21.6 g of an acidic solution was mixed with 60.4 g of water in a calorimeter with a calorimeter constant of 73.7 J K-¹ with all substances initially at 56.7 °C. The resulting solution was observed to be at a temperature of 34.8 °C and have a heat capacity of 4.01 J g-¹ K-¹. Determine q for the mixing process. O a. 8820 J O b. 1.40 x 105 J O c. -1.40 x 105 J O d. -8820 J O e. 7200 J

21.6 g of an acidic solution was mixed with 60.4 g of water in a calorimeter with a calorimeter constant of 73.7 J K-¹ with all substances initially at 56.7 °C. The resulting solution was observed to be at a temperature of 34.8 °C and have a heat capacity of 4.01 J g-¹ K-¹. Determine q for the mixing process. O a. 8820 J O b. 1.40 x 105 J O c. -1.40 x 105 J O d. -8820 J O e. 7200 J

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter12: Thermodynamic Processes And Thermochemistry

Section: Chapter Questions

Problem 74AP

See similar textbooks

Similar questions

The enthalpy of combustion of solid carbon to form carbon dioxide is 393.7 KJ/mol carbon, and the enthalpy of combustion of carbon monoxide to form carbon dioxide is 283.3 KJ/mol CO. Use these data to calculate H for the reaction 2C(s)+O2(g)2CO(g)
Consider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.
When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
When 1.000 g of gaseous butane, C4H10, is burned at 25C and 1.00 atm pressure, H2O(l) and CO2(g) are formed with the evolution of 49.50 kJ of heat. a Calculate the molar enthalpy of formation of butane. (Use enthalpy of formation data for H2O and CO2.) b Gf of butane is 17.2 kJ/mol. What is G for the combustion of 1 mol butane? c From a and b, calculate S for the combustion of 1 mol butane.
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
How is the sign of q, heat, defined? How does it relate to the total energy of the system?
The statement Energycan beneithercreatednor destroyedis sometimes used as an equivalent statement of the first law of thermodynamics. There areinaccuracies to the statement, however. Restate it tomake it less inaccurate.
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
For the reaction BaCO3(s) BaO(s) + CO2(g), rG = +219.7 kJ/mol-rxn. Using this value and other data available in Appendix L, calculate the value of fG for BaCO3(s).
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
When a gas expands, what is the sign of w? Why? When a gas contracts, what is the sign of w? Why? What are the signs of q and w for the process of boiling water?