A 0.92 mol sample of PCI5 is put into a 2.00 L vessel and heated. At equilibrium, the vessel contains 0.50 mol of PCI3 and 0.50 mol of Cl2 Calculate the value of the equilibrium constant for the decomposition of PCI5 to PCI3 and Cl2 at this temperature.

A 0.92 mol sample of PCI5 is put into a 2.00 L vessel and heated. At equilibrium, the vessel contains 0.50 mol of PCI3 and 0.50 mol of Cl2 Calculate the value of the equilibrium constant for the decomposition of PCI5 to PCI3 and Cl2 at this temperature.

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 14.2QE: Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium...

See similar textbooks

Related questions

Q: 1000oC

Q: An equilibrium mixture contains 0.700 mol of each of the products (carbon dioxide and hydrogen gas)…

Q: At a certain temperature, 0.4811 mol of N, and 1.681 mol of H, are placed in a 2.50 L container.…

A: Given N2(g) + 3 H2(g) ----- > 2 NH3(g) Initial Moles of N2 = 0.4811 mole Initial Moles of H2 =…

Q: 2. Consider the reaction CO(g) CH3OH(g) 2H2(g) A reaction mixture in a 1.00L flask initially only…

A: Initial concentration of CO and H2 and also the concentration of CH3OH at equilibrium can be…

Q: 2NO(g) + Cl2(g) ⇄ 2NOCl(g) Kp = 1.4 x 107 0.60 atm NO and 0.70 atm Cl2 are placed in a…

A: Given: Kp = 1.4 × 107 Pressure of NO = 0.60 atm Pressure of Cl2 = 0.70 atm

Q: The following equilibrium was studied by analyzing the equilibrium mixture for the amount of HCl…

A: The equilibrium constant can be written as the ratio of concentration of products to the…

Q: Initially 2.0 moles of N2(g) and 4.0 moles of H2(g) were added to a 1.0-liter container and the…

A: Given,Moles of N2 = 2.0mol.Moles of H2 = 4.0mol.Equilibrium concentration of NH3 = 0.63mol/L.The…

Q: Sulfur dioxide and oxygen react to form sulfur trioxide during one of the key steps in sulfuric acid…

Q: How can we determine Concentrations of Unknown Species in an Equilibrium Mixture?

A: Equilibrium reaction is the one in which the reactants and the products are in equilibrium with each…

Q: 18. Consider the following reaction in which all reactants and products are gases: A + 2B 2C + D One…

A: Given: Initial moles of A = 1.0 mol Initial moles of B = 2.0 mol Moles of D at equilibrium = 0.50…

Q: Ammonia has been studied as an alternative "clean" fuel for internal combustion engines, since its…

A: Answer: Equilibrium constant for a reaction is the ratio of the active masses of products and…

Q: Consider the following reaction:PCl5(g) PCl3(g) + Cl2(g)If 7.03×10-4 moles of PCl5, 0.293 moles of…

A: The value of equilibrium constant KC can be calculated as follows-

Q: 4NH3(g) + 5O2(g) ⇌ 4NO(g) + 6H2O(g) A. 0.35 mol of NH3(g) is treated with 0.35 mol of O2(g) in a…

A: Ammonia reacts with oxygen to form nitrogen monoxide and water. The equation for the balanced…

Q: A mixture of 3 mol of N2, 1 mol of O2, and 0.1 mol of Ar is heated to 2400 K at a constant pressure…

A: Number of mole of N2 = 3 moles Number of mole of O2 = 1 mole Number of mole of Ar = 0.1 mol…

Q: Ammonia has been studied as an alternative "clean" fuel for internal combustion engines, since its…

Q: 7. A student places 0.272 mol of PC13(g) and 8.56 x 10-4 mol of PC15(2) into a 0.718-L flask at a…

Q: A 0.72-mol sample of PCl5 is put into a 1.00-L vessel and heated. At equilibrium, the vessel…

Q: The equilibrium constant, K, for the following reaction is 1.20x10-2 at 500 K. PCI5(g) PC13(g) +…

Q: Consider the reaction: 2 SO2 (g) + O2 (g) → 2 SO3 (g) 4.0 mol of SO2 and 2.2 mol of 02 were placed…

A: you have given - Initial amount of SO2 = 4 mol Initial amount of O2 = 2.2 mol Final mole of SO2 =…

Q: Carbon tetrachloride can be produced by the following reaction: Cs2(g) + 3 C2(g)2 S,C2(g) + CCI4(g)…

A: The given reaction in equilibrium is shown below. The moles of CS2 are 0.120 mol. The moles of…

Q: Phosphorous pentachloride decomposes according to the reaction PCl5(g)↽−−⇀PCl3(g)+Cl2(g) A 10.3…

Q: When doing calculations with an equilibrium constant, what units should the concentrations have? A.…

A: We have to predict correct units for equilibrium constant.

Q: At equilibrium, a 1.00 L flask contains: 0.750 mol of PCl5, 0.500 mol of H2O, 7.50 mol of HCl, and…

A: The equilibrium constant expression for the above reaction will be given by Kc = [HCl]2 X [POCl3] /…

Q: osphorus pentachloride decomposes according to the chemical equation PCI,(g) = PCI,(g) + Cl,(g) K. =…

A: Given : We have to calculate the equilibrium concentration of PCl5(g) and PCl3(g).

Q: Consider the equilibrium between SO2Cl2, SO2 and Cl2. SO2Cl2(g) SO2(g) + Cl2(g) K = 0.236 at…

A: Given data: [SO2Cl2] = 0.110 M [SO2] = 0.161 M [Cl2] = 0.161 M

Q: Bromine monochloride decomposes to form chlorine and bromine. 2BrCI(g) → Cl2(g) + Br2(g) At a…

Q: In an experiment, 0.120 mol of CS2 and 0.360 mol of Cl2 were placed in a 1.00-L flask at a…

A: K is the ratio of product of concentration of products raised to their stoichiometric coefficient…

Q: An equilibrium mixture contains 0.450 mol of each of the products (carbon dioxide and hydrogen gas)…

Q: At a certain temperature, 0.3011 mol of N2N2 and 1.501 mol of H2H2 are placed in a 2.50 L container.…

A: Answer:- This question is answered by using the simple concept of calculation of equilibrium…

Q: Phosphorus pentachloride decomposes according to the chemical equation PCI, (g) PCI, (g) + Cl,(g) K.…

Q: At a certain temperature, 0.3211 mol of N2 and 1.741 mol of H2 are placed in a 1.50 L container.…

A: Given that : Initial moles of N2 = 0.3211 mol Initial mole of H2 = 1.741 mol The volume of container…

Q: A 4.80 mol4.80 mol sample of solid AA was placed in a sealed 1.00 L container and allowed to…

A: The equilibrium constant of given reaction is calculated as,

Q: The equilibrium constant, K, for the following reaction is 9.23x10-3 at 304 K. NH4HS(s) NH3(g) +…

Q: A 0.72-mol sample of PCl5 is put into a 1.00 L vessel and heated. At equilibrium, the vessel…

A: Since you have posted multiple questions, we are entitled to answer the first only.

Q: 1. Sulfur trioxide decomposes spontaneously to form sulfur dioxide and oxygen gases according to the…

A: Answer: Le-chatalier's principle on changing any parameter of the system that is in equilibrium then…

Q: The equilibrium constant for the reaction of chlorine gas with phosphorus trichloride to form…

A: The reaction's chemistry at equilibrium can be examined through equilibrium constant. It relates the…

Q: 2. When 4.00 mol ofA and 4.00 mol of B are mixed are mixed in a liter container and allowed to come…

A: Given : The reaction : A(g) + 3B (g) → C (g) + D (g) Find : The equilibtium constant of the…

Q: Ammonia has been studied as an alternative "clean" fuel for internal combustion engines, since its…

Q: Considering the following problem, What is the value of the equilbrium constant in terms of…

A: Given: Volume = 10.00 L Temperature = 297.8 K Number of moles = 0.4223 moles. Chemical reaction:

Q: Have each group member explain to the group what happens if a system at equilibrium is subject to…

A: Le Chatelier’s principle states that if there is a change in temperature, pressure or concentration…

Q: Consider the equilibrium systern described by the chemical reaction below, which has a value of Kc…

Q: - A mixture of CO and Cl, is placed in a reaction flask that is then sealed. Initially (CO) -0.0102…

A: Given equation: CO (g) + Cl2 (g) ⇌ COCl2 (g) The initial concentration of CO = 0.0102 mol/L The…

Q: How many moles of carbon dioxide would have to be added at constant temperature and volume to…

Q: At a certain temperature, 0.3011 mol of N2 and 1.721 mol of H2 are placed in a 2.00 L container.…

A: Given equilibrium mole of N2 is 0.1401

Q: Sulfur dioxlde and oxygen react to form sulfur trloxide during one of the key steps In sulfuric acld…

A: SO2 reacts with O2 to form SO3 as per the equation 2SO2(g) + O2(g) <-----> 2SO3(g) Given ,…

Q: Consider the reaction: 2 HI(g) yields H2(g) + I2(g) where K=46.5. In an experiment, 0.5…

A: 2HI(g)↽−−⇀H2(g)+I2(g) Kc=46.5 Moles of HI =0.5 mol Moles of H2 =…

Q: Ammonia has been studied as an alternative "clean" fuel for internal combustion engines, since its…

A: Given data : Initial moles of NH3 = 4.8 mol Initial moles of O2 =3.3 mol EEquilibrium moles of H2O =…

Q: Initially 2.0 moles of N2(g) and 4.0 moles of H2(g) were added to a 1.0-liter container and the…

A: Equilibrium constant is the ratio of concentration of product to the concentration of reactant. Kc=…

Question

A 0.92 mol sample of PCI5 is put into a 2.00
L vessel and heated. At equilibrium, the
vessel contains 0.50 mol of PCI3 and 0.50
mol of Cl2. Calculate the value of the
equilibrium constant for the decomposition
of PCI5 to PCI3 and Cl2 at this temperature.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Which of the systems described in Exercise 13.15 give homogeneous equilibria? Which give heterogeneous equilibria?
Which of the systems described in Exercise 13.16 give homogeneous equilibria? Which give heterogeneous equilibria?
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?
Hard water has a high concentration of calcium and magnesium ions. Focusing on the calcium ion, a common home water -softening process is based on a reversible chemical change that can be expressed by Na2Ze(s)+Ca2+(aq)CaZe(s)+2Na+(aq). Na2Ze represents a solid resin that is like an ionic compound between sodium ions and zeolite ions, a complex arrangement of silicate and aluminate groups; CaZe is the corresponding calcium compound. When, during the day, is this system most likely to reach equilibrium? Why doesnt it reach equilibrium and stay there? Periodically it is necessary to recharge the water softner by running salt water, NaCl(aq), through it. Why is this necessary? What concept is discussed in this chapter does the recharging process illustrate? Zeolite ions are used in home water softners because they have a porous but rigid structure that is weakly attracted to cations, readily allowing an exchange among different ions.
. At high temperatures, elemental nitrogen and oxygen react with each other to form nitrogen monoxide. N2(g)+O2(g)2NO(g)Suppose the system is analyzed at a particular temperature, and the equilibrium concentrations arc found to be [N2]=0.041M. [O2]=0.0078M, and [NO]=4.710M. Calculate the value of K for the reaction.
Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were allowed to react at 300. K. At equilibrium the total pressure was 110.5 torr. The reaction is 2NO(g)+Br2(g)2NOBr(g) a. Calculate the value of Kp. b. What would be the partial pressures of all species if NO and Br2, both at an initial partial pressure of 0.30 atm, were allowed to come to equilibrium at this temperature?
Equilibrium exists between butane and isobutane when [butane] = 0.020 M and [isobutane] = 0.050 M. An additional 0.0200 mol/L of isobutane is added to the mixture. What are the concentrations of butane and isobutane after equilibrium has again been attained?
The density of trifluoroacetic acid vapor was determined at 118.1 C and 468.5 torr, and found to be 2.784 g/L. Calculate KC for the association of the acid.
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
Nitrogen, hydrogen, and ammonia are in equilibrium in a 1000-L reactor at 550 K. The concentration of N2 is 0.00485 M, H2 is 0.022 M, and NH3 is 0.0016 M. The volume of the container is halved, to 500 L. (a) Calculate the equilibrium constant. (b) Define y as the change in the concentration of nitrogen in the 500-L container. Is y positive or negative? (c) Write the iCe table and express the equilibrium constant in a polynomial in terms of y.