Answered: 1. How many isomers of the octahedral…

1. How many isomers of the octahedral complex below? Draw all the isomers! a) [CoBr,ClI2]3- b)[C0C14B12]3- e) [MFCIBrI3]+

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter22: The Chemistry Of The Transistion Elements

Section: Chapter Questions

Problem 68GQ: How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand...

See similar textbooks

Related questions

Q: Question 1 Determine the hybridization of the metal centre in the complexes below using Ligand…

A: Since you have posted more than one question , we are doing first one for you. To do the rest repost…

Q: Suppose you have ML6 - d octahedral complex, calculate The CFSE for a high-spin of this complex: a)…

A: Crystal field stabilization energy or CFSE is a consequence of distribution of electrons in the…

Q: Name the following complexes and draw the structures of one possible isomer of each: (i)…

A: Note - Since you have asked multiple question, we will solve the first question for you. If youwant…

Q: 2. Assign the oxidation state of each M. Assuming the 18-electron rule applies, identify the 1st row…

Q: Which ligand below gives the LEAST stability to Pd2+ in forming a square planar complex? О а. NH3 O…

A: a) NH3 will form the least stable complex. Because we know that more is the basicity of lignad more…

Q: Which dn configuration is not capable of giving low-spin and high-spin complexes in an octahedral…

A: According to the crystal field theory the ligand atom acts as point negative change and the metal…

Q: The complex [Co(ox)(PMe, ),(NH,)C1]shows total number of isomers is ....... A) 5 B) 4 C) 3 D) 2

A: The compounds that have same molecular formula but have different arrangement of atoms in a space…

Q: (a) Explain the hybridization and structure of the following complexes [Cu(NH3)4]SO4 Zn₂[Fe(CN)6]…

A: Given,

Q: What energy levels are occupied in a complex such ashexacarbonylchromium(0)? Are any electrons…

A: According to the molecular orbital theory, the atomic orbitals combine to form new molecular…

Q: 4) The complex [Cr(OH2)3BrClI] has 4 possible isomers. Draw each of them.

A: In this question, we will draw the structure of all Four possible isomers. You can see details…

Q: By using valence bond theory and ligand field theory, prove [Fe(acac)3] is a paramagnetic high spin…

Q: Among the complex ions formed by M³* (M is a transition metal in 3d block) are the following:…

A: From given Each of the given complexes is correctly matched with the respective colors.

Q: Sketch all isomers of the following complex. Identify each isomer and indicate clearly each pair of…

A: The given complex is [Pd(NH3)(Cl)(OCH3)(H2O)].

Q: 2. Octahedral complex are shown as below. OCH3 H3CO LOCH3 Al H3CO `OCH3 ÓCH3 a. Calculate the CFSE…

Q: 1.Show how a Fischer carbene complex can be prepared starting from Mo(CO)6 . 2.How would you explain…

A: Back donation:The carbonyl ligand that coordinated with the metal has electron rich sp orbital. The…

Q: According to the Crystal field theory (CFT), Draw the d-orbital splitting diagram for the following…

A: As we know, according to crystal field theory, the interaction between a central metal and an…

Q: Is this complex K3[Fe(C2O4)3].3H2O paramagnetic or diamagnetic, explain?

A: We will discuss whether this complex K3[Fe(C2O4)3].3H2O is paramagnetic or diamagnetic.

Q: which of these complexes will show geometrical isomerism: a MA2X2 b MA2XY c MABCY d All of these

A: Geometric isomerism:Two or more compounds with the same formula but are having different…

Q: C1....... Cu ***.... CI 5. Answer the following questions related to crystal field splitting. A. For…

Q: Na2[Fe(CN)4(en)] The complex ion of this compound is known to be diamagnetic. Draw the d-orbital…

Q: [Cu(NH3)5Cl]2+ - name the complex

A: The name of inorganic coordination complexes are written according to the following general rules:…

Q: Explain why the complex Fe(en)3]2 is far less prone to ligand substitution reaction than its…

A: Interpretation - To explain the complex [Fe(en)3]2+ is far less prone to ligand substitution…

Q: The complex [Fe(en) 2Cl2]Cl is low spin Is the compound optically active? Explain your answer

Q: Is this complex [Co(NH3)5Cl]CI2 paramagnetic or diamagnetic, explain?

A: Diamagnetic or paramagnetic nature of compound. If metal contains unpaired electrons then compound…

Q: Determine the number of stereoisomers for square-planar metal complex: [PtCl2(en)]? en…

Q: 1. Explain why both cis and trans isomers are possible for [Co(NH3)2(C;O4)2] but only the cis isomer…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: How does the ligand relate to the complex in the pictureș i want explan and draw FeCl3 + 3 CH3COONH4…

A: Ligands are ions or neutral molecules that bond to a central metal atom or ion.

Q: Write the IUPAC name of the complex [Cr(NH3)4Cl2]+. What type of isomerism does it exhibit?

A: IUPAC name for [Cr(NH3)4Cl2]+ is tetraaminedichlorochromium (III)

Q: Name the following ligands: A.H2NCH2.CH2NH2 B. NO3 C. NH3 D. Br

A: a) Ethylenediamine b) Nitrato

Q: (b) Give the coordination geometries for each complexes. i. Re (CO) (p-n-C,H) ii. (Ar)W(CO)s iii.…

A: The required work is attached here , kindly find

Q: How many optically active isomer obtained from the octahedral complex of the type [МАЗВСD]? 1 3 4

Q: Which of these ions cannotform both high- and low-spinoctahedral complexes: (a) Mn3+; (b) Nb3+;…

A: In an octahedral complex, the central atom is surrounded by six ligands. Depending upon the strength…

Q: Depict and explain the Crystal field stabilization theory based on the color the below complexes.…

Q: 18-Elect Octahedral Complexes are stable, while 16-electron squareplane complexes are stable.…

Q: The effective atomic number of the [Co (en) 3] Cl3 complex is 36, and the complex obeys this rule.…

A: EAN i.e. effective atomic number rule is number of electrons surrounding to Central metal atom in…

Q: 2. Octahedral complex are shown as below. OCH3 H3CO LOCH3 Al H3CO rOCH3 OCH3 a. Calculate the CFSE…

Q: <p>Hexacyanomanganate(III) ion is a low-spin complex. Draw the crystal field splitting diagram…

A: Hexacyanomanganate (III) ion is a low spin complex because of the presence of cyano ligand, a strong…

Q: Which of the following is the most stable complex? а. [Fe(CN)6]3- b. [Fe(CO)s] С. [Fe(C204)3]3- d.…

Q: For each of the following complexes: a. [Fe(Br)s]3- i. Calculate the number of d electrons. ii. Draw…

Q: Among the complex ions formed by M³* (M is a transition metal in 3d block) are the following:…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: 6. In the following complex compound there are _ d electrons. [Zn(NH3)4]^2+

Q: Part A How many unpaired electrons are in the d orbitals of an octahedral complex of Ru3+ assuming…

A: In strong field, electrons enter the eg orbitals only when t2g orbitals are completely filled.

Q: Name the following complex: [Ni(en)2(F)(NO2)][PtCl3(py)]

A: bis(ethylenediamine)flurido(nitrito-N)nickel(III) trichloridopyridineplatinate(II)

Q: The type of isomerization in the following complex is 3+ 3- 3+ 3- NH3 NH3 CN NC CN Cr. NC CN CN NH3…

A: Solution : Coordination compounds consist of central metal atom or ion surrounded by ions…

Q: b) Consider (Co(CI).F and (Co(NH3)e]* ions. i. Illustrate the energy level splitting diagram for…

A: Since Cl is weak field ligand then the complex shows high spin And NH3 is strong field ligand shows…

Q: 1. How many isomers of the octahedral complex below? Draw all the isomers! a) [CoBr,Cl2I2]3-…

A: Two or more compounds having the same molecular formula but different arrangment of atoms are called…

Q: Calculate the crystal field stabilizing energy (CFSE) for the complexes below. i. [NİC14]²•,…

A: [NiCl4 ]2- Ni2+ →[Ar]3d8 Cl −→ weak field ligand,so pairing do not take place and have tetrahedral…

Question

1. How many isomers of the octahedral complex below?
Draw all the isomers!
a) [CoBr2Cl2I2]³-
b)[COCL4B%2]3-
e) [MFCIBrl3]+-

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen