1. The time for effusion of hydrogen gas and Gas A was obtained in theexperiment of determining the molar mass of Gas A by effusion. Determine themolar mass of Gas A from the data recorded in table below."2.4Time foreffusion of10710910710.710750cm3hydrogen gasisTime foreffusion of 5031330 9310321313em3 Gas AO A. 17.3 g/molO B. 12.8 g/molO C. 22.4 g/molO D. 13.4 g/mol2. Predict the identity of Gas A in question 1 above if gas A consists only C and H.O A. etheneO B. ethaneO C. methaneD. propene 3. Select the correct statement from the following choices that best explain theresult recorded in the table as shown in question 1.O A The ratio of the effusion rate of hydrogen gas to that of methane gas is 3:20B The molar mass obtained from experimentmass of the gas Alawer than that of the actual molarC The molar mass obtained is different from the actual molar mass of Gas A due toThe presence of impuritiesO D. The imnpurities presence might tiave the molar mass that is smaller than Gas A4. What difference would you expect on the time of effusion and molar mass ofgas A If the experiment were carried out using the same apparatus at a highertemperature.A. At a higher temperature, gan moleculen move more rapidiy and effusion time wouldtherefore longerO B. At high temperature, the molar mass of gas A obtained would be lowerO C At high temperature. the ratio of effusion rate of hydrogen to gas A would be higherO. At higher temperature, there is no change on thie effusion rate of hydrogen gas tothat of gas A

Since, you have asked multiple questions, we are solving first question for you. For remaining…

3. Select the correct statement from the following choices that best explain the result recorded in the table as shown in question 1. O A The ratio of the effusion rate of hydrogen gas to that of methane gas is 3.20 B The molar mass obtained from experiment is lower than that of the actual molar mass of the gas A C. The molar mass obtained is different from the actual motar mass of Gas A due to the presence of impurities O D. The impurities presence might have the molar mass that is smaller than Gas A 4. What difference would you expect on the time of effusion and molar mass of gas Aif the experiment wvere carried out using the same apparatus at a higher temperature. A. At a higher temperature, gas molecules move inore rapidiy and effusion time would therefore longer B. At high temperature, the molar mass of gas A obtaned would be lower CAt high temperature, the ratio of effusion rate of hydrogen to gas A would be higher 0 At higher temperature, there is no change on the effusion rate of hydrogen gas to that of gas A

3. Select the correct statement from the following choices that best explain the result recorded in the table as shown in question 1. O A The ratio of the effusion rate of hydrogen gas to that of methane gas is 3.20 B The molar mass obtained from experiment is lower than that of the actual molar mass of the gas A C. The molar mass obtained is different from the actual motar mass of Gas A due to the presence of impurities O D. The impurities presence might have the molar mass that is smaller than Gas A 4. What difference would you expect on the time of effusion and molar mass of gas Aif the experiment wvere carried out using the same apparatus at a higher temperature. A. At a higher temperature, gas molecules move inore rapidiy and effusion time would therefore longer B. At high temperature, the molar mass of gas A obtaned would be lower CAt high temperature, the ratio of effusion rate of hydrogen to gas A would be higher 0 At higher temperature, there is no change on the effusion rate of hydrogen gas to that of gas A

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter5: Gases

Section: Chapter Questions

Problem 27QAP: The gas in the discharge cell of a laser contains (in mole percent) 11% CO2, 5.3% N2, and 84% He....

See similar textbooks

Similar questions

The gas in the discharge cell of a laser contains (in mole percent) 11% CO2, 5.3% N2, and 84% He. (a) What is the molar mass of this mixture? (b) Calculate the density of this gas mixture at 32C and 758 mm Hg. (c) What is the ratio of the density of this gas to that of air (MM=29.0g/mol)at the same conditions?
The atmospheric surface pressure on Venus is 90 bar and is composed of 96 carbon dioxide and approximately 4 various other gases. Given a surface temperature of 730 K, what is the mass of carbon dioxide present per cubic centimeter at the surface?
One method of analyzing amino acids is the van Slyke method. The characteristic amino groups (NH2) in protein material are allowed to react with nitrous acid. HNO2, to form N2 gas. From the volume of the gas, the amount of amino acid can be determined. A 0.0604-g sample of a biological sample containing glycine, CH2(NH2)COOH, was analyzed by the van Slyke method and yielded 3.70 mL of N2 collected over water at a pressure of 735 torr and 29 C. What was the percentage of glycine in the sample? CH2(NH2)CO2H+HNO2CH2(OH)CO2H+H2O+N2
The second virial coefficient B and the third viral coefficient C for Ar are -0.021 L/mol and 0.0012 L2/mol2 at 273 K, respectively. By what percentage does the compressibility change when you include the third virial term?
Methane (CH4) gas flows into a combustion chamber at a rate of 200. L/min at 1.50 atm and ambient temperature. Air is added to the chamber at 1.00 atm and the same temperature, and the gases are ignited. a. To ensure complete combustion of CH4 to CO2(g) and H2O(g), three times as much oxygen as is necessary is reacted. Assuming air is 21 mole percent O2 and 79 mole percent N2, calculate the flow rate of air necessary to deliver the required amount of oxygen. b. Under the conditions in part a, combustion of methane was not complete as a mixture of CO2(g) and CO(g) was produced. It was determined that 95.0% of the carbon in the exhaust gas was present in CO2. The remainder was present as carbon in CO. Calculate the composition of the exhaust gas in terms of mole fraction of CO, CO2, O2, N2, and H2O. Assume CH4 is completely reacted and N2 is unreacted.
The compression ratio in an automobile engine is the ratio of the gas pressure at the end of the compression stroke to the pressure in the beginning. Assume that compression occurs at constant temperature. The total volume of the cylinder in an automobile is 350 cm3, and the displacement the reduction in volume during the compression stroke is 309 cm3. What is the compression ratio in that engine?
5-54 Automobile air bags are inflated by nitrogen gas. When a significant collision occurs, an electronic sensor triggers the decomposition of sodium azide to form nitrogen gas and sodium metal. The nitrogen gas then inflates nylon bags, which protect the driver and front-seat passenger from impact with the dashboard and windshield. What volume of nitrogen gas measured at 1 atm and 27°C is formed by the decomposition of 100. g of sodium azide?
49 mL of a gas are collected over water at 748 mm Hg and 298 K. If the vapor pressure of water at that temperature is 29 mm Hg, how many moles of the gas generated from the reaction were collected? (Express your answer using exponential notation (ex. 1.23e-3, or 1.23e3) to 3 significant figures, and don't round any calculations along the way!) moles
The gas in the discharge cell of a laser contains (in mole percent) 11% CO2, 5.3% N2, and 84% He. (a) What is the molar mass of this mixture? (b) Calculate the density of this gas mixture at 328C and 758 mm Hg. (c) What is the ratio of the density of this gas to that of air (MM air = 29.0 g/mol) at the same conditions
Ammonia gas (A) diffuses through a stagnant gas mixture consisting of one-third Nitrogen (B) and two thirds Hydrogen (C) by volume. The total pressure is 206.8 kN/m2 and the temperature is 540c.Calculate the rate of diffusion of Ammonia through a film of gas 0.5mm thick when the concentration change across the film is 10% to 5% by volume. The diffusivities at 200 0 c and one std. atm.pressure are reported to be DAB = 5.391 x 10 -4 m2 /s and DAC = 1.7371 x 10 -4 m2 /s.
An experiment is conducted in which a quantity of H2(g) is chemically generated in a closed headspace of volume V1 at absolute temperature T1, thereby raising the total pressure from Pa (the initial air pressure) to Pf (the total final pressure of H2(g) + air). Compose an algebraic expression for the volume (V2) that this sample of H2(g) would occupy if it were isolated (pure -- i.e. no air) at absolute temperature T2 and partial pressure P2. Note that your expression may contain no other variables than those given above, namely: V1, T1, T2, Pa, Pf, and P2. A) V2 = Now, suppose that the above experiment generated n mol of H2(g), that T2 = 0 °C and that P2 = 1 atm. Give the simple algebraic expression, in terms of V2 and n, which equates to the molar volume of H2(g) at STP. B) VM =
An experiment is conducted in which a quantity of H2(g) is chemically generated in a closed headspace of volume V1 at absolute temperature T1, thereby raising the total pressure from Pa (the initial air pressure) to Pf (the total final pressure of H2(g) + air).Compose an algebraic expression for the volume (V2) that this sample of H2(g) would occupy if it were isolated (pure -- i.e. no air) at absolute temperature T2 and partial pressure P2.Note that your expression may contain no other variables than those given above, namely: V1, T1, T2, Pa, Pf, and P2. V2 = Now, suppose that the above experiment generated n mol of H2(g), that T2 = 0 °C and that P2 = 1 atm. Give the simple algebraic expression, in terms of V2 and n, which equates to the molar volume of H2(g) at STP.VM = 8.829×10-4 mol of B2H6(g) (diborane gas) is generated into a 176.0 mL headspace, at 25.0 °C, thus increasing the pressure by 0.1209 atm. If we assume that the diborane gas obeys Boyle's Law and Charle's Law, what…