8. Write out the word equation for the following:H3(PO4) + Ca(OH), Caz(PO4), + H2O. O hydrogen peroxide reacts with calcium hydroxide to form calcium phosphate and water hydrogen phosphate reacts with calcium hydroxide, producing calcium phosphate and water hydrogen oxide and calcium hydroxide react to form calcium oxide and water hydrogen phosphide and calcium hydroxide form calcium phosphide and water

8. Write out the word equation for the following:H3(PO4) + Ca(OH), Caz(PO4), + H2O. O hydrogen peroxide reacts with calcium hydroxide to form calcium phosphate and water hydrogen phosphate reacts with calcium hydroxide, producing calcium phosphate and water hydrogen oxide and calcium hydroxide react to form calcium oxide and water hydrogen phosphide and calcium hydroxide form calcium phosphide and water

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 97E: Give the balanced equation for each of the following chemical reactions: a. Glucose (C6H12O6) reacts...

See similar textbooks

Similar questions

4.21 Ammonium nitrate, NH4NO3, will decompose explosively to form N2, O2, and H2O, a fact that has been exploited in terrorist bombings. What mass of nitrogen is formed by the decomposition of 2.6 kg of ammonium nitrate?
3.88 One Step in the enrichment of uranium for use in nuclear power plants involves the reaction of UO2 with hydro- fluoric acid (HF) solution. The products are solid UF4 and water. Write a balanced chemical equation for this reaction.
Give the balanced equation for each of the following chemical reactions: a. Glucose (C6H12O6) reacts with oxygen gas to produce gaseous carbon dioxide and water vapor. b. Solid iron(III) sulfide reacts with gaseous hydrogen chloride to form solid iron(III) chloride and hydrogen sulfide gas. c. Carbon disulfide liquid reacts with ammonia gas to produce hydrogen sulfide gas and solid ammonium thiocyanate (NH4SCN).
High cost and limited availability of a reactant often dictate which reactant is limiting in a particular process. Identify the limiting reactant when the reactions below are run, and come up with a reason to support your decision. a. Burning charcoal on a grill: C(s)+O2(g)CO2(g) b. Burning a chunk of Mg in water: Mg(s)+2H2O(l)Mg(OH)2(aq)+H2(g) c. The Haber process of ammonia production: 3H2(g)+N2(g)2NH3(g)
Colorful fireworks often involve the decomposition of barium nitrate and potassium chlorate and the reaction of the metals magnesium, aluminum, and iron with oxygen. (a) Write the formulas of barium nitrate and potassium chlorate. (b) The decomposition of solid potassium chlorate leads to the formation of solid potassium chloride and diatomic oxygen gas. Write an equation for the reaction. (c) The decomposition of solid barium nitrate leads to the formation of solid barium oxide, diatomic nitrogen gas, and diatomic oxygen gas. Write an equation for the reaction. (d) Write separate equations for the reactions of the solid metals magnesium, aluminum, and iron with diatomic oxygen gas to yield the corresponding metal oxides. (Assume the iron oxide contains Fe3+ ions.)
Many over-the-counter antacid tablets are now formulated using calcium carbonate as the active ingredient, which enables such tablets to also be used as dietary calcium supplements. As an antacid for gastric hyperacidity, calcium carbonate reacts by combining with hydrochloric acid found in the stomach, producing a solution of calcium chloride, converting the stomach acid to water, and releasing carbon dioxide gas (which the person suffering from stomach problems may feel as a “burp”). Write the unbalanced chemical equation for this process.
How many molecules of the sweetener saccharin can be prepared from 30 C atoms, 25 H atoms, 12 0 atoms, 8 S atoms, and 14 N atoms?
4.28 One of the steps in the manufacture of nitric acid is the oxidation of ammonia shown in this equation: 4NH3(g)+5O2(g)4NO(g)+6H2O(g) If 43.0 kg of NH3 reacts with 35.4 kg of O2, what mass of NO forms?
Aqueous hydrogen fluoride (hydrofluoric acid) is used to etch glass and to analyze minerals for their silicon content. Hydrogen fluoride will also react with sand (silicon dioxide). (a) Write an equation for the reaction of solid silicon dioxide with hydrofluoric acid to yield gaseous silicon tetrafluoride and liquid water. (b) The mineral fluorite (calcium fluoride) occurs extensively in Illinois. Solid calcium fluoride can also be prepared by the reaction of aqueous solutions of calcium chloride and sodium fluoride, yielding aqueous sodium chloride as the other product. Write complete and net ionic equations for this reaction.
3.19 Silicon nitride, Si3N4, is used as a reinforcing fiber in con- struction materials. It can be synthesized from silicon tetra- chloride and ammonia. The other product is ammonium chloride. Write the balanced chemical reaction for this
One of relatively few reactions that takes place directly between two solids at room temperature is Ba(OH)2+8H2O(s)+NH4SCN(s)Ba(SCN)2(s)+H2O(l)+NH3(g) In this equation, the 8H2O in Ba(OH)2 8H2O indicates the presence of eight water molecules. This compound is called barium hydroxide octahydrate. a. Balance the equation. b. What mass of ammonium thiocyanate (NH4SCN) must be used if it is to react completely with 6.5 g barium hydroxide octahydrate?