3 C(s) + 4 H2 (g) --> (Q14) Find AHrxn (in kJ) for the formation of propane from its elements: C3H8 (g) Use the following reactions with known enthalpy changes (4 sf): (A) C3H8 (g) + 5 O2 (g) --> 3 CO2 + 4 H2O (g) AHrxn = -2043.0 kJ (B) C (s) + O2 (g) --> CO2 (g) AHrxn = -393.5 kJ (C) 2 H2 (g) + O2 (g) --> 2 H2O (g) AHxn = -483.6 kJ

3 C(s) + 4 H2 (g) --> (Q14) Find AHrxn (in kJ) for the formation of propane from its elements: C3H8 (g) Use the following reactions with known enthalpy changes (4 sf): (A) C3H8 (g) + 5 O2 (g) --> 3 CO2 + 4 H2O (g) AHrxn = -2043.0 kJ (B) C (s) + O2 (g) --> CO2 (g) AHrxn = -393.5 kJ (C) 2 H2 (g) + O2 (g) --> 2 H2O (g) AHxn = -483.6 kJ

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter5: Thermochemistry

Section: Chapter Questions

Problem 5.34QE

See similar textbooks

Similar questions

In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
Benzoic acid, C6H5COOH, is a common standard used in bomb calorimeters, which maintain a constant volume. If 1.20 g of benzoic acid gives off 31, 723 J of energy when burned in the presence of excess oxygen and in a water bath having a temperature of 24.6 C, calculate q, w, H, and U for the reaction.
In a coffee-cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M HCI are mixed. Both solutions were originally at 24.6C. After the reaction, the final temperature is 31.3C. Assuming that all the solutions have a density of 1.0 g/cm3 and a specific heat capacity of 4.18 J/Cg, calculate the enthalpy change for the neutralization of HCl by NaOH. Assume that no heat is lost to the surroundings or to the calorimeter.
sample of natural gas is analyzed and found to be88.4% methane (CH4) and 11.6% ethane (C2H6) bymass. The standard enthalpy of combustion of methaneto gaseous carbon dioxide (CO2) and liquid water (H2O) is -891 kJ/mol. Write the equation for the combustionof gaseous ethane to carbon dioxide and water.Calculate the standard enthalpy of combustion of ethaneusing standard enthalpies of formation from Table R-11on page 975. Using that result and the standard enthalpyof combustion of methane in Table 15.3, calculate theenergy released by the combustion of 1 kg of natural gas.
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
Write reactions for which the enthalpy change will be a. Hf for solid aluminum oxide. b. the standard enthalpy of combustion of liquid ethanol, C2H5OH(l). c. the standard enthalpy of neutralization of sodium hydroxide solution by hydrochloric acid. d. Hf for gaseous vinyl chloride, C2H3Cl(g). e. the enthalpy of combustion of liquid benzene, C6H6(l). f. the enthalpy of solution of solid ammonium bromide.
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
The octane number of gasoline is based on a comparison of the gasolines behavior with that of 2,2,4-trimethylpentane, C8H18(), which is arbitrarily assigned an octane number of 100. The standard enthalpy of combustion of this compound is 5456.6 kJ/mol. (a) Write the thermochemical equation for the combustion of 2,2,4-trimethylpentane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of 2,2,4-trimethylpentane.