293) What is the value of ECELL (in V) for the following unbalanced reaction: Mg²+ (aq) + Al(s) ---> Mg (s) + A1³+ (aq) when it occurs at 25°C and the concentrations of the species are as follows: Mg2+] = 0.151 M A1³+] = 4.82 x 10-5 M The reduction potentials for the two half-reactions involved are: Mg2+ + 2 e---> Mg (s) (E°RED) = -2.37 V 1³+ + 3 e- --> Al (s) (E°RED) = -1.66 V Please give me four decimal places - if Canvas will allow - so that it is easier for me to award partial redit as appropriate).

293) What is the value of ECELL (in V) for the following unbalanced reaction: Mg²+ (aq) + Al(s) ---> Mg (s) + A1³+ (aq) when it occurs at 25°C and the concentrations of the species are as follows: Mg2+] = 0.151 M A1³+] = 4.82 x 10-5 M The reduction potentials for the two half-reactions involved are: Mg2+ + 2 e---> Mg (s) (E°RED) = -2.37 V 1³+ + 3 e- --> Al (s) (E°RED) = -1.66 V Please give me four decimal places - if Canvas will allow - so that it is easier for me to award partial redit as appropriate).

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 24Q: What is wrong with the following statement: The best concentration cell will consist of the...

See similar textbooks

Similar questions

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
The cell Ag|AgCl(sat’d)||H+(a = x)|glass electrode has a potential of —0.2094 V when the solution in the right-hand compartment is a buffer of pH 4.006. The following potentials are obtained when the buffer is replaced with unknowns: (a) —0.2806 V and (b) —0.2132 V. Calculate the pH and the hydrogen ion activity of each unknown. (c) Assuming anuncertainty of 0.001 Vin the junction potential, what is the range of hydrogen ion activities withinwhich the true value might be expected to lie?
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
For the following half-reaction, = 2.07 V: A1F63(aq)+3eAl(s)+6F(aq) Using data from Table 17-1, calculate the equilibrium constant at 25C for the reaction A13+(aq)+6F(aq)A1F63(aq)K=?
An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a pH meter at 25 00C is given by the equation where contains the potential of the reference electrode and all other potentials that arise in the cell that are not related to the hydrogen ion concentration. Assume that = 0.250 V and that a. What is the uncertainty in the values of pH and [H+] if the uncertainty in the measured potential is 1 m V ( 0.001 V)? b. To what precision must the potential be measured for the uncertainty in pH to be 0.02 pH unit?
What is wrong with the following statement: The best concentration cell will consist of the substance having the most positive standard reduction potential. What drives a concentration cell to produce a large voltage?