2. Calculate AG from standard enthalpy of formation and standard molarentropy values and predict whether the following reactions is spontaneous ornot, at 25 °C.А.H21 + COzH2O+ COAH (kJ/mol)S° (J/mol.K)130.6H2CO2H2OCO-393.5-241.8-110.5213.6188.8197.9B. Fe Oa)3H22Fe + 3H2OAH (kJ/mol)S° (J/mol.K)Fe203l-822.290.0FelH2O130.627.2188.8-241.8

Given reactions: A. H2 (g) + CO2 (g) →H2O (g) + CO (g) B. Fe2O3 (s) + 3H2 (g) → 2Fe (s) + 3H2O (g)…

2. Calculate AG° from standard enthalpy of formation and standard molar entropy values and predict whether the following reactions is spontaneous or not, at 25 °C. А. Hao + COzi H2O + CO S° (J/mol.K) 130.6 213.6 188.8 197.9 AH (kJ/mol) CO2 H2O CO -393.5 -241.8 -110.5 B. Fe Oa + 3H2 2Fe + 3H2O AH (kJ/mol) S° (J/mol.K) Fe203) -822.2 90.0 Fel H2O 130.6 27.2 188.8 -241.8

2. Calculate AG° from standard enthalpy of formation and standard molar entropy values and predict whether the following reactions is spontaneous or not, at 25 °C. А. Hao + COzi H2O + CO S° (J/mol.K) 130.6 213.6 188.8 197.9 AH (kJ/mol) CO2 H2O CO -393.5 -241.8 -110.5 B. Fe Oa + 3H2 2Fe + 3H2O AH (kJ/mol) S° (J/mol.K) Fe203) -822.2 90.0 Fel H2O 130.6 27.2 188.8 -241.8

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter10: Entropy And The Second Law Of Thermodynamics

Section: Chapter Questions

Problem 10.7PAE: On the basis of your experience, predict which of the following reactions are spontaneous. (a)...

See similar textbooks

Similar questions

In a spontaneous process, S(universe) is (a) 0 (b) = 0 (c) 0
The evaporation of one mole of water at 298 K has a standard free allergy change of 8.58 kJ. H2O(l)H2O(g)G298=8.58kJ (a) Is the evaporation of water under standard thermodynamic conditions spontaneous?. (b) Determine the equilibrium constant, KP, for this physical process. (c) By calculating G, determine if the evaporation of water at 298 K is spontaneous when the partial pressure of water, PH2O, is 0.011 atm.. (d) If the evaporation of water were always nonspontaneous at room temperature, wet laundry would never dry when placed outside. In order for laundry to dry, what must be the value of PH2O in the air?
Estimate the temperature range over which each of the following reactions is spontaneous. (a) 2Al(s)+3Cl2(g)2AlCl3(s) (b) 2NOCl(g)2NO(g)+Cl2(g) (c) 4NO(g)+6H2O(g)4NH3(g)+5O2(g) (d) 2PH3(g)3H2(g)+2P(g)
Explain why absolute entropies can be measured.
The synthesis of glucose directly from CO2 and H2O and the synthesis of proteins directly from amino acids are both non-spontaneous processes under standard conditions. Yet it is necessary for these to occur for life to exist. In light of the second law of thermodynamics, how can life exist?
On the basis of your experience, predict which of the following reactions are spontaneous. (a) CO2(s)CO2(g) at 25°C (b) NaCl(s)NaCl(l) at 25°C (c) 2NaCl(s)2Na(s)+Cl2(g) (d) CO2(g)C(s)+O2(g)
Limestone is predominantly CaCO3, which can undergo the reaction CaCO3(s)CaO(s)+CO2(g). We know from experience that this reaction is not spontaneous, yet S for the reaction is positive. How can the second law of thermodynamics explain that this reaction is not spontaneous?
For the reaction CH3OH(l)+32O2(g)2H2O(l)+CO2(g) the value of G is 702.2 kJ at 25C. Other data are as follows: Hf (kJ/mol) at 25C S (J/molK) at 25C CH3OH(l) 238.7 126.8 H2O(l) 285.8 70.0 CO2(g) 393.5 213.7 Calculate the standard entropy, S, per mole of O2(g).
Calculate the entropy change for the vaporization of liquid methane and liquid hexane using the following data. Boilling point (1atm) Hvap Methane 112K 8.20 KJ/mol Hexane 342K 28.9 KJ/mol Compare the molar volume of gaseous methane at 112 K with that of gaseous hexane at 342 K. How do the differences in molar volume affect the values of Svap for these liquids?
In the thermodynamic definition of a spontaneous process, why is it important that the phrase “continuous intervention” be used rather than just “intervention?”
Liquid water at 25C is introduced into an evacuated, insulated vessel. Identify the signs of the following thermodynamic functions for the process that occurs: H, S, Twater, Ssurr,, Suniv.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)