1. 1.02 grams of calcium metal reacts with hydrochloric acid (HCl). a. Write a balanced equation for this reaction. b. Identify the type of reaction. How many moles of hydrochloric acid will be used if 1.02 grams of calcium reacts. с. d. How many grams of calcium chloride will form when 1.02 grams of calcium reacts with hydrochloric acid? e. If a student collected 2.55 grams of calcium chloride, what is the percent yield? % yield Actual х 100 Theoretical

1. 1.02 grams of calcium metal reacts with hydrochloric acid (HCl). a. Write a balanced equation for this reaction. b. Identify the type of reaction. How many moles of hydrochloric acid will be used if 1.02 grams of calcium reacts. с. d. How many grams of calcium chloride will form when 1.02 grams of calcium reacts with hydrochloric acid? e. If a student collected 2.55 grams of calcium chloride, what is the percent yield? % yield Actual х 100 Theoretical

Living By Chemistry: First Edition Textbook

1st Edition

ISBN:9781559539418

Author:Angelica Stacy

Publisher:Angelica Stacy

ChapterU4: Toxins: Stoichiometry, Solution Chemistry, And Acids And Bases

Section: Chapter Questions

Problem SV2RE

See similar textbooks

Similar questions

Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
If baking soda (sodium hydrogen carbonate) is heated strongly, the following reaction occurs: :math>2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) lculate the mass of sodium carbonate that will remain if a 1.52-g sample of sodium hydrogen carbonate is heated.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
ou know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to know to determine the amount of product that will be produced? Explain.
You know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to determine the amount of product that will be produced? Explain.
3.81 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Consider the equation: 2A+B5C. If 10.0 g of A reacts with 5.00 g of B. how is the limiting reactant determined? Choose the best answer and explain. l type='a'> Choose the reactant with the smallest coefficient in the balanced chemical equation. So in this case, the limiting reactant is B. Choose the reactant with the smallest mass given. So in this case, the limiting reactant is The mass of each reactant must be converted to moles and then compared to the ratios in the balanced chemical equation. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must he converted to moles first. The reactant with the fewest moles present is the limiting reactant. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must be divided by their coefficients in the balanced chemical equation, and the smallest number present is the limiting reactant. So in this case, there is no limiting reactant because A and B arc used up perfectly.
The gaseous hydrocarbon acetylene, C2H2, is used in welders’ torches because of the large amount of heat released when acetylene burns with oxygen. :math>2C2H2(g)+5O2(g)4CO2(g)+2H2O(g) w many grams of oxygen gas are needed for the complete combustion of 150 g of acetylene?
You have seven closed containers, each with equal masses of chlorine gas (Cl2) . You add 10.0 g of sodium to the first sample, 20.0 g of sodium to the second sample, and so on (adding 70.0 g of sodium to the seventh sample). Sodium and chlorine react to form sodium chloride according to the equation 2Na(s)+Cl22NaCl(s) After each reaction is complete, you collect and measure the amount of sodium chloride formed. A graph of your results is shown below. Answer the following questions: a. Explain the shape of the graph. b. Calculate the mass of NaCl formed when 20.0 g of sodium is used. c. Calculate the mass of Cl2 in each container. d. Calculate the mass of NaCl formed when 50.0 g of sodium is used. e. Identify the leftover reactant, and determine its mass for parts b and d above.
You are making cookies and are missing a key ingredienteggs. You have most of the other ingredients needed to make the cookies, except you have only 1.33 cups of butter and no eggs. You note that the recipe calls for two cups of butter and three eggs (plus the other ingredients) to make six dozen cookies. You call a friend and have him bring you some eggs. a. What number of eggs do you need? b. If you use all the butter (and get enough eggs), what number of cookies will you make? Unfortunately, your friend hangs up before you tell him how many eggs you need. When he arrives, he has a surprise for you to save time, he has broken them all in a bowl for you. You ask him how many he brought, and he replies. I cant remember. You weigh the eggs and find that they weigh 62.1 g. Assuming that an average egg weighs 34.21 g. a. What quantity of butter is needed to react with all the eggs? b. What number of cookies can you make? c. Which will you have left over, eggs or butter? d. What quantity is left over?
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?