Write down the products of the reactions below. 9.55 다음 일련의 반응들의 생성물을 나타내어라. 서로 다른 작용기 사이를 '네비게이트'할 수 있도록어떻게 반응이 조합되는지를 알아보기 위해 로드맵을 참고하여라.1. Brg le light2.1HBr in the presence of1(a)light and peroxideNaOEt(b)3. Bry/H2O2. NaCN알게인>equivalent알켄1. Br2 12 light2. KOUBUequivalentNANH,(c)(d)2.-Br3. Og4. (CH,),S알카인3. H2 / Lindlar4. НС!알게인5. NaNg

Answered: Image /qna-images/answer/ae49b3ee-0475-400b-84fd-a8981adc37f2.jpg

생생활나타내어라. 서로 다른 작용기 사이를 '네비게이트 할 수 있도록 어떻게 반응이 조합되는지를 알아보기 위해 로드맵을 참고하여라. 1. Brg le light 2.1 HBr in the presence of light and peroxide (a) NaOEt (b) 3. Bry/H,O >equivalent 2. NaCN 알케인 알켄 1. Brg 1ea light 2. KOUBU equivalent NANH, 1.1 (c) Br (d) 2. 3. Og 4. (CH,),S 3. H2 / Lindlar 4. HCI 5. NaNg 알카인 알게인

생생활나타내어라. 서로 다른 작용기 사이를 '네비게이트 할 수 있도록 어떻게 반응이 조합되는지를 알아보기 위해 로드맵을 참고하여라. 1. Brg le light 2.1 HBr in the presence of light and peroxide (a) NaOEt (b) 3. Bry/H,O >equivalent 2. NaCN 알케인 알켄 1. Brg 1ea light 2. KOUBU equivalent NANH, 1.1 (c) Br (d) 2. 3. Og 4. (CH,),S 3. H2 / Lindlar 4. HCI 5. NaNg 알카인 알게인

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

how do I round 0.004198 to 3 sig figs
2N2O5-------> ?(A) 4NO2{g) + O2 (g)(B) 2NO2 + O6(C) N2O6 + O4
Describe why this reaction is significant: H3AsO4 (aq) + 4Zn (s) + 8H+ (aq)-> AsH3 (g) + 4Zn 2+ (aq) + 4H2O (l)
jlp.9
C6H12O6(s)→C3H6O3(s)+C2H5OH(l)+CO2(g) Calculate ΔH∘rxn
EXPLAIN ME LIKE I M 5. PLEASE IN DETAIL WITH HANDWRITTEN
Describe in details the twelve-basic principle of Green Chemistry.
What is the electron configuration of Lead? A) [Xe] 6s26f146d106p2 B) [Rn] 6s24f145d106p2 C) [Xe] 6s24f145d106p2 D) [Xe] 6s25d106p2
Can you please help with this problem, please do it on paper, showing work so I can see it clearly and understand it. Thank you so much.
UF6(g): -2113 kJ/mol UO2 (s): -1084 kJ/mol
Evaluate the quotient. 2.67 X 10^3 divided by 7.09 X 10^-7
HOCI HF HCN H₂SO4 HOBr 2.29 x 10-8 O 2.30 K₂= 3.510-8 O 1.17 x 108 O 1.45 x 10-7 K₂ = 7.2 10-4 K₂ = 4.010-10 K₁ = very large K₂ = 1.2 10-2 Ka = 2.5210-⁹ (COOH)2 CH3COOH C6H5NH2 NH3 K₁ = 5.9 x 10-² K₂ = 6.4 x 10-5 K₂ = 1.8 x 10-5 Refer to Equilibrium Constants. What is the [H3O+] of a solution that is 0.0100 M in HOCland 0.0300 M in NaOCI? Kb = 4.2 x 10-10 Kb = 1.8 x 10-5