A four coordinate complex MA2B2 is prepared and found to have two different isomers possible to determine from this information whether the complex is square planar or ____ if so, which is it?

Q: Which of the following is correct about Mn(CO).NO? i. The complex is paramagnetic and follows 18…

A: Which of the following is correct about Mn(CO)4NO?

Q: Consider an octahedral complex MA3B3. How many geometric isomers are expected for this compound?…

A: Isomerism-molecules with same molecular formula but different structural formula called as isomers…

Q: Which of the following compounds is expected to have the lowest K₂ (complex dissociation constant)?…

A: A multiple choice question based on coordination complexes that is to be accomplished.

Q: Naz[Fe(CN)4(en)] The complex ion of this compound is known to be diamagnetic. Draw the d-orbital…

A:

Q: [Cr(H2O)6] 2+ is violet. Another CrL6 complex is green. Can ligand L be CN-? Can it be Cl-? Explain.

A: The octahedral splitting energy of transition elements is the difference in the energy of the…

Q: Which complex ion includes a bond angle of 107°? A [Cr(NH;),J** B [CuCl,] C [CuClj?- D [Cr(H,O),1*

A: The Complex [CuCl4]2- exists in a discrete tetrahedral shape. Its crystal structure is taken from…

Q: By using valence bond theory and ligand field theory, prove that [Ru(OMe)2(PMe:)4] is a paramagnetic…

A:

Q: 4) The complex [Cr(OH2)3BrClI] has 4 possible isomers. Draw each of them.

A: In this question, we will draw the structure of all Four possible isomers.  You can see details…

Q: What would you expect the coordination sphere for the complex ion formed from Ni^2+ and…

A: In coordination chemistry, the first coordination sphere refers to the array of molecules and ions…

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which a metal atom or ion forms coordinate bonds with the…

Q: • Name these coordination complexes: •a. Cr(NH3);Cl3 •b. Pt(en)Cl, • . [Pt(ox),]? а. С.

A: a. Given, Cr(NH3)3Cl3  Name => Triamminetrichloridochromate(III)

Q: Consider the coordination complex [Cr(OH2)3CI3]Br3 Identify the ligands by name (include the word…

A: Given complex--- [Cr(OH2)3Cl3]Br3

Q: [FeL6]* complex (L indicates a monodentate ligand) has a magnetic moment of approximately 1.73 B.M.…

A:

Q: According to the Crystal field theory (CFT), Draw the d-orbital splitting diagram for the following…

A: As we know, according to crystal field theory, the interaction between a central metal and an…

Q: Consider [Co(CI)6]* and [Co(NH3)6]3* ions. i. Illustrate the energy level splitting diagram for both…

A:

Q: What is the possible number of isomers of the OsO4py complex?

A: In complex OsO4py has four O = ligands and one Py ligand . Thus structure of the complex is square…

Q: Is this complex K3[Fe(C2O4)3].3H2O paramagnetic or diamagnetic, explain?

A: We will discuss whether this  complex K3[Fe(C2O4)3].3H2O  is paramagnetic or diamagnetic.

Q: octahedral complex is found to absorb visible light, with the absorption maximum occurring at 507…

A: The absorption with maximum wavelength by an electron is equal to the energy difference between…

Q: which of these complexes will show geometrical isomerism: a  MA2X2 b  MA2XY c  MABCY d  All of these

A: Geometric isomerism:Two or more compounds with the same formula but are having different…

Q: a. Compounds 1 and 2 are complex ions of cobalt. 2+ 2+ NH2 H2 PME2 Me2 H,N. H,N NH, H2 Me,P. Me,P…

A:

Q: The complex [Fe(en) 2Cl2]Cl is low spin   Is the compound optically active? Explain your answer

A:

Q: Would you expect the complex [Cu(NH3)4(H2O)2]2+ to have isomers? If yes, what isomers would exist?

A: Yes there will be isomers of the complex [Cu(NH3)4(H2O)2]2+  this is because the H2O ligands can be…

Q: Is this complex [Co(NH3)5Cl]CI2 paramagnetic or diamagnetic, explain?

A: Diamagnetic or paramagnetic nature of compound. If metal contains unpaired electrons then compound…

Q: Write down the IUPAC name of the complex [Co(en)2Cl2]+. What type of isomerism is shown by this…

A: Coordination compounds are those compounds which are made by the transfer of electrons from ligands…

Q: How many unpaired electrons are in the low-spin octahedral complex [Co(CN),Jª¯? Provide your answer…

A: The no. Of unpaired electron in given complex = 1 (one).

Q: 2. Sketch and name two geometrical isomers of [Cr(NH3)2(CO)4]2+ () Is this compound paramagnetic or…

A:

Q: Write the IUPAC name of the complex [Cr(NH3)4Cl2]+. What type of isomerism does it exhibit?

A: IUPAC name for [Cr(NH3)4Cl2]+ is tetraaminedichlorochromium (III)

Q: How many isomers are possible for a tetrahedral complex [MA2BC]? а. О b b. 2 a с. 4

A: The number of isomers in tetrahedral complex having formula MA2BC are calculated as follows,

Q: or the following coordination complex (Mn(C204)(H20)2C13} Sive the name diaquatrichloridooxalatomang…

A:

Q: Strong Jahn Teller distortion cannot be observed in the following octahedral complexes. A) Cr(II) в)…

A: ⊙ In octahedral complex Strong Jahn Teller distortion occur when 'eg' orbital     orbital…

Q: The effective atomic number of the [Co (en) 3] Cl3 complex is 36, and the complex obeys this rule.…

A: EAN i.e. effective atomic number rule is number of electrons surrounding to Central metal atom in…

Q: <p>Hexacyanomanganate(III) ion is a low-spin complex. Draw the crystal field splitting diagram…

A: Hexacyanomanganate (III) ion is a low spin complex because of the presence of cyano ligand, a strong…

Q: When a certain weak-field ligand forms an octahedral complex with Coʻ 2+ cation, the energies of the…

A: We have find out the unpaired electrons,  nature and colour of octahedral complex.

Q: How many stereoisomers does the octahedral complex [Ni(bipy)2BR2] have? How many of these…

A: Given compound is [Ni(bipy)2Br2].

Q: When a coordination compound CrCl3.6H2O is mixed with AgNO3 solution, 3 moles of AgCl are…

A: When a coordination compound CrCl3.6H2O is mixed with AgNO3 solution, 3 moles of AgCl are…

Q: Does the term ‘labile’ imply that a complex is thermodynamically unstable? Does the term ‘inert’…

A: Henry Taube was the first to classify the compounds in terms of lability . He compared the factors…

Q: Coordination complexes

A: In this question we have to explain that the following statement is true or false, coordination…

Q: The complex [FeL2X2] {where L = 1,10-phenanthroline and X = thiocyanate} gives a magnetic moment,…

A: The answer of the question is given below:

Q: The following neutral molecules or ionic species are considered: CIo, CNO, NH3, O2, CH4,…

A: Coordinate complex is form by the coordinate covalent bond. In coordinate covalent bond the central…

Q: The complex (Fe(H,O)]* is paramagnetic. Is the H,0 ligand inducing a strong or weak field?

A: The coordination complex is the compound that does not lose its identity in the solution. The…

Q: Consider the following set of complexes Co(NH3)5CO3]NO3] (1 [Cr(acac)3] (2 Co(NH3)4C12]CIj (3…

A: Option 3rd is the answer. Because, [Co(NH3)4Cl2]Cl has 2 geometrical isomers , which are cis and…

Q: The effective atomic number of the [Co (en) 3] Cl3 complex is 36, and the complex obeys this rule.…

A: According to the effective Atomic Number (EAN) rule, if a coordination compound contains total of…

Q: What was the test that could used to determine the oxalate concentration in this complex?

A: A coordination complex is the result of a Lewis acid-base reaction in which neutral molecules or…

Q: What type of isomerism is shown by each of the following complexes: (i) [Pt(NH3)2Cl2] (ii)…

A: Isomers are molecules or polyatomic ions with identical molecular formulas that is, same number of…

Q: The octahedral complex ion [Co(NH3)6]** has fewer unpaired spins than the octahedral complex ion…

A:

Q: There are A.______ unpaired d electrons present in the [Mo(NH3)4Cl2]2+ complex, which is a low spin…

A:

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.