4. F An important reaction in the production of sulfuric acid is the formation of sulfur trioxide gas.2S02 (g) + O2 (g)2SO3 (g)A) Using the AH; values to calculate the enthalpy change for the reaction. Is the reactionendothermic or exothermic?B) What quantity of thermal energy (heat) is transferred when 40.0 g of SO2 and 50.0 g of O2react?C) Using the information from (b) determine the volume of SO3 gas obtained at STP.D) Using the information from (b) what is the actual yield of SO3 in grams if the percent of yieldof the reaction is only 85.0%?E) For a different experiment, determine the volume of air necessary for the combustion of 40.0 g ofSO2, assuming that air is 21.0% O2 by volume? Enthalpies of formation, kJ/mol at 25°C, 1 atm:Al,O3(s)-1675.7CO(g)-110.5NH3(g)-46.11B2H,(g)36CO2(g)-393.5NHẠNO3(s)-365.6-1272.8-272.082.05B2O3(s)FeO(s)N20(g)-558Fe,O3(s)-824.290.25BaQ(s)NO(g)-147313533.18BaSO4(s)HCN(g)NO2(g)-74.81-241.8-411.1H2O(g)CH4(g)NaCl(s)-135.4-285.9573.64CCL4(E)H2O({)Nal(s)-132-291.9-287.8H,O(s)SO2(g)CHC13(t)226.7-92.31-296.852.26HC/(g)-20.6SO3(g)-395.7CH2(g)-84.68H,S(g)62.43SiO2(s)-903.5CH4(g)49.03I(g)50.63SİH4(g)C,H,(g)N,H4(E)CgH,(t)

Since you have posted a question with multiple sub-parts, we will solve first three subpartsfor you.…

4. - An important reaction in the production of sulfuric acid is the formation of sulfur trioxide gas. 2SO2 (g) + 02 (g) 2SO3 (g) A) Using the AH; values to calculate the enthalpy change for the reaction. Is the reaction endothermic or exothermic? B) What quantity of thermal energy (heat) is transferred when 40.0 g of SO2 and 50.0 g of O2 react? C) Using the information from (b) determine the volume of SO3 gas obtained at STP.

4. - An important reaction in the production of sulfuric acid is the formation of sulfur trioxide gas. 2SO2 (g) + 02 (g) 2SO3 (g) A) Using the AH; values to calculate the enthalpy change for the reaction. Is the reaction endothermic or exothermic? B) What quantity of thermal energy (heat) is transferred when 40.0 g of SO2 and 50.0 g of O2 react? C) Using the information from (b) determine the volume of SO3 gas obtained at STP.

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter10: Energy

Section: Chapter Questions

Problem 3STP

See similar textbooks

Similar questions

The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.
sample of natural gas is analyzed and found to be88.4% methane (CH4) and 11.6% ethane (C2H6) bymass. The standard enthalpy of combustion of methaneto gaseous carbon dioxide (CO2) and liquid water (H2O) is -891 kJ/mol. Write the equation for the combustionof gaseous ethane to carbon dioxide and water.Calculate the standard enthalpy of combustion of ethaneusing standard enthalpies of formation from Table R-11on page 975. Using that result and the standard enthalpyof combustion of methane in Table 15.3, calculate theenergy released by the combustion of 1 kg of natural gas.
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
Calculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.
The enthalpy of combustion of solid carbon to form carbon dioxide is 393.7 KJ/mol carbon, and the enthalpy of combustion of carbon monoxide to form carbon dioxide is 283.3 KJ/mol CO. Use these data to calculate H for the reaction 2C(s)+O2(g)2CO(g)
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
One of the components of jet engine fuel is n-dodecane, C12H26(), which has a standard enthalpy of combustion of 8080.1 kJ/mol. (a) Write the thermochemical equation for the combustion of n-dodecane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of n-dodecane.
At 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?