1. Write out the word equation for the following:H3(PO4)+ Ca(OH), → Caz(PO4)2+ H,O.hydrogen oxide and calcium hydroxide react to form calcium oxide and waterO hydrogen peroxide reacts with calcium hydroxide to form calclum phosphate and waterhydrogen phosphate reacts with calcium hydroxide, producing calcium phosphate and waterhydrogen phosphide and calcium hydroxide form calcium phosphide and waterPREVIOUS1 of 5NEXTescCeC@232$4.5Wert

Answered: Image /qna-images/answer/d2fa8f5f-837d-4476-b8de-6fb97f060b84.jpg

1. Write out the word equation for the following:H3(PO4) + Ca(OH), → Ca3(PO4), + H,O. hydrogen oxide and calcium hydroxide react to form calcium oxide and water O hydrogen peroxide reacts with calcium hydroxide to form calcium phosphate and water hydrogen phosphate reacts with calcium hydroxide, producing calcium phosphate and water hydrogen phosphide and calcium hydroxide form calcium phosphide and water

1. Write out the word equation for the following:H3(PO4) + Ca(OH), → Ca3(PO4), + H,O. hydrogen oxide and calcium hydroxide react to form calcium oxide and water O hydrogen peroxide reacts with calcium hydroxide to form calcium phosphate and water hydrogen phosphate reacts with calcium hydroxide, producing calcium phosphate and water hydrogen phosphide and calcium hydroxide form calcium phosphide and water

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter3: Chemical Reactions

Section: Chapter Questions

Problem 45PS

See similar textbooks

Similar questions

In a common experiment in the general chemistry laboratory, magnesium metal is heated in air to produce MgO. MgO is a white solid, but in these experiments it often looks gray, due to small amounts of Mg3N2, a compound formed as some of the magnesium reacts with nitrogen. Write a balanced equation for each reaction.
3.14 A number of compounds are used in cement, and reactions among them occur when water is added. In one, CaO reacts with Al2O3 and water to form Ca3Al2(OH)12. Write a bal- anced chemical equation for this process.
Balance each of the following equations, and then write the net ionic equation. Show states for all reactants and products (s, . g, aq). (a) the reaction of sodium hydroxide and iron(II) chloride to give iron(II) hydroxide and sodium chloride (b) the reaction of barium chloride with sodium carbonate to give barium carbonate and sodium chloride (c) the reaction of ammonia with phosphoric acid
(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).
Many over-the-counter antacid tablets are now formulated using calcium carbonate as the active ingredient, which enables such tablets to also be used as dietary calcium supplements. As an antacid for gastric hyperacidity, calcium carbonate reacts by combining with hydrochloric acid found in the stomach, producing a solution of calcium chloride, converting the stomach acid to water, and releasing carbon dioxide gas (which the person suffering from stomach problems may feel as a “burp”). Write the unbalanced chemical equation for this process.
List and define all the ways of classifying chemical reactions that have been discussed in the text. Give a balanced chemical equation as an example of each type of reaction, and show clearly how your example fits the definition you have given.
One of relatively few reactions that takes place directly between two solids at room temperature is Ba(OH)2+8H2O(s)+NH4SCN(s)Ba(SCN)2(s)+H2O(l)+NH3(g) In this equation, the 8H2O in Ba(OH)2 8H2O indicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate. a. Balance the equation. b. What mass of ammonium thiocyanate (NH4SCN) must be used if it is to react completely with 6.5 g barium hydroxide octahydrate?
Aqueous hydrogen fluoride (hydrofluoric acid) is used to etch glass and to analyze minerals for their silicon content. Hydrogen fluoride will also react with sand (silicon dioxide). (a) Write an equation for the reaction of solid silicon dioxide with hydrofluoric acid to yield gaseous silicon tetrafluoride and liquid water. (b) The mineral fluorite (calcium fluoride) occurs extensively in Illinois. Solid calcium fluoride can also be prepared by the reaction of aqueous solutions of calcium chloride and sodium fluoride, yielding aqueous sodium chloride as the other product. Write complete and net ionic equations for this reaction.
Iron oxide ores, commonly a mixture of FeO and Fe2O3, are given the general formula Fe3O4. They yield elemental iron when heated to a very high temperature with either carbon monoxide or elemental hydrogen. Balance the following equations for these processes: Fe3O4(s)+H2(g)Fe(s)+H2O(g)Fe3O4(s)+CO(g)Fe(s)+CO2(g)
ABS plastic is a tough, hard plastic used in applications requiring shock resistance. The polymer consists of three monomer units: acrylonitrile (C3H3N), butadiene (C4H6), and styrene (C8H8). a. A sample of ABS plastic contains 8.80% N by mass. It took 0.605 g of Br2 to react completely with a 1.20-g sample of ABS plastic. Bromine reacts 1: 1 (by moles) with the butadiene molecules in the polymer and nothing else. What is the percent by mass of acrylonitrile and butadiene in this polymer? b. What are the relative numbers of each of the monomer units in this polymer?