1. Give the d orbitals electronic configurations for the following complexes in On symmetry:a. Nb(III) complexb. Mo(II) complex with Ao higher than the total electron pairing energyc. Mn(1I) complex with Ao lower than the total electron pairing energyd. Au(1) complexe. Ir(lII) complex with Ao higher than the total electron pairing energy

The formation of an octahedral complex requires six ligands.

1. Give the d orbitals electronic configurations for the following complexes in On symmetry: a. Nb(III) complex b. Mo(II) complex with Ao higher than the total electron pairing energy c. Mn(II) complex with Ao lower than the total electron pairing energy d. Au(1) complex

1. Give the d orbitals electronic configurations for the following complexes in On symmetry: a. Nb(III) complex b. Mo(II) complex with Ao higher than the total electron pairing energy c. Mn(II) complex with Ao lower than the total electron pairing energy d. Au(1) complex

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 61AP

See similar textbooks

Related questions

Q: The geometry of a lanthanide complex is determined by steric hindrance arising from the ligands. * O…

A: Answer - True According to the question - Given - The coordination number and geometry of the…

Q: Question 1 Determine the hybridization of the metal centre in the complexes below using Ligand…

A: Since you have posted more than one question , we are doing first one for you. To do the rest repost…

Q: Consider the complex square planar complex NiL4, where Ni2+ (d) is the central ion. Draw the system…

A: Solutions Given that Consider the complex square planer complex.. .…

Q: Shown below are mirror image pairs of coordination complexes of an octahedral complex with…

A: Answer given below

Q: NH2 H2 H,N, H2

Q: Do you expect any tetragonal distortion from octahedral structures of the following complexes.…

A: The Jahn Teller Effect is a geometric distortion of a non linear molecular system that reduces its…

Q: 36. What kind of a ligand "Ethylene diamine: H2N-CH2-CH2-NH2 is? a) Unidentate b) Bidentate c)…

A: Unidentate ligand :- ligand which has only one donor site. Bidentate ligand :- ligand which has two…

Q: Why is the energy of the dxz and dyz orbitals in a square-planar complex lower than that of the dxy…

A: The "square planar geometry" contains 4 ligands attached with 1 "central metal atom". In this…

Q: MeO2C. .CO2M. `N' Mn 'N' .N. MeO2C CO2Me CO2ME

Q: What would you expect the coordination sphere for the complex ion formed from Ni^2+ and…

A: In coordination chemistry, the first coordination sphere refers to the array of molecules and ions…

Q: Complex [Co(en):] [Co(CN)} [CoF6] [Co(NH;)6]* [Co(H2O),]*" Ao (cm ) 23,160 33,700 13,100 23,000…

A: 3. a. We have to tell among the given complexes, which two would be best explained by the σ-only…

Q: Draw out all the isomers, geometric and optical of the following complexes: a- [Pd(PPh3)2Cl2] b-…

A: In geometrical isomers, the ligand positions relatively are different. Cis isomers have same groups…

Q: C1....... Cu ***.... CI 5. Answer the following questions related to crystal field splitting. A. For…

Q: 2. Determine which of the following four coordinate complexes are tetrahedral and which are square…

A: There are number of theories have been proposed to determine the structure, magnetic behaviours of…

Q: Explain why the complex Fe(en)3]2 is far less prone to ligand substitution reaction than its…

A: Interpretation - To explain the complex [Fe(en)3]2+ is far less prone to ligand substitution…

Q: [COCI (NH3) 5] C12 Examine whether the complex obeys the effective atomic number rule.

A: The EAN rule means effective atomic number rule. When an atom obeys the EAN rule then it must attain…

Q: The metal ion, M2+, formed a paramagnetic tetrahedral complex [MJ4]2+, having three unpaired…

A: The given metal ion is M2+

Q: a) Naz[Fe(CN)4(en)] b) The complex ion of this compound is known to be diamagnetic. Draw the…

A: Since CN- is a strong field ligand, it forms low spin complex and has large crystal field splitting.…

Q: Determine the number of stereoisomers for square-planar metal complex: [PtCl2(en)]? en…

Q: Why is the energy of the dxz and dyz orbitals in a square-planar complex lower thanthat of the dxy…

A: The "square planar geometry" contains 4 ligands attached with 1 "central metal atom". In this…

Q: Determine the d electron configurationof [OsCl6]3-complex. A) (t2g)4(eg)2 B) (t2g)5(eg)0 C)…

A: Complex = [OsCl6]3- Here Os is present in +3 oxidation state. Electronic configuration of Os(Z=76)…

Q: Consider the [Ir2(dimen)4] 2+ complex. Notice that the dimen ligand is asymmetric. There is also a…

A: The two binuclear complex of Ir metal having the molecular formula [Ir2(dimen)4]2+ and [Ir2(TM4)4]2+…

Q: Arrange these complexes in order of octahedral splitting energy, A.. Largest A. Smallest Ao Answer…

Q: Mo(PMes)3(C6HS)2

Q: CFSE and total spin moment

Q: li Calculate the magnetic moment for a complex of Ho3,

Q: Find SALCs and construct the MO diagram for a transition metal complex with octahedral symmetry.

Q: The ppy ligand bears with inert complex. * substituent is expected to form the most CO2ME BF2 OH

A: For a ion/molecule to be inert in nature, we discuss the 3 main factors which are: Smaller size…

Q: 13. Using d-orbital splitting diagrams, please determine which of following complexes can exhibit…

A: Jahn-Teller effect refers to the distortion which occurs in the non-linear molecule. Due to this…

Q: Is the amine ligand less labile in the complex hexaamminenickel(II) tetrafluoroborate or in the…

A: Amine ligand is less or more labile is depends on the complex.

Q: The two egorbitals are identical in energy in an octahedralcomplex but have different energies in a…

A: The ligands are electron donors and they can donate the unshared electron pairs to the electrophilic…

Q: Consider the reactions below. Which of the following correctly identifies the coordinate complex?…

Q: explain and prove if [Fe(acac)3] is diamagnetic high spin octahedral complex using valence bond…

A: Acac is strong feild ligand, so according to VBT pairing take place and formation inner sphere…

Q: D. Consider the reaction of RuClz with terpyridine ligand. I. a. Draw the complex ion structure when…

A: Given RuCl3 with terpyridine ligand Complex structure = to be determined Stereoisomer in complex =…

Q: 2. Octahedral complex are shown as below. OCH3 H3CO LOCH3 Al H3CO rOCH3 OCH3 a. Calculate the CFSE…

Q: <p>Hexacyanomanganate(III) ion is a low-spin complex. Draw the crystal field splitting diagram…

A: Hexacyanomanganate (III) ion is a low spin complex because of the presence of cyano ligand, a strong…

Q: [FeF6]° , [Fe(CN)«]+

A: If the complex have unfilled orbitals, i.e., unpaired electrons, it is called a paramagnetic…

Q: 1. The UV-visible spectrum of an aqueous solution of CuSO, (which contains a Cu2+ metal center)…

A: ∆Oct is an energy term, representing the energy gap between the splitted orbitals and have an…

Q: When MCl4(NH3)2 is dissolved in water and treated withAgNO3, 2 mol of AgCl precipitates immediately…

A: When MCl4(NH3)2 is dissolved in water and treated withAgNO3, 2 mol of AgCl precipitates immediately…

Q: calculate the CFSE using Crsytal Field Theory. Compounds: Al(acac)3 , Cr(acac); , Cu(acac)2 a) Name…

A: Valence Bond theory describes covalent bond formation. According to this theory electrons occupy…

Q: Consider a d5 complex in tetrahedral symmetry. The dipole moment is found to be 1.73 μB. Is the…

Q: ce the following coordination complexes in order of bility constant, Bn. Justify your answer.…

A: Chelating agents are the chemical compounds that react with metal ions to form stable water…

Q: The octahedral complex ion [MnCl1* has more unpaired spins than the octahedral complex ion…

A: For [MnCl6]4- The oxidation state for Mn is +2. Cl is a very weak field ligand so it will form a…

Q: [Mn(H2O)6]?* complex has an extremely pale color, attributable to transitions which are formally…

Q: 1. The complex ion [Ni(en)2]2+ is… A. is diamagnetic because all electrons are paired B. is…

A: (1) When the complex have unpaired electrons , it is paramagnetic and when the complex have paired…

Q: The complex Mo(CO)3(NCC2H5)3 has the infrared spectrum shown below. Is this complex more likely the…

A: The mentioned complex is Mo(CO)3(NCC2H5)3

Q: Answer the following questions for square planar metal complexes ML4 (point group Dan): 2) draw the…

A: Electronic configuration of pt78 = [Xe]6s24f145d8

Q: The three complex ions [Mn(CN),]³-, [Mn(CN),J*¯, and [Mn(CN),]³- have all been synthesized and all…

A: All three complexes has cyanide ligand, CN- which is a strong field ligand , thus all complexes are…

Q: Short questions, all-or-nothing. There may be more than one answer per question. axial 3- CN NC Ni…

Q: Experiments can measure not only whether a compound is paramagnetic, but also the number of unpaired…

A: In the given complexes, CN- is a strong field ligand, and H2O is a weak field ligand.

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

100%

1. Give the d orbitals electronic configurations for the following complexes in On symmetry:
a. Nb(III) complex
b. Mo(II) complex with Ao higher than the total electron pairing energy
c. Mn(1I) complex with Ao lower than the total electron pairing energy
d. Au(1) complex
e. Ir(lII) complex with Ao higher than the total electron pairing energy

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step 5

Step by step

Solved in 5 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?
The two egorbitals are identical in energy in an octahedralcomplex but have different energies in a square planar complex,with the dz2orbital being much lower in energy than the dx2-y2 .Explain with orbital sketches.
Determine the symmetry of the orbital groups for the donor sigma bonds (σ) of the ligand in an octahedral complex. Construct an MO diagram for the formation of this complex and indicate which orbitals determine the Δo. Clearly indicate the procedure.
1.Show how a Fischer carbene complex can be prepared starting from Mo(CO)6 . 2.How would you explain the experimental observations that the SeF6 unit in Cs2[SeF6] is C2v and looks like six of the seven vertices of a capped trigonal prism are occupied by F, but the SeCl6 unit in Cs2[SeCl6] has Oh symmetry ?
Find SALCs and construct the MO diagram for a transition metal complex with octahedral symmetry.
Determine the hybridization of the metal centre in the complexes below using Ligand Field Theory. Give explanations to the hybridization that happened.
What is the most likely mechanism for ligand substitution in square-planar complexes? Group of answer choices association dissociation A wide variety of mechanisms are observed. Chemists have not determined one to take place in most cases. reductive elimination
Calculate the electron in the following complexes. a,b,c,d
What structural distortions would you expect to occur in the complex LnM( eta 4- butadiene) if the ligands L were made more electron releasing?
Work out the stoichiometries and structures of the neutral complexes, chromium carbonyl, rhenium carbonyl, and nickel carbonyl using the 18-electron rule. Then use valence bond theory to determine the hybridizations of the orbitals in each complex?