7.1 Enter electrons as e A voltaic cell is constructed from a standard H*H, half cell (E°,red = 0.000V) and a standard F2 F half cell (E°red= 2.870V). (Use the lowest possible coefficients. Use the pull-down boxes to specify states such as (aq) or (s). If a box is not needed, leave it blank.) The anode reaction is: The cathode reaction is: The spontaneous cell reaction is: + The cell voltage is V. 1 +

7.1 Enter electrons as e A voltaic cell is constructed from a standard H*H, half cell (E°,red = 0.000V) and a standard F2 F half cell (E°red= 2.870V). (Use the lowest possible coefficients. Use the pull-down boxes to specify states such as (aq) or (s). If a box is not needed, leave it blank.) The anode reaction is: The cathode reaction is: The spontaneous cell reaction is: + The cell voltage is V. 1 +

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 83AP

See similar textbooks

Similar questions

Why would a sacrificial anode made of lithium metal be a bad choice despite its ELi+/Li=2.07V, which appears to be able to protect all the other metals listed in the standard reduction potential table?
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Suppose Ered for H+H2 were taken to be 0.300 V instead of 0.000 V. What would be (a) Eox for H2H+ ? (b) Ered for Br2Br ? (c) E for the cell in 34(c)? Compare your answer with that obtained in 34(c).
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Consider a voltaic cell in which the following reaction takes place in basic medium at 25°C. 2NO3-(aq)+3S2(aq)+4H2O3S(s)+2NO(g)+8OH(aq) (a) Calculate E°. (b) Write the Nernst equation for the cell E. (c) Calculate E under the following conditions: PNO=0.994atm,ph=13.7,[S2]=0.154M,[NO3-]=0.472M, .
A galvanic cell is based on the following half-reactions at 25C: Ag++eAg H2O2+2H++2e2H2O Predict whether is larger or smaller than for the following cases. a. [Ag+]=1.0M,[H2O2]=2.0M,[H+]=2.0M b. [Ag+]=2.0M,[H2O2]=1.0M,[H+]=1.0107M
Determine the standard cell potential and the cell potential under the stated conditions for the electrochemical reactions described here. State whether each is spontaneous or nonspontaueous under each set of conditions at 293.15 K. (a) Hg(l)+S2(aq,0.10M)+2Ag+(aq,0.25M)2Ag(s)+HgS(s) (b) The galvanic cell made from a half-cell consisting of an aluminum electrode in 0.015 M aluminum nitrate solution and a half—cell consisting of a nickel electrode in 025 M nickel(l) nitrate solution. (c) The cell made of a half-cell in which 1.0 M aqueous bromide is oxidized to 0.11 M bromine ion and a half-cell in which aluminum ion at 0.023 M is reduced to aluminum metal. Assume the standard reduction potential for Br2(l) is the same as that of Br2(aq).
What is wrong with the following statement: The best concentration cell will consist of the substance having the most positive standard reduction potential. What drives a concentration cell to produce a large voltage?
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Zn|Zn2+(0.50M)Cd2+(0.020M)|Cd (b) Cu|Cu2+(0.0010M)H+(0.010M)|H2(1.00atm)|Pt
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Cu|Cu+(0.80M)Hg22+(0.10M)|Hg|Pt (b) Cr|Cr3+(0.615M)Ni2+(0.228M)|Ni