2. The corrosion of aluminum in cookwares is prevented as the aluminum metal reacts withoxygen in the air, producing a protective coat of aluminum oxide.a. Balance the equation:_Al +_ 02 4_A2O3b. How many grams of oxygen gas will react with 25.0 grams of aluminum?c. How many grams of aluminum oxide will be produced by the reaction in letter b?d. What is the percent yield if the actual yield is 36.4 grams?

Rusting of iron refers to the formation of rust, a mixture of iron oxides, on the surface of iron…

2. The corrosion of aluminum in cookwares is prevented as the aluminum metal reacts with oxygen in the air, producing a protective coat of aluminum oxide. a. Balance the equation: _Al +_ 02 _A½O3 b. How many grams of oxygen gas will react with 25.0 grams of aluminum? c. How many grams of aluminum oxide will be produced by the reaction in letter b? d. What is the percent yield if the actual yield is 36.4 grams?

2. The corrosion of aluminum in cookwares is prevented as the aluminum metal reacts with oxygen in the air, producing a protective coat of aluminum oxide. a. Balance the equation: _Al +_ 02 _A½O3 b. How many grams of oxygen gas will react with 25.0 grams of aluminum? c. How many grams of aluminum oxide will be produced by the reaction in letter b? d. What is the percent yield if the actual yield is 36.4 grams?

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter3: Mass Relations In Chemistry; Stoichiometry

Section: Chapter Questions

Problem 67QAP: When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and...

See similar textbooks

Similar questions

When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
4.72 The picture shown depicts the species present at the start of a combustion reaction between methane, CH4 and oxygen, O2 (a) What is the limiting reactant? (b) Draw the resulting state after this set of reactants has reacted as far as possible.
DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
4.70 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients. (c) identify the limiting reactant, and explain how the pictures allow you to do so.
4.71 The particulate scale drawing shown depict the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients. (c) Identify the limiting reactant, and explain how the pictures allow you to do so.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A at-oms are shown in blue and B atoms in white). The box on the left represents the box on the right shows what is left once the reaction has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
A weighed sample of iron (Fe) is added to liquid bromine (Br2) and allowed to react completely. The reaction produces a single product, which can be isolated and weighed. The experiment was repeated a number of times with different masses of iron but with the same mass of bromine (see graph below). (a) What mass of Br2 is used when the reaction consumes 2.0 g of Fe? (b) What is the mole ratio of Br2 to Fe in the reaction? (c) What is the empirical formula of the product? (d) Write the balanced chemical equation tor the reaction of iron and bromine. (e) What is the name of the reaction product? (f) Which statement or statements best describe the experiments summarized by the graph? (i) When 1.00 g of Fe is added to the Br2, Fe is the limiting reagent. (ii) When 3.50 g of Fe is added to the Br2, there is an excess of Br2. (iii) When 2.50 g of Fe is added to the Br2, both reactanu are used up compietely. (iv) When 2.00 g of Fe is added to the Br2, 10.8 g of product is formed. The percent yield must therefore be 20.0%.
3.82 The particulate scale drawing shown depicts the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
ou know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to know to determine the amount of product that will be produced? Explain.
Although many sulfate salts are soluble in water, calcium sulfate is not (Table 7. 1). Therefore, a solution of calcium chloride will react with sodium sulfate solution to produce a precipitate of calcium sulfate. The balanced equation is :math>CaCl2(aq)+Na2SO4(aq)CaSO4(s)+2NaCl(aq) a solution containing 5.21 g of calcium chloride is combined with a solution containing 4.95 g of sodium sulfate, which is the limiting reactant? Which reactant is present in excess?