1- Explain the bonding nature of [Fe(CN)5(NO)]-2 linear NO ligand.Vour ancwer

The given complex [Fe(CN)5(NO)]-2 is an organometallic complex where the central metal atom is iron,…

Answered: 1- Explain the bonding nature of…

Science

Chemistry

1- Explain the bonding nature of [Fe(CN)5 (NO)]-2 linear NÓ ligand.

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 53AP

See similar textbooks

Related questions

Q: Rhol(PPhs)s 9volume eICCtronsinRn in Cr which are The L-type ligands? Oxidanon State of Rn,cr…

A: The L type ligands in [RhCl(PPh3)3] is PPh3; i.e. triphenylphosphine. The L type ligand in Cr(CO)6…

Q: Is there a way to tell which ligands are strong-field and which are weak-field,

Q: What is a Chelate ligand? Give one example.

A: A ligand is a molecule or an ion that donates a pair of e- to the central metal ion or ion to result…

Q: 2. The [Co(NH3)6]²+ complex is high spin, the [Co(NH3)6]³+ complex is low spin. Which complex is…

Q: Explain the differences between weak-field and strong-field metal complexes?

A: Differences between weak-field and strong-field metal complexes:

Q: Which ligand is more likely to form a high- spin complex? а. ethylenediamine (en) b. CO С. CN d. F

A: Hello. Since your question has multiple parts, we will solve the first question for you. If you want…

Q: [Cr(H₂O)₆]²⁺ is violet. Another CrL₆ complex is green.Can ligand L be CN⁻? Can it be Cl⁻?…

A: Given: [Cr(H₂O)₆]²⁺

Q: What is the distinction between a weak-field ligand and a strong-field ligand? Give an example of…

A: The distinction between a weak-field ligand and a strong-field ligand has to be given.

Q: Which of the following ligands has the weakest field strength? Br- C2O42- NH3 NO2-

A: The spectrochemical series is a list of ligands arranged in order of their field strength. It is a…

Q: [Cr(H2O)6] 2+ is violet. Another CrL6 complex is green. Can ligand L be CN-? Can it be Cl-? Explain.

A: The octahedral splitting energy of transition elements is the difference in the energy of the…

Q: What is a chelating ligand?

A: Ligands that are having multiple donor sites to form five- to six-membered stable rings with metals…

Q: explain why heavier lanthanides form more stable complexes than lighter ones

Q: What is the distinction between a weak-field ligand and astrong-field ligand? Give an example of…

Q: How many stereoisomers of a hypothetical six-coordinate complex [M(AA);bc] (where AA is a bidentate…

A: Stereoisomers include Geometrical isomers and Optical isomers. There are two Geometrical isomers…

Q: could you please draw proposed structures for these three complexes? Ni(NCS)2(PPh3)2 NiCl2(PPh3)2…

A: Ni(NCS)2(PPh3)2 NiCl2(PPh3)2

Q: (b) Give 5 properties of metal ions that will affect the structure and bonding in coordination…

A: The answer is attached below-

Q: F3B-NH3

A: Electron deficient molecule tries to gain stability by accepting electrons from bonded or…

Q: CN- ion is a strong field ligand whereas Clis usually a weak field ligand. Draw d orbital energy…

Q: Ligands X, Y, and Z form octahedral complexes with Cu2* ion resulting to yellow, orange, and red…

A: ✓Following is the increasing order of ligand field strength Z<Y<X So the correct answer is (C)…

Q: Among the following ligands, which one can behave as ambidentate ligand? Select one: a. SCN- O b.…

A: Abmidient ligand: The ambidentate ligand has two or more donor atoms, but when a complex is formed,…

Q: When a hexadentate ligand, An-, binds to a metal ion that has a coordination number higher than 6,…

Q: Differentiate between monodentate ligands, bidentate ligands,and polydentate ligands?

A: Difference between monodentate ligands, bidentate ligands,and polydentate ligands has to be given,

Q: How we calculate the charge of ligands in this complex? [Ir(C≡C-Ph)(PMe3)4]

A: Given complex is [Ir(C≡C-Ph)(PMe3)4] We have to find the charge on ligand

Q: The CrF6^4- ion is known to have four unpaired electrons. State and explain whether the fluoride…

Q: Write the hybridization and shape of the following complexes: (i) [FeF6]3 (ii) [Ni(CO)4] (b) Out of…

A: Hybridization: It is a process in which atomic orbitals of same energy level (degenerate orbital)…

Q: Which complex undergoes the slowest ligand exchange of ligands at room temperature A) [Fe(H2O)e]**…

Q: True or false: a. Weak field ligands tend to form low spin complexes upon binding with metal…

Q: 1) Why are lanthanide complexes always weak field in nature , second and third d-transition metal…

A: Hey, since there are multiple questions posted, we will answer first question. If you want any…

Q: Represent the energy diagram of the d orbitals according to the ligand field theory and predict the…

Q: Cobalt(III) has a coordination number of 6 in all its complexes. Is the carbonate ion a monodentate…

A: In the given complex i.e. [Co(NH3)4(CO3)]+ the metal ion is cobalt and it forms a coordination…

Q: What is the coordination number of the central metal in [Co(en)3]Cl2 ? The en (NH2CH2CH2NH2)…

A: The coordination number of Co is calculated below. The coordination sphere is [Co(en)3]2+

Q: Depict and explain the Crystal field stabilization theory based on the color the below complexes.…

Q: What is the oxidation state of the metal centre in the [Cr(CO3)3(C6H6)] complex?

A: Explanation- Cr(CO3)3(C6H6)] complex is the name (η 6 -benzene ) tricarbonyl chromium(0).…

Q: Which of the following is the most stable complex? а. [Fe(CN)6]3- b. [Fe(CO)s] С. [Fe(C204)3]3- d.…

Q: For each of the following complexes: a. [Fe(Br)s]3- i. Calculate the number of d electrons. ii. Draw…

Q: colors

Q: Draw orbital-energy splitting diagrams and use the spectro-chemical series to show the orbital…

A: The spectrochemical series lists the ligands in increasing order of crystal field splitting (gap…

Q: Elucidate the bonding of the following complexes according to the valence-bond theory approach: (a)…

A: Valence bond theory is used to determine the bonding in atoms of a molecule by overlapping of their…

Q: 3. a. The [Co(H₂O)6]³+ complex is high spin. Fill the below molecular diagram with the correct…

A: [Co (H2 O) 6] 3+ is a complex. We can determine the number of d-electrons of the metal cam be…

Q: 1- Explain the bonding nature of [Fe(CN)5 (NO)]-2 linear NO ligand.

A: A question based on chemical bonding, which is to be accomplished.

Q: Given: CN^- is a stronger field ligand compared to SCN^-. Briefly explain why a complex formed…

A: CN- is strong field ligand than SCN- , When it forms complex with Iron. There will be…

Q: Part A How many unpaired electrons are in the d orbitals of an octahedral complex of Ru3+ assuming…

A: In strong field, electrons enter the eg orbitals only when t2g orbitals are completely filled.

Q: (b) Which copper complex ion is colourless? O A [CuCl] I B [CuClj²- O C [Cu(H,O),J** 2+ O D…

A: Cu+ ion has a d10 configuration and all eg orbitals are filled. There is no transition between the…

Q: Cobalt(III) has a coordination number of 6 in all its complexes. Is the carbonate ion amonodentate…

A: The general electronic configuration of cobalt is given as follows: Co- [Ar] 4s2 3d7 After the…

Q: The DOTA ligand is a cyclic octadentate ligand with four N- donors and four O-donors. * True O False

Q: (a) Construct a clearly labelled molecular orbital energy level diagram for an octahedral complex…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

1- Explain the bonding nature of [Fe(CN)5
(NO)]-2 linear NO ligand.
Vour ancwer

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Classify each ligand as monodentate, bidentate, and so on. (a) (CH3)3P (b) H2N(CH2)2NH(CH2)2NH2 (c) H2O
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
Predict whether the carbonate ligand CO32- will coordinate to a metal center as a monodentate, bidentate, or tridentate ligand.
Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.