Q: Give the IUPAC name for each compound.
A: Since we answer only 3 sub-parts so we will answer first 3. Please resubmit the question mentioning…
Q: Give the IUPAC name for each compound. a. C. b. d. f.
A:
Q: (a) Give the IUPAC name for A and B. (b) Draw the product formed when A or B is treated with each…
A: a) The IUPAC name for A and B b) The product formed when A or B is treated with each reagent [1]…
Q: Give a systematic or common name for each compound. а.
A: Rules for naming the organic compound is as follows; Select the longest continuous main carbon…
Q: What alcohol starting material is needed to prepare each carbonyl compound as a product of an…
A: Alcohols are oxidized to formaldehyde, ketone and carboxylic acids.
Q: Give the IUPAC name for each compound.
A: Since you have posted question with multiple sub-parts, we are entitled to answer the first 3 only.…
Q: Give the IUPAC name for each compound.
A: Rues for IUPAC nomenclature 1. Select the longest chain. 2. Give numbering in such a way that the…
Q: Give the IUPAC name for each compound.
A: (a) CH3-CH2-CH2-CH2-CH(CH3)-CH2-CH3 IUPAC name : 3-methylheptane (b) IUPAC name :…
Q: Give an acceptable name for each compound depicted in the ball-and-stick models.
A: In the ball and stick model The grey sphere represents the hydrogen atom, blue represents nitrogen,…
Q: Give the IUPAC name for each ketone.
A: Rules to write the IUPAC name. 1) First locate the longest carbon chain. 2) Then locate all the…
Q: Explain why A is less water soluble than B, even though both compounds have the same functional…
A: Since in molecule 1, both C=O and the OH are near to each other. Hence they will have internal H…
Q: Name each compound depicted in the ball-and-stick models.
A: a. The given structure of alcohol is in the form of ball and stick model. It is converted into…
Q: Give the IUPAC name for each compound.
A: (a) The given structure is, From the structure, it is clear that, The parent ring is benzene One…
Q: What alcohol can be oxidized to each carboxylic acid?
A: Carboxylic acids are the carbon compounds that contain carboxyl group as a major functional group.…
Q: Give the IUPAC name of each compound.
A: Rules to write the IUPAC name. 1) First locate the longest carbon chain. 2) Then locate all the…
Q: Lycopene is a bright red carotenoid hudrocarbon found in tomatoes and other red fruits and…
A: Structure of Lycopene and it's IUPAC name is given below in next step
Q: Which compound in each pair has the higher boiling point? Он a. or b. or A.
A: The temperature where a liquid's vapor pressure equals the pressure of gas over it is known as the…
Q: Give the IUPAC name for each aldehyde.
A: Concept introduction: For naming an aldehyde in IUPAC nomenclature, the suffix –al is added to the…
Q: Label the functional group(s) in each compound as ethers or acetals.
A: In organic chemistry, functional groups are the atom or substituent which is responsible for the…
Q: Rank the following compounds in order of increasing boiling point. a. Он Он Он b. но Он
A: First Part
Q: Write the IUPAC name for each compound
A: Given compound structure,
Q: Explain why A is less water soluble than B, even though both compounds have the same functional…
A: 3.67 Since in molecule 1, both C=O and the OH are near to each other. Hence they will have…
Q: (a) Give the IUPAC name for A and B. (b) Draw the product formed when A or B is treated with each…
A:
Q: 4. Give the IUPAC names for the following molecules a) b)
A: IUPAC nomenclature system is basically a method to determine the names of organic molecules in a…
Q: Give the IUPAC name for each compound.
A: a). The aldehyde contains four carbon straight chain. It is a derivative of butane. Numbering from…
Q: Give the IUPAC name for each compound.
A: IUPAC refers to the international union for pure and applied chemistry. It gives a specific name for…
Q: IUPAC name for each compound. a. e. CH: b. f.
A:
Q: What alkyl halides are formed when each ether is treated with HBr?
A: Alkyl ethers are cleaved by the strong acids HBr in a nucleophilic substitution reaction.…
Q: Explain why A is less water soluble than B, even though both compounds have the same functional…
A: The solubility of a substance provides information about the extent of the substance moves into a…
Q: NO2 reagent E reagent A reagent B reagent D CI reagent C OH
A: Reaction A is known as the nitration of benzene because the product forming is a having a nitrate…
Q: 11. Give the IUPAC name for each compound. (a)
A: The given compound is complex substituted alkane. according to rule first, select the longest carbon…
Q: Give the IUPAC name for each compound.
A: IUPAC nomenclature is followed as a standard while naming various compounds.The main chain or the…
Q: Write the IUPAC and, where possible, a common name for each compound.
A: Write the IUPAC and, where possible, a common name for each compound.
Q: Give the IUPAC name for each compound. a. Он OH он он d.
A: a. First, number the carbon atoms that form the longest chain starting from the high priority side.…
Q: Give the IUPAC name for each ketone.
A: (a) 4-methyl-5-propyllheptan-3-one (b) 3-isopropyl-2-2methylcyclopentanone
Q: Give the IUPAC name for each polyfunctional compound.
A: The IUPAC nomenclature makes sure that every chemical compound has an identity that is the…
Q: Give the IUPAC name for each compound.
A: The answer for part (a) given below. Kindly repost the other part as separate one
Q: Give the IUPAC name for each compound. он LOH но он он OH d.
A: d) The compound given is having alcohol i.e -OH as major functional group. The longest carbon chain…
Q: Give a systematic or common name for each compound.
A: In the given structures, Black ball represents carbon atom, Blue ball represents nitrogen atom and…
Q: B. Give the IUPAC name for each compound. C. b. d.
A: Following are the appropriate IUPAC nomenclature of the four given organic compounds.
Q: What alkyl halides are formed when attached ether is treated with HBr?
A: Given ethers,
Q: 1. Give the IUPAC name for each compound. a. g. i. b.
A: Hi, since you have posted question that has multiple subparts, we will answer the first three…
Q: Answer each question using the ball-and-stick model of compound A. Draw a stereoisomer for A and…
A: Stereoisomers have the same composition and differ in the orientation of different groups in the…
Q: What ester and Grignard reagent are needed to prepare each alcohol?
A: Grignard reagent: Alkyl magnesium halide is called as Grignard reagent( R-MgX ). Grignard Reagent is…
Q: Give a systematic or common name for each compound.
A: a) The systematic name of the given compound is 4,6-dimethyl-1-heptanamine. The structure of the…
Q: Give the IUPAC name for each nitrile.
A: a. 4-chloro-2-methylhexanenitrile b. 2,3-diethyloctanenitrile c.…
Q: 10.38 Give the IUPAC name for each compound. а. b. с.
A: Note : As per our company guidelines we are supposed to answer only first 3 sub-parts. Kindly repost…
Q: Pristane is a high molecular weight alkane present in shark liver oil, a lipid used as a folk remedy…
A: The structure of pristane is as shown below
Answer question number 1 letters d, e, and f
Step by step
Solved in 6 steps with 3 images
- Which member of each pair is more soluble in water? Why?(a) CH₃CH₂OCH₂CH₃(l) or CH₃CH₂OCH₃(g)(b) CH₂Cl₂(l) or CCl₄(l)Draw the products (including stereoisomers) formed when benzaldehyde (C6H5CHO) is treated with each Wittig reagent.Isomers with the same boiling point and molecular weight but have different boiling points how is this possible ?
- What reagent can be used from compound F to G? (NaH / NaOH / LiAlH4+hydronium quench / CrO3 Jones)Which compounds (B–F) are identical to A? (b) Which compounds (B–F) represent an isomer of A?(a) Give the IUPAC name for A and B. (b) Draw the product formed when A or B is treated with each reagent: [1] NaBH4, CH3OH; [2] CH3MgBr, then H2O; [3] Ph3P = CHOCH3; [4] CH3CH2CH2NH2, mild acid; [5] HOCH2CH2CH2OH, H+.
- Answer each question using the ball-and-stick model of compound A. Draw a constitutional isomer that contains an ether and give its IUPACname. Draw the products formed (including stereochemistry) when A istreated with each reagent: [1] NaH; [2] H2SO4; [3] POCl3, pyridine; [4]HCl; [5] SOCl2, pyridine; [6] TsCl, pyridineDraw the product formed when (CH3)2CHOH is treated with each reagent (a, b and c)What are the IUPAC's for each structure?
- (a) Draw the products formed when propane is heated with Br2. (b) Label major and minor products and explain with an energy diagram.Which product is predominate?Draw the organic product(s) formed when CH3CH2CH2OH is treated with each reagent. a.H2SO4 b.NaH c.HCl + ZnCl2 d.HBr e.SOCl2, pyridine f.PBr3 g.TsCl, pyridine h. [1] NaH; [2] CH3CH2Br [1] i.TsCl, pyridine; [2] NaSH j.POCl3, pyridine