balanced chemical equation based on the following description: solid C,H100 is burned with…

A: In a chemical reaction; the substance which involves in conversion is said to be reactant whereas…

Q: mass of oxygen gas

Q: Write a balanced chemical equation based on the following description: the reaction of aluminum…

A: The reaction of aluminum metal with aqueous sulfuric acid to form aqueous aluminum sulfate and…

Q: Write balanced chemical equations corresponding to each ofthe following descriptions: (a) Solid…

A: Balanced reaction for the following: (A) CaC2 (s) + 2H20(l) → Ca(OH)2(aq) + C2H2(g) (B) 2KCIO3 (s) →…

Q: 5.3 What is the net ionic equation for the reaction of aqueous lead (II) nitrate with aqueous sodium…

A: Reaction of aqueous lead (II) nitrate with aqueous sodium bromide:When the two salts are mixed…

Q: Write a balanced chemical equation based on the following description: solid lead(IV) chlorite…

A: The reaction given is Pb(ClO2)4 (s) ------> PbCl4 (s) + O2 (g) Since there are 8 O in LHS. Hence…

Q: Solid lead (II) sulfide reacts with aqueous hydrobromic acid to form solid lead(II) bromide and…

A: Balance chemical equation is defined as which has equal number of atoms or ions in both sides…

Q: When Cu(oH)2 is heated,copper (II)oxide and water are formed what is the balanced equation for the…

A: Copper oxide and water are formed when solid copper hydroxide is heated.

Q: Write a balanced chemical equation for the following reactions and classify reactions. i. Liquid…

A: Here, we have to write the balanced chemical equations and have to classify the reactions: i. when…

Q: balanced chemical

Q: Write a balanced chemical equation for this reaction aqueous sodium hydroxide and hydrogen gas are…

A: Balanced chemical equation means in which equal number of atoms are present on both the reactants…

Q: Write a balanced chemical equation based on the following description: solid cesium reacts with…

A: According to the Law of conservation of mass " all atoms of different elements must be equal on both…

Q: One way the U.S. Environmental Protection Agency (EPA) tests for chloride contaminants in water is…

A: Given balance equation shown in below

Q: Write the balanced chemical equation for each reaction. a. Solid lead(II) sulfide reacts with…

Q: Write the balanced chemical equations representing the following reactions: Propane gas reacts with…

A: Balanced Chemical Equations:- An equation is balanced when the same number of each element is…

Q: balance this chemical reaction ____ NaHCO3 + ____ C6H8O7 → ____ Na3C6H5O7…

Q: Write the balanced chemical equation based on the following aqueous potassium phosphate reacts…

A: Write the balanced chemical equation based on the following ---

Q: Determine the products, state the type of reaction, write a balanced chemical equation, including…

A: Need to complete the following reaction. A) aqueous ammonium sulfide reacts with aqueous iron (II)…

Q: Write balanced chemical equations for the following reactions. The decomposition of solid ammonium…

A: Balanced Reaction for decomposition of ammonium nitrate : NH4NO3(s) ------> N2O(g) + 2H2O(g)

Q: A chemist needs to produce 100 grams of gallium chloride, when gallium reacts with hydrochloric acid…

Question

Please write clearly the answer, as well as the type of compound it is. Such as gas, solid, etc

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

According to the Resource Conservation and Recovery Act (RCRA), waste material is classified as toxic and must be handled as hazardous if the lead concentration exceeds 5 mg/L. By adding chloride ion, the lead ion will precipitate as PbCl2, which can be separated from the liquid portion. Once the lead has been removed, the rest of the waste can be sent to a conventional waste treatment facility. How many grams of sodium chloride must be added to 500 L of a waste solution to reduce the concentration of the Pb2+ ion from 10 to 5 mg/L?
Chlorine gas was first prepared in 1774 by C. W. Scheele by oxidizing sodium chloride with manganese(IV) oxide. The reaction is NaCl(aq)+H2SO4(aq)+MnO2(s)Na2SO4(aq)+MnCl2(aq)+H2O(l)+Cl2(g) Balance this equation.
Cobalt metal can be prepared by reducing cobalt (II) oxide with carbon monoxide. CoO(s)+CO(g)Co(s)+CO2(g)Kc=4.90102 at 550 C
The metals industry was a major source of air pollution years ago. One common process involved roasting metal sulfides in the air 2 PbS(s) + 3 O2(g) 2 PbO(s) + 2 SO2(g) If 2.50 mol of PbS is heated in air, what amount of O2 is required for complete reaction? What amounts of PbO and SO2 are expected?
What is G for the following reaction? 2Br(aq)+Cl2(g)Br2(l)+2Cl(aq) Use data given in Table 19.1.
A student set up an experiment for six different trials of the reaction between 1.00-M aqueous acetic acid, CH3COOH, and solid sodium hydrogen carbonate, NaHCO3. CH3COOH(aq) + NaHCO3(s) NaCH3CO2(aq) + CO2(g) + H2O() The volume of acetic acid was kept constant, but the mass of sodium bicarbonate increased with each trial. The results of the tests are shown in the figure. (a) In which trial(s) is the acetic acid the limiting reactant? (b) In which trial(s) is sodium bicarbonate the limiting reactant? (c) Explain your reasoning in parts (a) and (b).
One of the few industrial-scale processes that produce organic compounds electrochemically is used by the Monsanto Company to produce1,4-dicyanobutane. The reduction reaction is 2CH2CHCH+2H++2eNC(CH2)4CN The NC(CH2)4CN is then chemically reduced using hydrogen gas to H2N(CH2)6NH2, which is used in the production of nylon. What current must be used to produce 150.kg NC(CH2)4CN per hour?
Nickel(II) sulfide, NiS, occurs naturally as the relatively rare mineral millerite. One of its occurrences is in meteorites. To analyze a mineral sample for the quantity of NiS, the sample is dissolved in nitric add to form a solution of Ni(NO3)2. NiS(s) + 4 HNO3(aq) Ni(NO3)2(aq) + 2 NO2(g) + 2 H2O(l) + S(s) The aqueous solution of Ni(NO3)2 is then reacted with the organic compound dimethylglyoxime (C4H8N2O2) to give the red solid Ni((C4H7N2O2)2. Ni(NO3)2(aq) + 2 (C4H8N2O2)(aq) Ni(C4H7N2O2)2 + 2 HNO3(aq) Suppose a 0.468-g sample containing millerite produces 0.206 g of red, solid Ni(C4H7N2O2)2 What is the mass percent of NiS in the sample?
Write balanced chemical equations for the following reactions. (a) The reaction of aluminum and iron(III) oxide to form iron and aluminum oxide (known as the thermite reaction). (b) The reaction of carbon and water at high temperature to form a mixture of gaseous CO and H2 (known as water gas and once used as a fuel). (c) The reaction of liquid silicon tetrachloride and magnesium forming silicon and magnesium chloride. This is one step in the preparation of ultrapure silicon used in the semiconductor industry
4.65 Using the web, find out how lead “poisons” the catalyst in a catalytic converter.
Consider the equation G = -nF. What are the four terms in this equation? Why does a minus sign appear in the equation? What does the superscript o indicate?
Using Lewis structures, write balanced equations for the following reactions: (a) HCI(g)+PH3(g) (b) H3O++CH3 (c) CaO+SO3 (d) NH4++C2H5O