2. Calculate the value of AH° for the following reaction: P4010(s) + 6PC15(g) 10C13PO(g) using the following four equations: a) P4(s) + 6Cl₂(g) ---> 4PC13(g) b) P4(s) + 50₂(g) ---> P4O10(s) c) PC13(g) + Cl₂(g) ---> PC15(g) d) PC13(g) + 1/2O2(g) ---> C13PO(g) AH = -285.7 kJ AH° = -1225.6 kJ AH° = -2967.3 kJ AH° -84.2 kJ =

2. Calculate the value of AH° for the following reaction: P4010(s) + 6PC15(g) 10C13PO(g) using the following four equations: a) P4(s) + 6Cl₂(g) ---> 4PC13(g) b) P4(s) + 50₂(g) ---> P4O10(s) c) PC13(g) + Cl₂(g) ---> PC15(g) d) PC13(g) + 1/2O2(g) ---> C13PO(g) AH = -285.7 kJ AH° = -1225.6 kJ AH° = -2967.3 kJ AH° -84.2 kJ =

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter4: Acids And Bases

Section4.6: Molecular Structure And Acidity

Problem 1Q: Acid-Base Equilibria Many factors contribute to the acidity of organic compounds. Electronegativity,...

See similar textbooks

Similar questions

From the following information, determine ΔH°f of malonic acid, CH2(COOH)2(s).CH2(COOH)2(s) + 2O2(g) → 3CO2(g) + 2H2O(l); ΔH° = –861.0 kJSubstance ΔH°f (kJ/mol)CO2(g) –393.5H2O(l) –285.8a. 2613 kJb. 891.1 kJc. −1540.3 kJd. −2613.1 kJe. −891.1 kJ
A Keq value of 5.2 x 104 tells us that, at equilibrium, ____________ are favored. Group of answer choices
1. The ΔHac of nitrogen dioxide is -937.86 kJ/mole. The ΔHf of nitrogen dioxide is +33.2 kJ/mole. Propose a reasonable explanation for this difference.
The ?a of HCNHCN is 6.2×10−10.6.2×10−10. What is the ?b value for CN− at 25 °C?
Benzoic acid is a weak acid that has antimicrobial properties. Its sodium salt, sodium benzoate, is a preservative found in foods, medications, and personal hygiene products. Benzoic acid dissociates in water: C6H5COOH (aq) + H2O (l) C6H5COO- (aq) + H3O+ (aq) The pKa of this reaction is 4.2. In a 0.62 mol L^-1 solution of Benzoic acid, what percentage of the molecules are ionized? Express your answer to two significant figures and include appropriate units.
vingegar is 5.0% (w/v) solution of acetic (CH3COOH) in water, Acetic Acid's molar mass is 60.032g/ mol A. Determine the molarity of acetic acid? B. When acetic acid is put into water at the molarity you determined in part a, what is the Ph of vinegar? (the Ka of acetic acid is 1.8x10-5)
Calculate the Ka for aqueous hydrogen cyanide dissociation at 258.0 oC. The ΔGo for HCN(aq) = 112 kJ/mole and ΔGo for CN-1(aq) = 166 kJ/mole. HCN(aq) ↔ H+1(aq) + CN-1(aq) Group of answer choices 4.87x10-6 6.31x10-10 1.17x10-11 5.86x10-13 0.989
Acid-Base Equilibria Many factors contribute to the acidity of organic compounds. Electronegativity, resonance, induction, hybridization, aromaticity, and atomic size, all play a role. In the following comparisons, you are asked to identify the factor(s) that would be most important to analyze when predicting relative acidity, and then to predict the trend in acidity and pKa values. For each of the following pairs of compounds answer the following two multiple-choice questions. 1. What factor(s) are the most important to consider when predicting the relative acidity of the two compounds? a. Electronegativity of the atom possessing the hydrogen. b. Resonance stabilization of the anionic conjugate base. c. Inductive stabilization of the anionic conjugate base. d. Hybridization of the atom possessing the hydrogen. e. The atomic size of the atom possessing the hydrogen.
Give the formula of the conjugate acide of H2O ?
What is the pH of an aqueous solution containing 0.50 mol L–1 ethanoic acid, 0.30 mol L–1 sodium ethanoate, and 0.10 mol L–1 HCl? [The pKa of ethanoic acid is 4.75.]
8. (a) HA(aq) is a weak acid with a dissociation constant, Ka, of 8.8 x 10−12. What is the pH of a 0.022 M solution of A−(aq)? The temperature is 25 ◦C. (b) For the reaction A(g) =A(l), the equilibrium constant is 0.666 at 25.0 ◦C and 0.222 at 75.0 ◦C. Making the approximation that the entropy and enthalpy changes of this reaction do not change with temperature, at what temperature will the equilibrium constant be equal to 0.777?
The weak base (CH3)2NH has a Kb = 5.9 x 10−4 at 25 °C. a) Write out the chemical equation for the protonation reaction of (CH3)2NH to form the conjugate acid: (CH3)2NH2+ . b) What is the ionization constant at 25 °C for (CH3)2NH2+?