a) N2(g) + O2(g) 2NO (g) ∆H298 = + 180 kJ mol-1 From the equilibrium shown above, use Le Chatelier’s Principle to decide what happens to the equilibrium position by: Increasing the concentration of NO Increasing the pressure Increasing the temperature Increasing the concentration of N2 Adding a catalyst

Q: Draw formulas that illustrate the hydrogen bonding that may exist between two polyamide molecules…

A: Polyamide molecule To show: The hydrogen bonding that may exist between two polyamide molecules…

Q: H₂C- -B(OH)2 + Br -CH₂OH cat. Pdº NaOH THF

A: The given reaction is an example of Suzuki coupling reaction that is it is coupling between boronic…

Q: Be sure to answer all parts. For the reaction depicted in the molecular scenes, X is red and Y is…

A:

Q: 3) What defines the atomic number of an element? a. The number of shells b. The number of neutrons…

A:

Q: What is the correct K, expression for the given reaction? 2H₂ (g) + O2 (g) 2H₂O(g) [2H₂0] [2H₂][0₂]…

A: The equilibrium constant, Kc, is the ratio of the equilibrium concentrations of products over the…

Q: There is 21.0 g of carbon dioxide gas stored in a cylinder with a volume of 15.0. A pressure gauge…

A:

Q: 14.42 Give an acceptable name (IUPAC or common) for each ether. OCH 3 a. CH3OCH₂CH₂CH3 b. C. -OCH 3

A: According to the IUPAC nomenclature, First longest chain of carbon atom is identified. Numbering is…

Q: 8. Which of these compounds reacts most rapidly under the following conditions? RBr a. KOt-Bu…

A:

Q: What is the IUPAC name of the following? стравотат CH3 Submit Answer Retry Entire Group Important…

A:

Q: The half-life of a radioactive sample is 60.0 y. If the sample weighs 0.893 g initially, how much…

A:

Q: You discover a new element with a molar mass of 319.0 g/mol. How many atoms are contained in 97.9…

A:

Q: Provide the isomers of Vanillin (C8H8O3) and explain how we are sure which isomer the HNMR and CNMR…

A: The isomers of Vanillin (C8H8O3)                  To get the correct structure from the isomers we…

Q: Consider the reaction A → B with ΔS° = 78.900 J/(K·molrxn). What should be the ΔS° in J/(K·molrxn)…

A: When the reaction is reversed, the sign of the entropy will be changed.

Q: Consider the synthesis of aspirin shown below. Explain why an old bottle of aspirin might smell…

A: acetyl salicylic acid is called aspirin. Vinegar: The aqueous solution of acetic acid( CH3COOH) is…

Q: How many hydrogen bond/s are shown in the picture below. ни X 4—C—4... № н c- n ...O 1 Question 8 O…

A: We have to answer about the types of intermolecular forces.   N.B.: According to the Bartleby…

Q: A chemistry class is investigating contamination in different sources of water and discovers that…

A: Data :-

Q: 5) Using the Born-Haber cycle, the AH°f of KBr is equal to A) AH°f [K (g)] - AH°f [Br (g)] - I1(K) -…

A: we have to determine ∆Hfo of KBr

Q: Are there thiols or sulfides in the picture? If so, point them out and state which compounds they…

A:

Q: 10.0 g of a metal chloride salt is dissolved in 90.0 g H2O. This solution has a vapor pressure that…

A: Answer: Raoult's law states that when a non-volatile solute is dissolved in a solvent, it causes a…

Q: Using curved arrow notation, write a detailed, stepwise mechanism for the reaction below. Лон +…

A:

Q: Predict the MAJOR product of the following reaction: A H3C 1) NaOEt in EtOH S. OEt 2) 3) H₂O*, heat…

A: Enolate is used to form a new C-C bond in the product.

Q: Draw the Lewis structures and determine which of these molecules has a central atom that violates…

A: Octet Rule:…

Q: B) Linolenic acid has cis double bonds with the formula CH3CH2CH=CHCH2CH=CHCH2CH-CH(CH2)7COOH. Write…

A: This problem is based on naming of fatty acids.

Q: Explain the step by step process occruing here

A: The reaction is between the 4- amino benzaldehyde and 2,4-dihydroxy benzaldehyde. That means this is…

Q: You are given the following related reactions and the corresponding enthalpy changes. 1. 2. 2(g)…

A:

Q: NO₂ .NO ₂ 2 •H ноду нао O₂N. O₂N₂ H

A: Robinson Annulation is a 1,4 addition type of reaction. After that 1,2 addition is taking place with…

Q: It takes 49.0 J to raise the temperature of an 10.2 g piece of unknown metal from 13.0°C to 24.0 °C.…

A:

Q: how does the composition and structure of metal alloys, polymers and polymer matrix composites…

A: The composition and structure of metal alloys, polymers, and polymer matrix composites have a…

Q: 5) What of the following is false about water? a. Water contains no H* or OH ions b. Water has a pH…

A: The question is based on the concept of pH of the solution.  it is defined as a negative logarithm…

Q: HO OCH3 te - 2e с Ho осн (M+ = 152) Molecular ion но +h' оснз (m/2=(51) Base peak

A: Given compound is m-methoxy, p-hydroxy benzaldehyde. First step of the reaction is ionization of the…

Q: In the contact process:                                                                        DH =…

A: According to Le-Chatelier's principle when factors like concentration, pressure, temperature, inert…

Q: H₂(g) + I2 (s) 2HI(g) Calculate Ke for the above reaction using the equilibrium concentrations…

A: H2 (g)   +  I2 (s)   ⇌    2 HI (g) Equilibrium concentration of H2 = H2 = 0.019 MEquilibrium…

Q: 0.98 g of naphthalene (a non-electrolyte) is dissolved in 21.40 g of cyclohexane (solvent). The…

A: mass of solute (naphthalene) = 0.98 g mass of solvent (cyclohexane) = 21.4 g freezing point of…

Q: The reaction of sodium with chlorine to produce table salt, sodium chloride, has a ΔH = -411 kJ/mol.…

A: Reaction of sodium and chlorine to produce sodium chloride, with ΔH = -411 kJ/mol.    Inital…

Q: A 20.0 g sample of polyisoprene, which has a specific heat capacity of 1.880 J-gc, is dropped into…

A:

Q: Predict the MAJOR organic product of the following reaction sequence. H3C H 1) LDA in THF 2) H3C 3)…

A:

Q: A 2.501 g sample of unknown metal chloride compound was reacted with excess silver nitrate resulting…

A: Mass of unknown sample of metal chloride =2.501 g Mass of silver chloride precipitate = 1.184 g We…

Q: Please write following half cell reactions and their Nernst equations. 2IO4- + 22I- + 16H+ ----->…

A:

Q: Which carbon would be assigned to the chemical shift at 18.5 C4 ppm? OH C3 CH3 O C1 C2

A: The chemical shift for the sp3 hybridised carbon atom is approximately 10 to 40 ppm. And the…

Q: The oxidation number of aluminum in Al³+ is

A: Oxidation state or oxidation number is a measure of the number of electrons that an atom has gained…

Q: 17. 8.63 grams of aluminum nitrate is dissolved in 100 mL of ethanol. Calculate the freezing point…

A: Mass of Al(NO3)3 = 8.63 gDensity of ethanol = 0.789 g/mLThe freezing point of ethanol = -117.3°C

Q: Draw the product(s) 1. NaNH2 2. sec-butyl iodide 3. Na, liquid NH3

A:

Q: Liquid octane (CH₂(CH₂) CH₂) will react with gaseous oxygen (O₂) to produce gaseous carbon dioxide…

A:

Q: Which salts will be more soluble in an acidic solution than in pure water? Cul CaSO4 KCIO4 Be(OH)2…

A:

Q: If a current of 11 A passes through an electrolytic cell for 2.9 hours, how many moles of electrons…

A:

Q: If a sample of a certain solution is determined to have a [H3O+] concentration of 9.56 x 10…

A:

Q: Explain the step by step process occuring here

A: This is reaction between 2,4- dihydroxy benzaldehyde and 4- Nitro acetophenone. That means this is…

Q: Be sure to answer all parts. Consider the following balanced redox reaction (do not include state of…

A:

Q: Consider the balanced reaction 4 A + 8 B → 5 C + 6 D and the absolute entropies provided in the…

A: 4 A + 8 B → 5 C + 6 D ∆Srxn0 = -633.7 J/K.molrxn Compound S° (J/(mol·K)) A -48.8 B -89.1 C…

Q: 2. If 50. mL of 0.00015 M CaCl₂ are mixed with 25. mL of 0.0034 M NaF will a precipitate form? The…

A: we have to determine if a precipitate will be formed or not