Need help with number 9 please I appreciate it Equations With Energy 2028. (3-step conversion) How many kilocalories in 54.3 J9. (3-step conversion)How many kJ in157.4 cal ?EVALUATING EQUATIONS WITH ENERGY TE4 NH3 + 3 O2 2 N2 + 6 H20 (g) + -382 kJ/mol10. What side of the equation do we find AH ? TheThe reaction isbecause the sign of L11. MAP the above equation on a separate sheet of paper,to predict how many grams of water you can produce wi12. Using the same sort of reasoning, MAP the same equationpredict how many kJ of energy can be released by the bi

Answered: 9. (3-step conversion) How many kJ…

Science

Chemistry

9. (3-step conversion) How many kJ in157.4 cal ?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 24Q: The combustion of methane can be represented as follows: a. Use the information given above to...

See similar textbooks

Related questions

Q: 7- Given the following data: 2H2 (g) + C (s) → CH4 (g) 2H2 (g) + O2 (g)→ 2H2O (I) C (s) + O2 (g) →…

A: The required equation is : The given chemical equations are:

Q: A student Tuns twoexpermemts WitIT a Constant volume DOID CaloImeter CoTmta ng T1J00. g ur vwater…

Q: Q2. What is the total amount of calories needed to 1) heat 200.00 gf water from 21.5 °C to its…

A: Boiling point of water is 373 k or 100 degree celcius In first part we calculate the heat needed for…

Q: O LI* H -Н20 1. ? OH- heat 2. H2O a. b. C. d.

Q: If 46.1 g Zn (Cp=0.388 J/g°C) at 18.0 °C is placed in 80.0 g of water at 75.0 °C (Cp = 1.00…

Q: Yeong determined the AT for their 62.9874 g metal cylinder was -69.4 °C. They also determined that…

A: Given: For metal:mass, m1=62.9874gchange in temperature, ∆T1=-69.4∘C { -ive sign means heat is lost…

Q: Calorimeter Calibration 50 45 y = -0.44x + 45.86 40 A. 35 30 y = -0.35x + 34.533 Temperature 25 °C…

A: Given: Volume of water = 50 mL Time = 4 min From the calibration curve at 4 min, the temperature of…

Q: Draw the major product formed from the following elimination reactions.

A: The first reaction is

Q: stion 7 of 24 <. The specific heat of a certain type of metal is 0.128 J/(g.C). What is the final…

Q: If the initial temperature of 120. g of ethanol is 20. °C, what will be the fi nal temperature after…

A: Given : Heat energy added = 950 cal mass of ethanol = 120 g Initial temperature (T1) = 20°C

Q: Given that H2(g)+F2(g)⟶2HF(g) Δ?∘rxn=−546.6kJ 2H2(g)+O2(g)⟶2H2O(l) Δ?∘rxn=−571.6 kJ…

A: Some Basic Rule (1) If we multiply the any number in reaction then in the enthalpy ,that number is…

Q: )? in kJ, round to the nearest whole number, and leave out units.

Q: Consider the reaction A B with AH° = 15.3 kJ/molpm and the reaction B→ C with AH° = 91.3 kJ/molxn-…

A: •The desired reaction is, A→C ; ∆H° = ? • The given reactions are, (i) A →B ; ∆H1° =…

Q: 30) C,H;O ? OH H+ - heat

A: Malonic ester synthesis: In the given synthesis the intermediate compound is formed by the malonic…

Q: Convert 231 cal to kj

A: Conversion factor is the ratio that provides the relation between distinct units of the same…

Q: How do you convert 604 mK/s to K/s and micro Kelvin/ms?

A: Unit conversion problemHere we have to convert between temperature units.

Q: 7- Given the following data: 2H2 (g) + C (s) → CH4 (g) 2H2 (g) + O2 (g)→ 2H2O (I) C (s) + O2 (g) –→…

A: Given: 2H2 (g) + C(s) ----> CH4 (g) Delta G1o = -51 kJ 2H2 (g) + O2 (g) ----> 2H2O…

Q: How much heat is required to raise the temperature of 10.0 g of H2O (s) from -10 degrees C to H2O…

Q: 7- Given the following data: 2H2 (g) + C (s) → CH4 (g) 2H2 (g) + O2 (g) → 2H2O (I ) C (s) + O2 (g) →…

A: Given,

Q: mass

Q: 455 kJ to cal

Q: Use the molar heats of formations given under the formulas in equations [1] and [2] : [1] Mg(s)…

Q: heat N(CH3)3 OH H2N V NaN3, heat and then H20

A: Since we only answer up to 3 sub-parts, we'll answer the first three. Please resubmit the question…

Q: How much heat is required, in calories, to raise the temperature of 57.8 g of silver from 17.0°C to…

A: Given mass = 57.8 g initial temperature = 17.0°C Final temperature = 43.5°C specific heat capacity (…

Q: n enthalpy of the gas mixture pund your answer to 3 | kJ ? exothermic rmic or endothermic?…

A: We are given that Enthalpy of a mixture of a gases reactants Change in enthalpy==365KJ Where…

Q: What is the heat change when a 26.8 g sample of water [Cwater = 4.184 J/(g°C)] is cooled from 75.6°C…

A: The heat change can be calculated using the equation,

Q: you plan to melt some old gold jewelry so that you can make something new. when it is right at the…

A: Since you have asked multiple question, we will solve the first question for you. If youwant any…

Q: The specific heat of a certain type of metal is 0.128 J/(g⋅∘C).0.128 J/(g⋅∘C). What is the final…

A: Given data:

Q: Convert 7908 cal to kJ

A: Given: Energy in cal = 7908 cal.

Q: 11. A 44.0g sample of unknown metal at 99.0°C was placed in a calorimeter containing 80 g of H₂O at…

A: Concept According to Calorimetry heat lost is equal to heat gained by the cold body. Heat lost is…

Q: 1. Calculate AHf NI2 Oz given 2Ni Is) t 5 Ozlq) 7 Ni 2 O3 LS) mass of ca lorime tek SpeciPic heat of…

A: Hello.since the question contains multiple subparts the fisrt part is solved. in acse the solution…

Q: 7- Given the following data: 2H2 (g) + C (s) –→ CH4 (g) 2H2 (g) + O2 (g) → 2H2O (I) C (s) + O2 (g) →…

A: Given, The reaction with unknown free energy change is - Add the equation (2) and (3) and subtract…

Q: Convert 3.345MJ into pJ

Q: 2. What is the total number of calories needed to change the temperature of 50.0 grams of water by…

A: q = mc∆T q is the amount of heat energy needed m is the mass of substance c is the specific heat…

Q: If the ∆Hcomb of C4H10 = -2871 kJ/mol. What would be the final temperature of 850.0 mL of water at…

A: Given : ∆Hcomb of C4H10 = -2871 KJ/mol. Volume of water = 850.0 mL Initial temperature of water =…

Q: 6. (2-step conversion) How many J in 78.4 kJ ?

A: The amount of energy is = 78.4 kJ The value of this energy in J is =?

Q: The specific heat of a certain type of metal is 0.128 J/(g⋅∘C).0.128 J/(g⋅∘C). What is the final…

Q: 4.05 * 10^4 J to cal

A: 1 Cal = 4.184 J

Q: Consider the reaction A →B with AH° = 43.19 kJ/molxn and the reaction B → C with AH° = 81.98…

A: We know that according to Hess's law, the heat of reaction for a given reaction is the sum of the…

Q: Convert 3.345MJ into J

A: We know that , 1 Mega = 106 units 1 M = 106 units By using this relation we can convert the mega…

Q: The balanced combustion reaction for C6H6 is 2C6H6(l) + 15O2(g) yields to 12CO2(g) + 6H2O(l) +…

A: The balanced reaction given is 2C6H6(l) + 15O2(g) ----->12CO2(g) + 6H2O(l) + 6542 kJ. It is for 2…

Q: Given that H2(g)+F2(g)⟶2HF(g)ΔH∘rxn=−546.6 kJH2(g)+F2(g)⟶2HF(g)ΔHrxn°=−546.6 kJ…

A: Since by multiplying reaction 1 with 2 and subtracting reaction 2 from 2 X reaction 1, we will get…

Q: How much heat is required, in calories, to raise the temperature of 57.8 g of silver from 17.0C to…

A: Mass of silver (m) = 57.8 g Initial temperature (T1) = 17.0°C Final temperature (T2) = 43.5°C…

Q: 3. How much heat is required to raise the temperature of 10.0 g of H,O(s) from -10-C to H.O(1) at…

Question

100%

Need help with number 9 please I appreciate it

Equations With Energy 202
8. (3-step conversion) How many kilocalories in 54.3 J
9. (3-step conversion)
How many kJ in157.4 cal ?
EVALUATING EQUATIONS WITH ENERGY TE
4 NH3 + 3 O2 2 N2 + 6 H20 (g) + -382 kJ/mol
10. What side of the equation do we find AH ? The
The reaction is
because the sign of L
11. MAP the above equation on a separate sheet of paper,
to predict how many grams of water you can produce wi
12. Using the same sort of reasoning, MAP the same equation
predict how many kJ of energy can be released by the bi

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A student performing a calorimetry experiment combined 100.0 ml. of 0.50 M HCI and 100.0 ml. of 0.50 M NaOH in a StyrofoamTM cup calorimeter. Both solutions were initially at 20.0 C, but when the two were mixed, the temperature rose to 23.2 C (a) Suppose the experiment is repeated in the same calorimeter but this time using 200 mL of 0.50 M HCl and 200.0 ml of 0.50 M NaOH. WIII the AT observed be greater than, less than, or equal to that in the first experiment, and why? (b) Suppose that the experiment is repeated once again in the same calorimeter, this time using 100 mL of 1.00 M HCI and 100.0 ml. of 1.00 M NaOH. Will the T observed be greater than, less than, or equal to that in the first experiment, and why?
Define the standard enthalpy of formation. What are standard states for elements and for compounds? Using Hess's law, illustrate why the formula Hreaction=npHf(products)nfHf(reactants) works to calculate H for a reaction.
The overall reaction that occurs when sugar is metabolized is C12H22O11(s)+12O2(g)12CO2(g)+11H2O(l) For this reaction, H° is -5650 kJ and G° is -5790 kJ at 25°C. (a) If 25% of the free energy change is actually converted to useful work, how many kilojoules of work are obtained when one gram of sugar is metabolized at body temperature, 37°C? (b) How many grams of sugar would a 120-lb woman have to eat to get the energy to climb the Jungfrau in the Alps, which is 4158 m high? ( w=9.79103mh, where w= work in kilojoules, m is body mass in kilograms, and h is height in meters.)
The combustion of methane can be represented as follows: a. Use the information given above to determine the value of H for the combustion of methane to form CO2(g) and 2H2O(l). b. What is Hf for an element in its standard state? Why is this? Use the figure above to support your answer. c. How does H for the reaction CO2(g) + 2H2O (1) CH4(g) + O2(g) compare to that of the combustion of methane? Why is this?
Given the following data 2O3(g) 3O2(g)H = 427 kJ O2(g) 2O(g)H = 495 kJ NO(g) + O3(g) NO2(g) + O2(g)H = 199 kJ Calculate H for the reaction NO(g) + O(g) NO2(g)
Shown below is a diagram depicting the enthalpy change of a chemical reaction run at constant pressure. a Is the reaction exothermic or endothermic? b What is the sign of H? c What is the sign of q? d If the reaction does no work, what is the sign of E for this process?
A 5.00-g sample of aluminum pellets (specific heat capacity = 0.89 J/C g) and a 10.00-g sample of iron pellets (specific heat capacity = 0.45 J/C g) are heated to 100.0C. The mixture of hot iron and aluminum is then dropped into 97.3 g water at 22.0C. Calculate the final temperature of the metal and water mixture, assuming no heat loss to the surroundings.
How is the sign of q, heat, defined? How does it relate to the total energy of the system?
Explain in your own words what is meant by the term entropy. Explain how both matter spread and energy spread are related to the concept of entropy.