2. Using the value of standard Gibbs free energy change, AG°xn, predict thespontaneity of the following reaction at 25°C.2 HNO3 (1) + NO (g)AH°XN = - 71.66 kJ/mol3 NO2 (g)H2O (1)NO2 (g)H2O (0)HNO3 (1)NO (g)Substance155.6210.76240.0669.91AS°t (J/mol K)

The reaction is given as follows: 3NO2(g)+H2O(l)-------->2HNO3(l)+NO(g)

2. Using the value of standard Gibbs free energy change, AG°xn, predict the spontaneity of the following reaction at 25°C. 2 HNO3 (1) + NO (9) AH°xn = - 71.66 kJ/mol 3 NO2 (9) H2O (1) + NO2 (g) H2O () HNO3 (1) NO (9) Substance 69.91 155.6 210.76 AS°r (J/mol K) 240.06

2. Using the value of standard Gibbs free energy change, AG°xn, predict the spontaneity of the following reaction at 25°C. 2 HNO3 (1) + NO (9) AH°xn = - 71.66 kJ/mol 3 NO2 (9) H2O (1) + NO2 (g) H2O () HNO3 (1) NO (9) Substance 69.91 155.6 210.76 AS°r (J/mol K) 240.06

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter17: Chemcial Thermodynamics

Section: Chapter Questions

Problem 17.67QE: What is the sign of the standard Gibbs free-energy change at low temperatures and at high...

See similar textbooks

Related questions

Q: Calculate the standard entropy change ΔS° for the following reaction, using the tabulated standard…

A: Given, 2NO (g) + O2 (g) -> 2NO2 (g) S° NO (g) = 210.7 J/mol-K S° O2 (g) = 205.0 J/mol-K S° NO2…

Q: For a chemical reaction to be spontaneous at all temperatures in the reverse direction, which of the…

A: First option. ∆S° > 0, ∆H° < 0

Q: Sodium carbonate can be made by heating sodium bicarbonate:…

A: Standard free energy change, standard enthalpy and standard entropy have the following relationship.…

Q: Consider acetylene the balanced chemical equation for the combustion of 1 mole of acetylene gas…

A: Given Reaction is - C2H2 + (5/2) O2 ==> 2 CO2 +H2O Also given that - ∆H = 226.7 kJ/mol = 226700…

Q: 1. Rank the following from lowest to highest entropy. (a) CaH:s (1), CaHso(g), CaoHs (5) (b) Si (s),…

A: The correct answer about entropy is given below

Q: Calculate the standard entropy changes for the following reactions at 250C. 1. CaCO3(s) →CaO(s) +…

A: Given that - Temperature = 25°C = 273+25 = 298 K And, following Reactions are - 1. CaCO3(s)…

Q: about the Gibbs Free energy? Select one: a. It is positive for spontaneous reactions b. It has the…

A: 1) Gibbs energy is parameter to determine Spontaneity of process. So, correct statement is It the…

Q: Consider the oxidation of a generic metal M into a metal oxide as shown in the reaction. 3 M(s) +…

Q: 2H2S(g) + SO2(g) = 3S(s) + 2H2O(9) At 298 K, the standard enthalpy change, AH°, for the reaction…

A: “Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: For the reaction, 4KClO3(s) → 3KClO4(s) + KCl(s) Calculate ΔGosys for the process at 298 K if…

A: ∆Gsyso = ∆Hsyso - T ∆Ssyso where ∆Hsyso = Standard enthalpy change of system = - 144.3 KJ x…

Q: Consider the following reaction at constant P. Use the information here to determine the value of…

A: The formula used here is as follows: Calculations have been shown in the following step.

Q: The give reaction is C6H12O6 (s) + O₂(g) → CO₂ (g) + H₂O (1) Asrxnnxsº (products)->nxsº (reactants)…

Q: Consider the following reaction: N2(g) + 3H2(g) ⇄ 2NH3(g) A. When would this reaction be…

A: Reaction : N2(g) + 3H2(g) ⇄ 2NH3(g)…

Q: Predict the algebraic sign of the entropy change for the following reactions. a. PCl3 (g) + Cl2 (g)…

A: Entropy is a measure of degree of randomness of a reaction. The entropy of the substances follows…

Q: Examine each of the reactions in the multiple choices below and decide whether the entropy change…

A: If gaseous mole of product increases then reaction have positive entropy change if gaseous mole of…

Q: SO2(g)+2H2S(g) --> 3/8S8(s)+2H2O(g) at what temperature does the reaction become spontaneous?

A: Since the reaction becomes spontaneous when the net gibbs free energy change of the reaction becomes…

Q: Predict the sign of the entropy change of the system foreach of the following reactions:(a) N2(g) +…

A: We will answer first three subparts at a time since you have not mentioned the exact subparts that…

Q: Use the data given here to calculate the values of AGixn at 25 °C for the Compound AG; (kJ/mol)…

Q: Calculate the entropy change for the following reactions, using the tabulated standard molar…

A: Nitrogen oxide reacts with oxygen to form nitrogen dioxide, the equation for the balanced chemical…

Q: 9) Consider the following reaction FeO(s) + CO(g) → CO:(g) + Fe(s) AH = -11.0 kJ; AS = -17.4 J/K a)…

Q: Calculate Delta G^o for the following reaction at 25Celsius. What is k of reaction? What type of…

A: The reaction given is, => C2H4 (g) + O2 (g) → CO2 (g) + H2O (g)

Q: (a) Calculate AH° andAs° for the reaction below. Explain what each of the signs mean. N2(g) + 3…

Q: Consider the reaction: NH4Cl (s) → NH3 (g) + HCl (g) ArS 94.6 J K-¹mol-¹ A,H= 175.98 kJ/mol a)…

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Given the reference thermodynamic data below taken at 25°C, calculate the value of the equilibrium…

A: The reaction for given process is : N2(g) + 3H2(g) ⇌ 2NH3(g) Given that : ΔGº = -32.96 kJΔHº =…

Q: Consider the following reaction at 25 °C: 3 NiO(s) + 2 NH (g) →3 Ni(s) + N,(g) + 3 H,O(g) K If AH° =…

Q: Which of the following reactions will NOT be spontaneous at any temperature? (A) 2SO3(g)…

A: If Delta G is negative then reaction is spontaneous and if positive then reaction will never be…

Q: Which reaction below is spontaneous at low temperatures and nonspontaneous at high temperatures? O…

Q: Ribozomes in your body create proteins by combing amino acids together. What are the signs of AG,…

Q: Photosynthesis in plants converts carbon dioxide and water into glucose (C,H1206) and oxygen…

Q: waterand For the decomposition of hydrogen peroxide to H202(9) oxygen, → H20(g) + %02(g) AH = -106…

Q: Calculate the standard entropy change for the reaction at 25 °C. 2CH3OH(g)+3O2(g)⟶2CO2(g)+4H2O(g)…

A: The given balanced equation -

Q: At 298 K, the formation of ammonia has a negative So osys . 2N2(g) + 3H2(g) → 2NH3(g) Soosys = -…

Q: For a chemical reaction that is spontaneous at standard conditions, which of the following holds?…

Q: Predict the sign of the entropy change of the system for each of the following reactions: (a) N2(g)…

Q: Enter your answer in the provided box. Calculate the standard entropy change for the following…

Q: Use the data given here to calculate the values of AGixn at 25 °C for the reaction described by the…

A: Given A + B ⇔ C ∆Grxn0 = To be determined Compound ∆Gf0 (kJ/mole) A +387.7 B -596.8 C…

Q: C6H12O6(s)+ 6 02(g) 6 CO2(g) + 6 H2O(g) AS ran = +900. J/(mol,n K) Substance Approximate S (J/(mol…

A: We have to tell which option is correct

Q: For the reaction, A + B C, AH° = -40 kJ, and AS° = +80 J/K. Which of the following statements is…

A: Given: ∆H°=-40 kJ ∆S°=+80 J/K

Q: 1.With respect to the system only, a reaction with ΔH < 0 and ΔS < 0 is predicted to be ___________.…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: For the following reaction, calculate the a.ΔrxnH, b.ΔrxnS, c. ΔrxnG (25°C) of the following…

A: Given, H2 (g) + I2 (s) --> 2 HI (g) At 25 °C, the a.ΔrxnH, b.ΔrxnS, c. ΔrxnG is:

Q: Nitric oxide reacts with chlorine to form NOCI. The data refer to 298 K. 2NO(g) + Cl2(3) → 2NOC(g)…

A: The standard Gibb's free energy change of a reaction at 298 K can be calculated by the following…

Q: For a certain chemical reaction, the standard Gibbs free energy of reaction at 30.0°C is 73.3 kJ.…

A: To solve this problem we will use the given formula to calculate the equilibrium constant as given…

Q: Calculate the standard entropy change for the following reactions at 25 C. 2 Na (s) + 2 H2O (l) -->…

Q: Consider the following reaction at 25 * C : 2N2O (g) +O2(g) 4 NO (g) a. At equilibrium,…

A: The reaction given is 2 N2O (g) + O2 (g) ---------> 4 NO (g) a) The equilibrium constant for the…

Q: Which of the following statements is true? (a) The larger the Q, the larger the ∆G°. (b) If Q = 0,…

A: Spontaneous process is a natural process which occur in a finite period of time.

Q: Given the values of AH, ASa, and T, determine ASuniy and predict whether or not each reaction is…

Q: 1. 2NO(g) + O2(g)→ 2NO (g) DH° = -112 kJ/mol Absolute Entropy at 298 K (J/(K mol)) NO(9) 211 O2(9)…

A: The details solution for this is provided below in attach image.

Q: Calculate ΔSsurr at 25°C for the following reaction at constant pressure. Will the reaction be…

Q: Given: In principle, ethane gas can be obtained from the natural gas methane using the following…

A: The given reactions are : 2 CH4 (g) → C2H6 (g) + H2 (g) H2 (g) + ½ O2 (g) → H2O (g)

Q: 16. The standard enthalpy of vaporization of methanol is 35.2 kJ/mol at its normal boiling point,…

Question

2. Using the value of standard Gibbs free energy change, AG°xn, predict the
spontaneity of the following reaction at 25°C.
2 HNO3 (1) + NO (g)
AH°XN = - 71.66 kJ/mol
3 NO2 (g)
H2O (1)
NO2 (g)
H2O (0)
HNO3 (1)
NO (g)
Substance
155.6
210.76
240.06
69.91
AS°t (J/mol K)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is sulfur trioxide an important substance to study? (Hint: What happens when it combines with water?)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
For one day, keep a log of all the activities you undertake that consume Gibbs free energy. Distinguish betweenGibbs free energy provided by nutrient metabolism andthat provided by other energy resources.
Calculate the entropy change for the vaporization of liquid methane and liquid hexane using the following data. Boilling point (1atm) Hvap Methane 112K 8.20 KJ/mol Hexane 342K 28.9 KJ/mol Compare the molar volume of gaseous methane at 112 K with that of gaseous hexane at 342 K. How do the differences in molar volume affect the values of Svap for these liquids?
Explain why absolute entropies can be measured.
What types of experiments can be carried out to determine whether a reaction is spontaneous? Does spontaneity have any relationship to the final equilibrium position of a reaction? Explain.
The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
On the basis of your experience, predict which of the following reactions are spontaneous. (a) CO2(s)CO2(g) at 25°C (b) NaCl(s)NaCl(l) at 25°C (c) 2NaCl(s)2Na(s)+Cl2(g) (d) CO2(g)C(s)+O2(g)
In a spontaneous process, S(universe) is (a) 0 (b) = 0 (c) 0
Determine the standard Gibbs free energy change, rG, for the reactions of liquid methanol, of CO(g), and ofethyne, C2H2(g), with oxygen gas to form gaseous carbondioxide and (if hydrogen is present) liquid water at298 K. Use your calculations to decide which of thesesubstances are kinetically stable and which are thermodynamically stable: CH3OH(), CO(g), C2H9(g), CO2(g),H2O().