Answered: The equilibrium constant for a chemical…

The equilibrium constant for a chemical reaction is Kc = 902 at 25°C. What is the standard free energy change, ∆G⁰ for this reaction?

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 16P

See similar textbooks

Related questions

Q: Why is the standard entropy of a substance in the gas state greater than its standard entropy in the…

A: The intermolecular force between gas molecules is less than the intermolecular force between liquid…

Q: 1. a) Why is chemical potential analogous to temperature and pressure? b) Under what circumstance…

A: a. The chemical potential is the measure of free energy is changed in the process. Since the free…

Q: The concentration of glucose inside a cell is 0.13 mM. Outside the cell the concentration of glucose…

A: Given that : Concentration of glucose inside the cell (Ci)= 0.13 mM Concentration of glucose outside…

Q: At temperature T0, substance X in its A form (A can be liquid, solid or vapor) has same chemical…

Q: The molar entropies of carbon monoxide and carbon dioxide at 25°C are 197.7 and 213.8 J/molK,…

A: The molar entropy in terms of micro-state is given as :

Q: a reaction has the following thermodynamic value of delta h =288 kj/mol and delta s =98.J/K MOL at…

Q: Which substance would have the greatest standard molar entropy? O N2(g) NO2(g) O N2(1) O NO2(1)

A: Entropy (S): entropy dependence on randomness of a system . For example randomness order…

Q: 14. At what temperatures will a reaction be spontaneous if ΔrH° = +62.4 kJ and ΔrS° = +301 J/K?

A: For, the reaction to be spontaneous, the free energy is negative. The standard thermodynamic data at…

Q: Calculate the standard free energy for the combustion of 1 mole of ethylene, C₂H₄(g), in the gas…

A: The reaction for the combustion of ethylene in gas phase – C2H4g +3O2 g →2CO2g +2H2Og

Q: Given ΔHrxn∘= −135 kJ, ΔS∘rxn= −263 J/K, & T= 299 K, will the reaction be spontaneous?

A: Given: ΔHrxn∘= −135 kJ ΔS∘rxn= −263 J/K T= 299 K To find: Whether the reaction is spontaneous

Q: 9. A chemical reaction under standard state has the enthalpy of reaction: A,H° = +117 kJ and the…

A: B) The reaction is entropy driven.

Q: A process increases the entropy of the system by 128 J/mol K and absorbs 54 kJ/mol of heat from the…

A: Given: Change in entropy (∆S) = 128 J/mol•K Absorbed heat=54 kJ/mol =54×103 J/mol To determine…

Q: What is "Gibb's Free Energy"? How is it related to the Enthalpy and Entropy of a system at…

A: we denote gibb's free energy by G and the change in gibb's free energy is denoted by ΔG

Q: Which substance would have the smallest standard molar entropy? NO2(g) N2(1) N2(g) NO2(1)

A: Entropy is determined by checking the state of phase . In which state material is available .

Q: Reaction: 2 ICI (g) 17.78 Cb (g). AH (kJ/mole) S° 247.551 116.135 223.066 (J/mole K) A. 0.0123 B.…

Q: 8. Predict the sign of the change in entropy for the condensation of steam to liquid water. 9.…

A: Entropy means randomness. The higher the randomness of the system, the higher will be its entropy.…

Q: List the ways in which we can interpret entropy at the molecular level?

A: The ways in which we can interpret entropy at the molecular level has to be given,

Q: Consider the following reaction at 25 °C: 3 NiO(s) + 2 NH₃(g) → 3 Ni(s) + N₂(g) + 3 H₂O(g) a.Given…

Q: The equilibrium constant of a reaction conforms to the following equation in the temperature range…

A: The equilibrium constant(K) is defined as the ratios of concentration of product to the…

Q: Calculate the entropy of vaporization of water at 25 °c from thermodynamic data and its enthalpy of…

A: First calculate the entropy change of the given process at 25oC Given, The temperature of the system…

Q: Choose the compound with the smallest standard molar entropy, S° (298.15 K). A) H2O (l) B) H2O (g)…

A: Entropy is the measure of disorder of molecules in a system. More the randomness, more will be the…

Q: For a certain chemical reaction, the equilibrium constant K=1.6X 10^6 at 20.0°C. Calculate the…

Q: Calculate the standard free-energy change at 25°C for the Haber synthesis of ammonia using the given…

A: Standard free energy change is calculated using formula ∆G° = ∆H° - T∆S° Reaction is spontenous…

Q: What is the precise definition of entropy? What is the significance of entropy being a state…

A: Entropy is a thermodynamic state function that determines randomness in a system. When we raise…

Q: Calculate the boiling point of carbon tetrachloride if the standard entropy and enthalpy of…

Q: What is the value of the equilibrium constant at 20°C for a reaction that has a standard free-…

A: The relationship between the ΔG0 and equilibrium constant is given by RTln(K) = nFE0cell = -ΔG0…

Q: Create a system that shows the third law of thermodynamics and how it relates to the concept of…

Q: Which of the following processes are spontaneous and which are nonspontaneous:formation of CH4 and…

Q: What is the change in entropy in a large mass of water at 50 °C when it receives 155 kJ of energy in…

A: Answer is explained below. Given that, the change is reversible and the mass of water is large…

Q: What is the increase in entropy of 1.00 kg of ice originally at 0 oC that is melted to form water a…

A: Change in entropy is given by: ∆S=∆qT∆S=m×LfT

Q: When the temperature is increased by 1K, which form is thermodynamically more stable?

A: Entropy is defined as the degree of randomness present in the molecules of any substance. It is a…

Q: What conditions are necessary for the free-energy change to be used to predict the spontaneity of a…

A: The conditions are necessary for the free-energy change to be used to predict the spontaneity of a…

Q: Which one of the following choices shows the gaseous molecules ranked from lowest (on the left) to…

A: Given options: 1. Ar, Kr, He, Ne 2. Kr, Ar, Ne, He 3. He, Ne, Ar, Kr 4. He, Ne, Kr, Ar

Q: Which of these species has the highest entropy (S) at 25°C?

A: Entropy is defined as a degree of randomness, and the entropy for a gaseous compound is greater than…

Q: Why is it important in using change in free energy, ΔG, as the thermodynamic parameter for assessing…

A: Thermodynamics is branch of chemistry which deals with heat gained and heat lost by system.

Q: What is the entropy when a system goes from 4 microstates to 5 microstates? 3.08 x 10-24 O -3.08 x…

Q: System 1 has 5 energetically equivalent orientations. System 2 has 15 energetically equivalent…

A: Given: Energetically equivalent orientations of System 1 = 5 Energetically equivalent orientations…

Q: In glycolysis, glucose is broken down to yield energy. If the equilibrium constant of the…

A: Here, we have to calculate free energy change and concentration of reactant and product at…

Q: In each of the following pairs, which compound would you expect to have the higher standard molar…

A: Given pair, CO2(g) and CO(g)

Q: Define the term entropy in thermodynamics. (ii) In what way entropy is related to third law of…

A: ANSWER

Q: Calculate the standard entropy of formation of liquid ethanol at 25°C. [S°(Cgraphite) =…

A: If the standard entropies of formation of each substance are known, then the standard entropy change…

Q: For a certain chemical reaction, the equilibrium constant K = ×8.410−4 at 15.0 °C .…

A: Given : K = 8.4 x 10-4

Q: Recognize the species that has the lowest entropy, S° at 25°C. А. СНЗОН (1) B. N2 (g) C. NazSO4 (s)…

A: Entropy is defined as the measurement of disorderedness or randomness in a system. The increasing…

Q: Consider a process in which the entropy of a system increases by 125 J K−1 and the entropy of the…

A: Entropy change of the universe is the summation of entropy change of the system and entropy change…

Q: Which expression below could be used to calculate the free energy change for a chemical reaction at…

Q: Arrange HCl(l), NaF(s), and SiF4(g) in the order of decreasing standard molar entropy at 25°C.

A: Arrange HCl(l), NaF(s), and SiF4(g) in the order of decreasing standard molar entropy at 25°C.

Q: For a certain chemical reaction, the equilibrium constant K = ×7.7106 at 5.00 °C .…

Q: In each of the following pairs, which compound wouldyou expect to have the higher standard molar…

A: Entropy: It is the measure of disorder or randomness that is occurring in the system. Standard molar…

Q: Consider the reaction N2(g) + 2H20(1)–2NO(g) + 2H2(g) for which AH° = 752.2 kJ and AS° = 351.6 J/K…

Question

The equilibrium constant for a chemical reaction is Kc = 902 at 25°C. What is the standard free energy change, ∆G⁰ for this reaction?

Definition Definition Transformation of a chemical species into another chemical species. A chemical reaction consists of breaking existing bonds and forming new ones by changing the position of electrons. These reactions are best explained using a chemical equation.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Determine the standard Gibbs free energy change, rG, for the reactions of liquid methanol, of CO(g), and ofethyne, C2H2(g), with oxygen gas to form gaseous carbondioxide and (if hydrogen is present) liquid water at298 K. Use your calculations to decide which of thesesubstances are kinetically stable and which are thermodynamically stable: CH3OH(), CO(g), C2H9(g), CO2(g),H2O().
a Calculate K1, at 25C for sulfurous acid: H2SO3(aq)H+(aq)+HSO3(aq) b Which thermodynamic factor is the most significant in accounting for the fact that sulfurous acid is a weak acid? Why?
Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is sulfur trioxide an important substance to study? (Hint: What happens when it combines with water?)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the synthesis of ammonia? 3H2(g) + N2(g) 2NH3(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?
The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
Solid NH4NO3 is placed in a beaker containing water at 25 C. When the solid has completely dissolved, the temperature of the solution is 23.5 C. (a) Was the process exothermic or endothermic? (b) Was the process spontaneous? (c) Did the entropy of the system increase? (d) Did the entropy of the universe increase?
Describe how the standard entropy of hydrogen gas at 25C can be obtained from heat measurements.
For each of the following processes, identify the systemand the surroundings. Identify those processes that arespontaneous. For each spontaneous process, identify theconstraint that has been removed to enable the process to occur: Ammonium nitrate dissolves in water. Hydrogen and oxygen explode in a closed bomb. A rubber band is rapidly extended by a hangingweight. The gas in a chamber is slowly compressed by aweighted piston. A glass shatters on the floor.
Determine the entropy change for the combustion of liquid ethanol, C2H5OH, under the standard conditions to give gaseous carbon dioxide and liquid water.
For ammonia (NH3), the enthalpy of fusion is 5.65 kJ/mol and the entropy of fusion is 28.9 J/K mol. a. Will NH3(s) spontaneously melt at 200. K? b. What is the approximate melting point of ammonia?