Thank you. 4 Fe + 3 O2 → 2 Fe,O313. How many grams of Fe,O3 are produced when 42.7 grams of Fe is reacted?42.7 g Femol Femol Fe2O3g Fe2O3g Fe2O3%3Dg Femol Femol Fe,O314. How many grams of Fe,O; are produced when 17.0 grams of O, is reacted?17.0 g O2g Fe,O315. How many grams of O2 are needed to react with 125 grams of Fe?

Answered: Image /qna-images/answer/ffe2ec46-0f09-4a52-8b61-4bd3c536ee54.jpg

Answered: 4 Fe + 3 O2 → 2 Fe¿O3 13. How many…

4 Fe + 3 O2 → 2 Fe¿O3 13. How many grams of Fe,O; are produced when 42.7 grams of Fe is reacted? 42.7 g Fe mol Fe mol Fe,O3 g Fe,O3 g Fe2O3 %3D g Fe mol Fe mol Fe O3

General, Organic, and Biological Chemistry

7th Edition

ISBN:9781285853918

Author:H. Stephen Stoker

Publisher:H. Stephen Stoker

Chapter6: Chemical Calculations: Formula Masses, Moles, And Chemical Equations

Section: Chapter Questions

Problem 6.84EP: In an experiment designed to produce calcium oxide by the chemical reaction 2Ca + O2 2CaO 177.2 g...

See similar textbooks

Related questions

Q: how many grams of water is produced when 1.22*10^33 molecules of sodium hydroxide are reacted with…

Q: A student reacts 832 mL of 5.43 M NazCO3 with excess AICI, in the lab, according to the balanced…

A: Answer: the percent yield for her experiment is 47.68%

Q: 2 NH3 + 3 CuO --> 3 Cu + N2 + 3 H2O In the above equation how many moles of N2 can be made when…

A: Given : Mass of CuO = 179.9 grams Also , molar mass of CuO = 79.5 gm/mol

Q: Given the unbalanced equation, Cr(NO3)3(aq) + LiOH(aq) → LiNO3(aq) + Cr(OH)3(s), how many…

A: The following unbalanced reaction can be balanced as follows: By the given reaction it is clear…

Q: Consider the reaction 2D2(g)+O2(g)→2D2O(l)2D2(g)+O2(g)→2D2O(l) What is the mass of heavy water,…

A: Given: Mass of O2(g) = 8.75 g Known: Molar mass of O2(g) = 32 g/mol Molar mass of D2O(l) = 20.03…

Q: How many moles of methane are produced when 85.1 molesmoles of carbon dioxide gas react with excess…

A: Number of moles of any substance is the ratio of mass of the substance to the molar mass of that…

Q: Consider the following reaction: Mg(OH)2(aq) + 2 HNO3(aq) --> Mg(NO3)2(aq) + 2 H2O(l)…

A: Number of mol = Mass/Molar mass % Yield = 100 x Obtained amount/Calculated amount

Q: "In our bodies, sugar is broken down with oxygen to produce water and carbon dioxide." According to…

A: The answer to the first question is given below

Q: N2 + 3H2 ---> 2NH3 How many molecules of ammonia are produced from the reaction of 9.5 x 1023…

A: Nitrogen reacts with hydrogen to form ammonia. The equation for the balanced chemical reaction is…

Q: What mass of CaSO4 is produced according to the givenequation when 5.00 g of each reactant are…

A: By mass-mass relation: 78 g of CaF2 reacts with 98 g of H2SO4. So, H2SO4 will be limiting reagent…

Q: CaCl2 + Na2CO3 ---> Given 74.3 g of CaCl2 and 5.94 x 1023 formula units of Na2CO3 , how may…

A: Number of moles of a chemical compound is used to measure the amount of the compound in a mixture or…

Q: For the reaction shown, calculate how many moles of NH3 form when each amount of reactant completely…

A: Mole to mole RelationshipIn these problems, the moles of one ofthe Reactant/Products is to be…

Q: CaCO3 + 2H3PO4 ---> Ca3(PO4)2 + 3H2CO3 a. When 8.38 grams of each reactant is used, calculate the…

A: in balanced equation number of atoms of each species are equal on both reactant and products side

Q: Use 1 decimal point for all atomic masses. 82.1 g of Ni3C(s) are reacted with 1.80 g of H2(g) by the…

A: The reaction given is Ni3C(s) + 2H2(g) --> 3Ni(s) + CH4(g) Since mass of Ni3C taken = 82.1 g And…

Q: CaCl2 + Na2CO3 ---> Given 74.3 g of CaCl2 and 5.94 x 1023 formula units of Na2CO3 , how may…

Q: how many g of Fe2O3 will you obtain from reacting 14.4 g FeS2 and 13.0 g of O2? When rounding…

Q: A 3.82-g sample of magnesium nitride is reacted with 7.73 g of water.…

A: The balanced reaction taking place is given as, => Mg3N2 + 3 H2O → 2 NH3 + 3 MgO Given: Mass of…

Q: For the reaction, calculate how many grams of the product form when 21.4 g of Ca completely reacts.…

A: Since you have asked a question with multiple subparts we will solve the first 3 subparts . If you…

Q: Consider the balanced chemical reaction below. How many grams of C6H;Br are produced if 30.0 g of…

Q: How many grams of carbon dioxide will react to produce 1.51 x 1023 molecules of H2CO3?…

A: The given equation is as follows. CO2+H2O→H2CO3 This is a balanced equation. So the ratio between…

Q: What is the maximum mass of S8 that can be produced by combining 76.0 g of each reactant?…

A: The given data contains, mass = 76 g.

Q: What mass of CO is required to react with 25.13 g of Fe2O3 according to the equation Fe2O3 + 3CO…

A: Given Reaction Fe2O3 + 3CO → 2Fe + 3CO2 Mass of Fe2O3 = 25.13 gram Mass of CO = ?

Q: calculate the masses of both reactants and products assuming a 100% reaction. Na3PO3 +…

A: Stoichiometry, in balanced chemical reaction is defined by the ratio at which reactants are reacting…

Q: According to the following reaction, how many grams of carbon dioxide will be formed upon the…

A: According to law of conservation of mass ,sum of masses of reactant is equal to sum of masses of…

Q: Consider the following unbalanced reaction: P4(s) + F2(g) ---> PF3(g) How…

A: The reaction is unbalanced first we have to write a balanced reaction Given data : 78.1% yield…

Q: Determine the number of grams of HCl that can react with 0.750 grams of Al(OH)3 according to the…

Q: For the reaction AlCl3 + Na2SO4 --> Al2(SO4)3 + NaCl…

A: Given For the reaction AlCl3 + Na2SO4 --> Al2(SO4)3 + NaCl…

Q: In the following reaction, identify the limiting reactant: C3H8 (g) + 5 O2 (g) → CO2 (g) + 2 H2O…

A: Given Reaction C3H8(g) + 5 O2(g) → CO2(g) + 2 H2O(g) Number of mole of C3H8 = 1 mole Number…

Q: The theoretical yield of a reaction is the amount of product obtained if the limiting reactant is…

Q: If 10.0 grams of C4H10 are mixed with 16.0 grams of O₂ according to the following reaction, how many…

A: Given, 2C4H10(g) + 13O2(g) → 8CO2(g) + 10H2O(g) mass of C4H10 reacts = 10.0 g mass of O2 reacts =…

Q: The combustion of propane occurs through the following chemical reaction.…

Q: Consider the following chemical reaction HCl (aq) + HgNO3 (aq) -> HgCl2 (s) + HNO3 (aq) If 20.0…

A: Detailed solution of your question is given below :

Q: Ammonium nitrate has been used as a high explosive because it is unstable and decomposes into…

A: This can be solved by gram molar mass concept. Balanced reaction is as follows: 2NH4NO3(s)…

Q: For the reaction shown, calculate how many moles of NH3NH3 form when each amount of reactant…

A: The balanced reaction taking place is given as, => 3 N2H4 (l) -------> 4 NH3 (g) + N2 (g)

Q: Base on the following chemical equation: NH3(g) + F2(g) ---> N2F4(g) + HF(g) 1. How many grams of…

Q: A student performs the following reaction: CaF2 + H2SO4 --> 2HF + CaSO4 If he starts with 25 grams…

A: Number of mols = mass/molar mass CaF2…

Q: Under certain circumstances, carbon dioxide, CO2(g)CO2(g), can be made to react with hydrogen gas,…

A: 1) Since from the balanced reaction we can see, 1 moles of CO2 reacts to form 1 mole of methane i.e…

Q: A. What is the mass of CO2 produced when 15.2 g of O2 reacts with 13.0 g of C7H12? C7H12 (l) + 10 O2…

A: The given balanced equation is: C7H12 (l) + 10 O2 (g) ----> 7CO2 (g) + 6 H2O(g) Given the mass…

Q: Gaseous butane (CH;(CH2) CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Butane reacts with oxygen to form carbon dioxide and water. The equation for the balanced chemical…

Q: CaCl2 + Na2CO3 ---> Given 74.3 g of CaCl2 and 5.94 x 1023 formula units of Na2CO3 , how may…

Q: MgO are produced when 35.0 grams of O2 react completely with Mg?

A: The reaction is: Molecular weight of 2Mg = 24.3g/mol. Molecular weight of oxygen = 32g/mol.…

Q: Sodium hydroxide reacts with carbon dioxide as follows: 2NaOH(s)+CO2(g)→Na2CO3(s)+H2O(l) How many…

A: Balanced reaction: A chemical reaction is said to be balanced when all number of atom at reactant…

Q: A 3.82-g sample of magnesium nitride is reacted with 7.73 g of water. Mg3N2 + 3H20 –→ 2NH3 + 3M9O…

Q: For the reaction shown, calculate how many moles of each product form when the given amount of each…

A: Given, moles of C3H8 = 4.6 moles Other reactant O2 is present in excess. To calculate: Number of…

Q: When 30.0 g of MgCl2 and 30.0 g of Na2CO3 are reacted MgCl2 + NazCO3 MgCO3 + 2 NaCI the limiting…

Q: l2O5+5CO 5CO2+l2 80.0 g of iodine (V) oxide reacts with 28.0 g of carbon monoxide what is the…

Q: A) For the reaction Ca(s)+Cl CL2(g)→CaCl2(s) calculate how many grams of the product form when 14.4…

Q: 18 g of CH4(g) are reacted with 5.2 g of O2(g) by the following reaction CH4(g) + 2O2(g) -->…

A: In given reaction, the reactant molecule available in large amount is basically "excess reactant".…

Q: For the reaction shown, calculate how many moles of each product form when the given amount of each…

A: In a chemical reaction, it is the limiting reactant and not the excess reactant that decided the…

Question

Thank you.

4 Fe + 3 O2 → 2 Fe,O3
13. How many grams of Fe,O3 are produced when 42.7 grams of Fe is reacted?
42.7 g Fe
mol Fe
mol Fe2O3
g Fe2O3
g Fe2O3
%3D
g Fe
mol Fe
mol Fe,O3
14. How many grams of Fe,O; are produced when 17.0 grams of O, is reacted?
17.0 g O2
g Fe,O3
15. How many grams of O2 are needed to react with 125 grams of Fe?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Analysis

VIEW

Calculation

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Types of Polymers on the Basis of Physical Properties

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A compound contains only carbon, hydrogen, nitrogen, and oxygen. Combustion of 0.157 g of the compound produced 0.213 g CO2 and 0.0310 g H2O. In another experiment, it is found that 0.103 g of the compound produces 0.0230 g NH3. What is the empirical formula of the compound? Hint: Combustion involves reacting with excess O2. Assume that all the carbon ends up in CO2 and all the hydrogen ends up in H2O. Also assume that all the nitrogen ends up in the NH3 in the second experiment.
In an experiment designed to produce calcium oxide by the chemical reaction 2Ca + O2 2CaO 177.2 g of CaO was obtained out of a possible 203.9 g ofCaO. a. What is the theoretical yield of CaO? b. What is the actual yield of CaO? c. What is the percent yield of CaO?
Silver sulfadiazine burn-treating cream creates a barrier against bacterial invasion and releases antimicrobial agents directly into the wound. If 23.8 g of Ag2O is reacted with 47.6 g of C10H10N4SO2, what mass of silver sulfadiazine, AgC10H9N4SO2, can be produced, assuming 100% yield? Ag2O(s) + 2 C10H10N4SO2(s) → 2 AgC10H9N4SO2(s) + H2O(l)
5. KO2 is used in a closed-system breathing apparatus. It removes carbon dioxide and water from exhaled air. The reaction for the removal of water is: KO2 + H2O O2 + KOH. The KOH produced is used to remove carbon dioxide by the following reaction: KOH + CO2 KHCO3. a. What mass of KO2 produces 235 g of O2?b. What mass of CO2 can be removed by 123 g of KO2?
Ethyl alcohol (C2H5OH), also called grain alcohol, can be made by the fermentation of glucose: C6H12O6→ 2 C2H5OH + 2 CO2If a 84.6% yield of ethyl alcohol is obtained, What mass of ethyl alcohol will be produced from 750 g of glucose? What mass (in kg) of glucose should be used to produce 475 g of C2H5OH?
The compound HgO can be decomposed to form Hg and O2. This can be represented at the atomic level by a chemical equation: 2HgO ---> 2Hg+ O2 According to the law of conservation of mass, if 31.8 grams of HgO decomposes and 29.5 grams of Hg is formed, how many grams of O2 must simultaneously be formed? _____ grams O2 The compound BrCl can be formed by combining Br2 and Cl2. This can be represented at the atomic level by a chemical equation: Br2+ Cl2 ----->2BrCl According to the law of conservation of mass, if 29.5 grams of Br2 and 13.1 grams of Cl2 combine to form BrCl, how many grams of BrCl must form? ______ grams BrCl
Photosynthesis is the process by which plants synthesize glucose from carbon dioxide and water. The overall reaction is: 6CO2(g)+6H2O(g)⟶C6H12O6(s)+6O2(g)6CO2(g)+6H2O(g)⟶C6H12O6(s)+6O2(g) How many grams of glucose can be made from 40.65 grams of carbon dioxide?
2C8H18 (l) + 25O2 (g) --> 16CO2 (g) + 18H2O (g) The above reaction is the reaction for gasoline (C8H18) in a typical internal combustion engine. How many grams of carbon dioxide are produced from 571.8 grams of gasoline?
Ammonia can also be synthesized by the reaction: 3H2(g)+N2(g)→2NH3(g)3H2(g)+N2(g)→2NH3(g) What is the theoretical yield of ammonia, in kilograms, that we can synthesize from 5.22 kgkg of H2H2 and 33.6 kgkg of N2N2?
One way of commercially producing methanol involves the following reaction: CO (g) + 2 H2 (g) ⇌ CH3OH (g) 1. How many grams of CO does it need to react with 4 moles of H2? 2. How many moles of CO is needed to create 1.81 ×1024 molecules of methanol? 3. How many grams of methanol is produced with 28.01 g of CO?
Hydrazine (N2H4) and hyfrogen peroxide (H2O2) have been used as rockets propellants. They react according to the following equiation. 7H2O2 + N2H4 --> 2HNO3 + 8H2O a) When 76 kg of hydrazine react, hoe many grams of nitric acid can be formed? b)When 289 mL of hydrogen peroxide (d= 1.41 g/mL) recat, how many grams of water can be formed? c)how many grams of hydrinaze will be required to react with 765 g of hydrogen peroxide? d)How many grams of water can be produced when 204 g hydrazine combined with 175 g hydrogen peroxide? e) How many of the exceess reactant in part (d) are left unreacted?
Carbon dioxide gas, CO2(g)CO2(g) , produced in the combustion of a sample of ethane is absorbed in Ba(OH)2(aq)Ba(OH)2(aq), producing 0.672 gg BaCO3(s)BaCO3(s). How many grams of ethane (C2H6)(C2H6) must have been burned?C2H6(g)+O2(g)→CO2(g)+H2O(l)C2H6(g)+O2(g)→CO2(g)+H2O(l) (not balanced)CO2(g)+Ba(OH)2(aq)→BaCO3(s)+H2O(l)CO2(g)+Ba(OH)2(aq)→BaCO3(s)+H2O(l) (not balanced) Express your answer with the appropriate units.