Write a balanced equation for the double-replacement precipitation reaction described, using the smallest possible integer coefficients. A precipitate forms when aqueous solutions of zinc iodide and potassium hydroxide are combined.

Write a balanced equation for the double-replacement precipitation reaction described, using the smallest possible integer coefficients. A precipitate forms when aqueous solutions of zinc iodide and potassium hydroxide are combined.

World of Chemistry

7th Edition

ISBN:9780618562763

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter7: Chemical Reactions: An Introduction

Section: Chapter Questions

Problem 48A

See similar textbooks

Related questions

Q: A precipitation reaction occurs when

Q: precipitation reaction involves the formation of a precipitate when aqueous solutions are mixed. Not…

A: Balance Chemical equation means no of atoms or ions should be equaal in both side reactant and…

Q: Write a balanced equation for the double-replacement neutralization reaction described, using the…

A: Given that : We have to write a balanced equation for the double-replacement neutralization reaction…

Q: Which of the following are examples of soluble compounds? Hydroxides Chromates Sulfides Nitrates

A: The compounds given are hydroxides, chromates, sulfides and nitrates.

Q: Briefly explain the following terms. (a) Precipitation reaction (b) Combustion reaction (c)…

Q: Does a reaction occur when aqueous solutions of copper(II) chloride and lead(II) nitrate are…

A: We have to tell whether reaction occurs or not

Q: What are the solubility rules? How are they useful?

A: There is no easy way to tell whether a particular compound is soluble or insoluble just by looking…

Q: The neutralization of hydrochloric acid with aqueous sodium hydroxide is an exothermic reaction.…

A: Acid + base gives a salt and water , These Reaction also called as neutralisation reactions. HCl…

Q: How can predicting a precipitation reaction be useful?

A: 1. Precipitation reactions are useful in determining whether a certain element is present in a…

Q: Include states of matter in your equation. A) Complete and balance the molecular equation for the…

A: The reactants given are aqueous solutions of, 1) Strontium hydroxide i.e Sr(OH)2 (aq) 2) Lithium…

Q: Write the net ionic equation that describes the reaction that occurs when a solution of barium…

A: In the net ionic reaction, the common ions in the left and the right side of the arrow gets…

Q: A reaction between a solution of sodium carbonate is mixed with a solution of calcium nitrate to…

A: Volume of Na2CO3 = 492.1 ml Molarity of Na2CO3= 0.674 mole/L Volume of Ca(NO3)2 = 551.4 ml Molarity…

Q: A group of Physics students have come to your chemistry class and asked for assistance creating a…

A: Precipitate is the insoluble substance formed after the reaction.

Q: Using the general solubility rules, predict the following substances as soluble or insoluble in…

A: According to solubility rules, Bicarbonates, carbonates and sulfites of Transition metals are…

Q: Lead(II) ions can be removed from solution by precipitation with sulfate ions. Suppose that a…

Q: Write an equation for the precipitation reaction that occurs (if any) when solutions of sodium…

A: In this question, an equation for the reaction that occurs has to be written when solutions of…

Q: Write a balanced equation for the double-replacement precipitation reaction described, using the…

A: Since, We know that, Balanced equation means number of atom in reactant side is equal to number of…

Q: The fact that a reaction takes place when potassium hydroxide is added to a solution of nickel(II)…

A: When potassium hydroxide is added to a solution of nickel(II) ions, the nickel hydroxide is…

Q: The compound calcium nitrate is a strong electrolyte. Write the reaction when solid calcium nitrate…

Q: One way the U.S. Environmental Protection Agency (EPA) tests for chloride contaminants in water is…

A: Given data,Volume of sample=250mL=0.250LMolarity of AgNO3=46mMMass of AgCl=4.4mg=0.0044g

Q: Write the net ionic equation for the precipitation reaction, if any, that may occur when aqueous…

A: Strontium hydroxide and Lithium phosphate will dissociate as follows in aqueous…

Q: Write a balanced equation for the double-replacement precipitation reaction described, using the…

A: A precipitate calcium sulphate forms when aqueous solutions of calcium bromide and potassium…

Q: Consider the chemical reaction that takes place between solid magnesium and aqueous hydrochloric…

Q: Write a balanced equation for the double-replacement precipitation reaction described, using the…

A: In a double replacement precipitation reaction the cation and anion of both the reactants are…

Q: Write a balanced equation for the double-replacement precipitation reaction described, using the…

A: Balanced reaction means, number of atom in reactant side is equal to number of atom in product…

Q: Write a balanced chemical equation based on the following description: solid barium carbonate…

A: A chemical reaction is symbolic representation of the conversion of substances to new substances. In…

Q: Write an equation for the precipitation reaction that occurs (if any) when solutions of sodium…

A: In this question, a chemical equation for the reaction occurring when solutions of sodium carbonate…

Q: Based on general solubility rules, predict the identity of the precipitate that forms when aqueous…

A: We have to tell which precipitate is formed during reaction of sodium bromate and mercury (I)…

Q: When aqueous solutions of nickel(II) bromide and sodium carbonate are combined, solid nickel(II)…

A: Net ionic equation is given as follows

Q: Write the formula equation from the word equation. Include physical states. Solutions of barium…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: A precipitation forms when solutions of lead (II) nitrate and potassium iodide are mixed. Write the…

A: The compound of the nitrate is completely dissolved in the aqueous solution while the compound of…

Q: Precipitation is an example of what type of reaction? a. single replacement b. double replacement…

A: Precipitation reaction: precipitation reaction is the formation of an insoluble salt when two…

Q: Six aqueous solutions were used in a series of solubility experiments. Each solution was mixed with…

A: In precipitation reaction an insoluble salt formed when two solutions containing soluble salts are…

Q: What do you mean by a precipitation reaction? Explain by giving examples.

A: Precipitation is displacement reaction which can be single or double. Actually precipitation…

Q: Complete and balance the molecular equation for the reaction between aqueous solutions of strontium…

A: In precipitation, a solid water insoluble product is formed.

Q: What is difference between displacement and double displacement reactions? Write equations for these…

A: The exchange reactions are the reactions that involve both synthesis as well as decomposition. Two…

Q: Write a balanced equation for the following reaction. Solid silver sulfate decomposes with heat to…

A: In Balanced chemical equation each species have equal atoms on reactent and products side.

Q: A mixture of MgCl, and inert material is analyzed to determine the Mg content. First the mixture is…

A: The given reaction is a precipitation reaction in which the precipitate formed is AgCl. Steps…

Q: Write an equation for the precipitation reaction (if any) that occurs when solutions of lead(II)…

A: A reaction is called precipitation reaction when two solution containing soluble salt are combined…

Q: Write a balanced chemical equation for this reaction aqueous sodium hydroxide and hydrogen gas are…

A: Balanced chemical equation means in which equal number of atoms are present on both the reactants…

Q: Describe the Precipitation Reactions?

A: Definition of Precipitation Reactions has to be given,

Q: When a solution of Cu(II) chloride is added to a solution of potassium sulfide yielding Copper(II)…

A: Those reactions in which mixing of two aqueous solutions lead to the formation of insoluble salt as…

Q: A precipitation reaction involves the formation of a precipitate when aqueous solutions are mixed.…

A: When the reaction occurs and there is formation of solid which is called as precipitate. All the…

Q: What are precipitation reactions?

A: The formation of new compounds is the result of chemical changes observed during the interaction of…

Q: Barium sulfate is formed from reacting barium hydroxide and sulfuric acid. Indicate the ion/s that…

A: A question based on ionic equation, which is to be accomplished.

Q: When the following aqueous solutions are mixed together, will a precipitate form? Sodium chloride…

A: 1) The reactants given are NaCl (aq) and KNO3 (aq) Hence the possible double displacement reaction…

Q: Write a balanced equation for the reaction described, using the smallest possible integer…

A: Silver (I) Nitrate + Barium Bromide ----->Silver(I) bromide + Barium Nitrate 2AgNO3 +…

Q: Write a balanced equation for the double-replacement precipitation reaction described, using the…

A: The equation of chemical reaction, which have a same number of atoms for each elements and total…

Q: Write the net ionic equation for any precipitation reaction that may be predicted when aqueous…

A: Sodium nitrate is water soluble and it is present in form of sodium ion and nitrate ion in the…

Q: Write the formulas for the given reactants, predict the products, and balance the entire…

Concept explainers

States of Matter

The substance that constitutes everything in the universe is known as matter. Matter comprises atoms which in turn are composed of electrons, protons, and neutrons. Different atoms combine together to give rise to molecules that act as a foundation for all kinds of substances. There are five states of matter based on their energies of attraction, namely solid, liquid, gases, plasma, and BEC (Bose-Einstein condensates).

Chemical Reactions and Equations

When a chemical species is transformed into another chemical species it is said to have undergone a chemical reaction. It consists of breaking existing bonds and forming new bonds by changing the position of electrons. These reactions are best explained using a chemical equation.

Question

Write a balanced equation for the double-replacement precipitation reaction described, using the smallest possible integer coefficients.
A precipitate forms when aqueous solutions of zinc iodide and potassium hydroxide are combined.
Be sure to include states such as (s) or (ag).
+
Submit Answer
Try Another Version
1 item attempt remaining
Visited

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1 Objective

VIEW

Step 2 Balanced Equation

VIEW

Step 3 Conclusion

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The element tin often occurs in nature as the oxide, SnO2 . To produce pure tin metal from this sort of tin ore, the ore usually is heated with coal (carbon). This produces pure molten tin, with the carbon being removed from the reaction system as the gaseous byproduct carbon monoxide. Write the unbalanced equation for this process.
When hydrogen sulfide, H2S , gas is bubbled through a solution of lead(II) nitrate, Pb( NO3)2 , a black precipitate of lead(II) sulfide, PbS. forms, and nitric acid, HNO3 , is produced. Write the unbalanced chemical equation for this reaction.
A common demonstration in chemistry courses involves adding a tiny speck of manganese(IV) oxide to a concentrated hydrogen peroxide, H2O2 , solution. Hydrogen peroxide is unstable, and it decomposes quite spectacularly under these conditions to produce oxygen gas and steam (water vapor). Manganese(IV) oxide is a catalyst for the decomposition of hydrogen peroxide and is not consumed in the reaction. Write the balanced equation for the decomposition reaction of hydrogen peroxide.
When lead(II) sulfide is heated lo high temperatures in a stream of pure oxygen gas, solid lead(II) oxide forms with the release of gaseous sulfur dioxide. Write the unbalanced chemical equation for this reaction.
The flasks below illustrated three trials of a reaction between varying amounts of zinc and a constant volume of hydrochloric acid solution of constant concentration. The table gives the initial amount of zinc added and the observation at the conclusion of each reaction. Mass of Zinc Added g Observation at Conclusion of Reaction 6.10 Balloon inflated completely Some unreacted zinc remains 2.37 Balloon inflated completely No zinc remains 0.41 Balloon not inflated completely No zinc remains The reaction produces an aqueous solution of zinc chloride and hydrogen gas. Explain the observed results.
When copper (II) oxide is boiled in an aqueous solution of sulfuric acid, a strikingly blue solution of copper (II) sulfate forms along with additional water. Write the unbalanced chemical equation for this reaction.
On Easter Sunday, April 3, 1983, nitric acid spilled from a tank car near downtown Denver, Colorado. The spill was neutralized with sodium carbonate: 2HNO3(aq)+Na2CO3(aq)2NaNO3(aq)+H2O(l)+CO2(g) a. Calculate H for this reaction. Approximately 2.0 104 gal nitric acid was spilled. Assume that the acid was an aqueous solution containing 70.0% HNO3 by mass with a density of 1.42 glcm3. What mass of sodium carbonate was required for complete neutralization of the spill, and what quantity of heat was evolved? (Hf for NaNO3(aq) = 467 kJ/mol) b. According to The Denver Post for April 4, 1983, authorities feared that dangerous air pollution might occur during the neutralization. Considering the magnitude of H, what was their major concern?
Using the general solubility rules given in Table 7.1, which of the following ions will form a precipitate with SO42? msp;Ba2+ msp;Na+ msp;NH4+ least two of the above ions will form a precipitate with SO42. l of the above ions will form a precipitate with SO42.
Using the general solubility rules discussed in Chapter 7, give the formulas of live substances that would be expected to be readily soluble in water and five substances that would be expected to not be very soluble in water. For each of the substances you choose, indicate the specific solubility rule you applied to make your prediction.
The element carbon undergoes many inorganic reactions, as well as being the basis for the field of organic chemistry. Write balanced chemical equations for the reactions of carbon described below. l type='a'> Carbon burns in an excess of oxygen (for example. in the air) to produce carbon dioxide. If the supply of oxygen is limited, carbon will still burn but will produce carbon monoxide rather than carbon dioxide. molten lithium metal is treated with carbon, lithium car bide, Li2C2 , is produced. i>Iron(II) oxide reacts with carbon above temperatures of about 700 °C to produce carbon monoxide gas and molten elemental iron. i>Carbon reacts with fluorine gas at high temperatures to make carbon tetrafluoride.
Classify the reactions represented by the following unbalanced equations by as many methods as possible. Balance the equations. msp;I4O9(s)I2O6(s)+I2(s)+O2(g) msp;Mg(s)+AgNO3(aq)Mg(NO3)2(aq)+Ag(s) msp;SiCl4(l)+Mg(s)MgCl2(s)+Si(s) msp;CuCl2(aq)+AgNO3(aq)Cu(NO3)2(aq)+AgCl(s) msp;Al(s)+Br2(l)AlBr3(s)
The Solvay process is multistep industrial method for the manufacture of sodium carbonate, Na2CO3, which is also known as washing soda. Although most of the industrialized world utilizes the Solvay process for production of sodium carbonate, it is not manufactured in the United States because it can be obtained at lower cost from a large natural deposit in Wyoming. Questions 19 through 22 are based on reactions in that process. Sodium carbonate is used for many purposes, including glass manufacturing. How much NaCl is needed to react completely with 83.0g of ammonium hydrogen carbonate in NaCl+NH4HCO3NaHCO3+NH4Cl?